Inhibitors and Activators
Showing 1000 of 56287 products meeting your criteria.
| ID | Code | Name | Supplier | |
|---|---|---|---|---|
| 1695836 | TAR-T17544 | Biotin-amido-PEG4-PFP ester | TargetMol | |
| 1695835 | TAR-T17543 | BI-3663 | TargetMol | |
| 1695834 | TAR-T17542 | Benzyl-N-bis(PEG3-Boc) | TargetMol | |
| 1695833 | TAR-T17541 | Benzaldehyde-PEG4-azide | TargetMol | |
| 1695832 | TAR-T17540 | BCN-SS-NHS | TargetMol | |
| 1695831 | TAR-T17539 | BCN-SS-amine | TargetMol | |
| 1695830 | TAR-T17538 | BCN-PEG4-Ts | TargetMol | |
| 1695829 | TAR-T17537 | BCN-PEG4-OH | TargetMol | |
| 1695828 | TAR-T17536 | BCN-PEG4-NHS ester | TargetMol | |
| 1695827 | TAR-T17535 | BCN-PEG4-hydrazide | TargetMol | |
| 1695826 | TAR-T17534 | BCN-PEG4-alkyne | TargetMol | |
| 1695825 | TAR-T17533 | BCN-PEG4-acid | TargetMol | |
| 1695824 | TAR-T17532 | BCN-PEG3-VC-PFP ester | TargetMol | |
| 1695823 | TAR-T17531 | BCN-PEG3-Val-Cit | TargetMol | |
| 1695822 | TAR-T17530 | BCN-PEG3-oxyamine | TargetMol | |
| 1695821 | TAR-T17529 | BCN-PEG3-Biotin | TargetMol | |
| 1695820 | TAR-T17528 | BCN-PEG1-Val-Cit-PABC-OH | TargetMol | |
| 1695819 | TAR-T17527 | BCN-PEG1-Val-Cit-OH | TargetMol | |
| 1695818 | TAR-T17526 | BCN-?exo-?PEG3-?NH2 | TargetMol | |
| 1695817 | TAR-T17525 | Azidoethyl-SS-propionic NHS ester | TargetMol | |
| 1695816 | TAR-T17524 | Azidoethyl-SS-propionic acid | TargetMol | |
| 1695815 | TAR-T17523 | Azido-PEG9-NHS ester | TargetMol | |
| 1695814 | TAR-T17520 | Azido-PEG8-hydrazide | TargetMol | |
| 1695813 | TAR-T17519 | Azido-PEG7-azide | TargetMol | |
| 1695812 | TAR-T17518 | Azido-PEG6-azide | TargetMol | |
| 1695811 | TAR-T17517 | Azido-PEG5-triethoxysilane | TargetMol | |
| 1695810 | TAR-T17516 | Azido-PEG5-maleimide | TargetMol | |
| 1695809 | TAR-T17514 | Azido-PEG4-nitrile | TargetMol | |
| 1695808 | TAR-T17513 | Azido-PEG4-amido-PEG4-Boc | TargetMol | |
| 1695807 | TAR-T17512 | Azido-PEG36-Boc | TargetMol | |
| 1695806 | TAR-T17511 | Azido-PEG36-alcohol | TargetMol | |
| 1695805 | TAR-T17510 | Azido-PEG36-acid | TargetMol | |
| 1695804 | TAR-T17509 | Azido-PEG35-amine | TargetMol | |
| 1695803 | TAR-T17508 | Azido-PEG3-Sulfone-PEG4-Boc | TargetMol | |
| 1695802 | TAR-T17507 | Azido-PEG3-Sulfone-PEG4-acid | TargetMol | |
| 1695801 | TAR-T17506 | Azido-PEG3-SSPy | TargetMol | |
| 1695800 | TAR-T17505 | Azido-PEG3-SS-NHS | TargetMol | |
| 1695799 | TAR-T17504 | Azido-PEG3-S-PEG4-t-butyl ester | TargetMol | |
| 1695798 | TAR-T17503 | Azido-PEG3-S-PEG4-propargyl | TargetMol | |
| 1695797 | TAR-T17502 | Azido-PEG3-S-PEG3-azide | TargetMol | |
| 1695796 | TAR-T17500 | Azido-PEG3-amide-C3-triethoxysilane | TargetMol | |
| 1695795 | TAR-T17499 | Azido-PEG24-NHS ester | TargetMol | |
| 1695794 | TAR-T17498 | Azido-PEG24-Boc | TargetMol | |
| 1695793 | TAR-T17497 | Azido-PEG24-alcohol | TargetMol | |
| 1695792 | TAR-T17496 | Azido-PEG24-acid | TargetMol | |
| 1695791 | TAR-T17495 | Azido-PEG23-amine | TargetMol | |
| 1695790 | TAR-T17494 | Azido-PEG20-alcohol | TargetMol | |
| 1695789 | TAR-T17493 | Azido-PEG2-C2-Boc | TargetMol | |
| 1695788 | TAR-T17491 | Azido-PEG16-NHS ester | TargetMol | |
| 1695787 | TAR-T17490 | Azido-PEG16-Boc | TargetMol | |
| 1695786 | TAR-T17489 | Azido-PEG16-acid | TargetMol | |
| 1695785 | TAR-T17488 | Azido-PEG15-t-butyl ester | TargetMol | |
| 1695784 | TAR-T17487 | Azido-PEG15-azide | TargetMol | |
| 1695783 | TAR-T17485 | Azido-PEG12-Boc | TargetMol | |
| 1695782 | TAR-T17481 | Azido-PEG11-acid | TargetMol | |
| 1695781 | TAR-T17480 | Azido-PEG10-NHS ester | TargetMol | |
| 1695780 | TAR-T17479 | Azido-PEG10-Boc | TargetMol | |
| 1695779 | TAR-T17478 | Azido-PEG1-Val-Cit-OH | TargetMol | |
| 1695778 | TAR-T17477 | Azido-PEG1-CH2COO-Cl | TargetMol | |
| 1695777 | TAR-T17475 | Azido-C3-UV-biotin | TargetMol | |
| 1695776 | TAR-T17474 | Azide-PEG9-amido-C8-Boc | TargetMol | |
| 1695775 | TAR-T17473 | Azide-PEG9-amido-C4-Boc | TargetMol | |
| 1695774 | TAR-T17472 | Azide-PEG9-amido-C16-Boc | TargetMol | |
| 1695773 | TAR-T17471 | Azide-PEG9-amido-C12-Boc | TargetMol | |
| 1695772 | TAR-T17470 | Azide-PEG6-amido-C16-Boc | TargetMol | |
| 1695771 | TAR-T17469 | Azide-PEG3-Sulfone-PEG3-azide | TargetMol | |
| 1695770 | TAR-T17468 | Azide-PEG3-L-alanine-Fmoc | TargetMol | |
| 1695769 | TAR-T17467 | Azide-PEG2-Ms | TargetMol | |
| 1695768 | TAR-T17466 | Azide-PEG16-alcohol | TargetMol | |
| 1695767 | TAR-T17463 | Azide-PEG-azide (MW 5000) | TargetMol | |
| 1695766 | TAR-T17462 | Azide-PEG-azide (MW 20000) | TargetMol | |
| 1695765 | TAR-T17461 | Azide-PEG-azide (MW 2000) | TargetMol | |
| 1695764 | TAR-T17460 | Azide-PEG-azide (MW 10000) | TargetMol | |
| 1695763 | TAR-T17459 | Azide-PEG-amine (MW 5000) | TargetMol | |
| 1695762 | TAR-T17458 | Azide-PEG-amine (MW 3500) | TargetMol | |
| 1695761 | TAR-T17457 | Azide-PEG-amine (MW 2000) | TargetMol | |
| 1695760 | TAR-T17456 | Azide-PEG-alcohol (MW 2000) | TargetMol | |
| 1695759 | TAR-T17455 | AZD-CO-C2-Ph-amido-Ph-azide | TargetMol | |
| 1695758 | TAR-T17453 | APN-PEG4-tetrazine | TargetMol | |
| 1695757 | TAR-T17452 | APN-PEG4-PFP | TargetMol | |
| 1695756 | TAR-T17451 | APN-PEG4-DBCO | TargetMol | |
| 1695755 | TAR-T17450 | APN-PEG4-BCN | TargetMol | |
| 1695754 | TAR-T17449 | APN-PEG4-Amine hydrochloride | TargetMol | |
| 1695753 | TAR-T17448 | AmPEG6C2-Aur0131 | TargetMol | |
| 1695752 | TAR-T17447 | Aminoxyacetamide-PEG3-azide | TargetMol | |
| 1695751 | TAR-T17446 | Aminooxy-PEG-OH (MW 2000) | TargetMol | |
| 1695750 | TAR-T17445 | Aminooxy-amido-PEG4-propargyl | TargetMol | |
| 1695749 | TAR-T17444 | Amino-Tri-(m-PEG4-ethoxymethyl)-methane | TargetMol | |
| 1695748 | TAR-T17443 | Amino-SS-PEG12-acid | TargetMol | |
| 1695747 | TAR-T17442 | Amino-PEG9-amido-C16-Boc | TargetMol | |
| 1695746 | TAR-T1744 | Compound T1744 | TargetMol | |
| 1695745 | TAR-T17439 | Amino-PEG6-Thalidomide | TargetMol | |
| 1695744 | TAR-T17438 | Amino-PEG6-amido-C16-COOH | TargetMol | |
| 1695743 | TAR-T17437 | Amino-PEG6-amido-C16-Boc | TargetMol | |
| 1695742 | TAR-T17436 | Amino-PEG6-amido-bis-PEG5-N3 | TargetMol | |
| 1695741 | TAR-T17435 | Amino-PEG4-Val-Cit-PAB-MMAE | TargetMol | |
| 1695740 | TAR-T17434 | Amino-PEG4-benzyl ester | TargetMol | |
| 1695739 | TAR-T17433 | Amino-PEG36-CONH-PEG36-acid | TargetMol | |
| 1695738 | TAR-T17432 | Amino-PEG36-CH2-Boc | TargetMol | |
| 1695737 | TAR-T17431 | Amino-PEG36-Boc | TargetMol | |
| 1695736 | TAR-T17430 | Amino-PEG36-alcohol | TargetMol | |
| 1695735 | TAR-T17429 | Amino-PEG36-acid | TargetMol | |
| 1695734 | TAR-T17428 | Amino-PEG32-acid | TargetMol | |
| 1695733 | TAR-T17427 | Amino-PEG3-SS-acid | TargetMol | |
| 1695732 | TAR-T17426 | Amino-PEG28-acid | TargetMol | |
| 1695731 | TAR-T17425 | Amino-PEG27-amine | TargetMol | |
| 1695730 | TAR-T17424 | Amino-PEG25-acid | TargetMol | |
| 1695729 | TAR-T17423 | Amino-PEG24-CH2-Boc | TargetMol | |
| 1695728 | TAR-T17422 | Amino-PEG24-Boc | TargetMol | |
| 1695727 | TAR-T17421 | Amino-PEG24-alcohol | TargetMol | |
| 1695726 | TAR-T17420 | Amino-PEG24-acid | TargetMol | |
| 1695725 | TAR-T17419 | Amino-PEG23-amine | TargetMol | |
| 1695724 | TAR-T17418 | Amino-PEG23-acid | TargetMol | |
| 1695723 | TAR-T17417 | Amino-PEG20-Boc | TargetMol | |
| 1695722 | TAR-T17416 | Amino-PEG20-acid | TargetMol | |
| 1695721 | TAR-T17415 | Amino-PEG16-acid | TargetMol | |
| 1695720 | TAR-T17414 | Amino-PEG15-amine | TargetMol | |
| 1695719 | TAR-T17412 | Amino-PEG14-acid | TargetMol | |
| 1695718 | TAR-T17410 | Amino-PEG12-CH2COOH | TargetMol | |
| 1695717 | TAR-T17409 | Amino-PEG12-CH2-Boc | TargetMol | |
| 1695716 | TAR-T17404 | Amino-PEG11-CH2COOH | TargetMol | |
| 1695715 | TAR-T17403 | Amino-PEG10-CH2-Boc | TargetMol | |
| 1695714 | TAR-T17401 | Amino-bis-PEG3-TCO | TargetMol | |
| 1695713 | TAR-T17400 | Amine-PEG-thiol (MW 5000) | TargetMol | |
| 1695712 | TAR-T17399 | Amine-PEG-thiol (MW 3400) | TargetMol | |
| 1695711 | TAR-T17398 | Amine-PEG-thiol (MW 2000) | TargetMol | |
| 1695710 | TAR-T17396 | Amine-PEG-CH2COOH (MW 3400) | TargetMol | |
| 1695709 | TAR-T17395 | Amine-PEG-CH2COOH (MW 2000) | TargetMol | |
| 1695708 | TAR-T17394 | Amine-PEG-amine (MW 5000) | TargetMol | |
| 1695707 | TAR-T17393 | Amine-PEG-amine (MW 35000) | TargetMol | |
| 1695706 | TAR-T17392 | Amine-PEG-amine (MW 3400) | TargetMol | |
| 1695705 | TAR-T17391 | Amine-PEG-amine (MW 20000) | TargetMol | |
| 1695704 | TAR-T17390 | Amine-PEG-amine (MW 2000) | TargetMol | |
| 1695703 | TAR-T17388 | AM-Imidazole-PA-Boc | TargetMol | |
| 1695702 | TAR-T17387 | Aloc-D-Ala-Phe-Lys(Aloc)-PAB-PNP | TargetMol | |
| 1695701 | TAR-T17386 | Alkyne-PEG4-SS-PEG4-alkyne | TargetMol | |
| 1695700 | TAR-T17385 | Ald-Ph-amido-PEG3-C2-Pfp ester | TargetMol | |
| 1695699 | TAR-T17384 | Ald-Ph-amido-PEG3-C1-Boc | TargetMol | |
| 1695698 | TAR-T17383 | Ald-Ph-amido-PEG3-C-COOH | TargetMol | |
| 1695697 | TAR-T17382 | Ald-Ph-amido-PEG2 | TargetMol | |
| 1695696 | TAR-T17381 | Ald-Ph-amido-PEG2-C2-Pfp ester | TargetMol | |
| 1695695 | TAR-T17380 | Ald-Ph-amido-PEG1-C2-Pfp ester | TargetMol | |
| 1695694 | TAR-T17379 | Ald-Ph-amido-PEG1-C2-NHS ester | TargetMol | |
| 1695693 | TAR-T17378 | Ald-Ph-amido-C2-nitrate | TargetMol | |
| 1695692 | TAR-T17377 | Ald-Ph-PEG5-Boc | TargetMol | |
| 1695691 | TAR-T17376 | Ald-Ph-PEG24-TFP ester | TargetMol | |
| 1695690 | TAR-T17375 | Ald-Ph-PEG24-NHS ester | TargetMol | |
| 1695689 | TAR-T17374 | Ald-Ph-PEG2-Boc | TargetMol | |
| 1695688 | TAR-T17373 | Ald-Ph-PEG12-TFP ester | TargetMol | |
| 1695687 | TAR-T17371 | Ald-Ph-amido-PEG4-propargyl | TargetMol | |
| 1695686 | TAR-T17370 | Ald-Ph-amido-PEG24-acid | TargetMol | |
| 1695685 | TAR-T17369 | Ald-Ph-amido-PEG23-OPSS | TargetMol | |
| 1695684 | TAR-T17368 | Ald-Ph-amido-C2-PEG3-azide | TargetMol | |
| 1695683 | TAR-T17367 | Ald-CH2-PEG8-azide | TargetMol | |
| 1695682 | TAR-T17366 | Ald-CH2-PEG10-Boc | TargetMol | |
| 1695681 | TAR-T17365 | Ala-Ala-Asn-PAB | TargetMol | |
| 1695680 | TAR-T17364 | AhR Ligand-Linker Conjugates 1 | TargetMol | |
| 1695679 | TAR-T17363 | β-Naphthoflavone-CH2-OH | TargetMol | |
| 1695678 | TAR-T17362 | Acrylate-PEG-OH (MW 5000) | TargetMol | |
| 1695677 | TAR-T17361 | Acrylate-PEG-OH (MW 3400) | TargetMol | |
| 1695676 | TAR-T17360 | Acrylate-PEG-OH (MW 10000) | TargetMol | |
| 1695675 | TAR-T17359 | Acrylate-PEG-NH2 (MW 2000) | TargetMol | |
| 1695674 | TAR-T17358 | Acrylate-PEG-NH2 (MW 10000) | TargetMol | |
| 1695673 | TAR-T17357 | AcLys-PABC-VC-Aur0101 | TargetMol | |
| 1695672 | TAR-T17356 | Acid-propionylamino-Val-Cit-OH | TargetMol | |
| 1695671 | TAR-T17355 | Acid-PEG4-S-PEG4-acid | TargetMol | |
| 1695670 | TAR-T17354 | Acid-PEG25-NHS ester | TargetMol | |
| 1695669 | TAR-T17353 | Acid-PEG13-NHS ester | TargetMol | |
| 1695668 | TAR-T17351 | Acetylene-linker-Val-Cit-PABC-MMAE | TargetMol | |
| 1695667 | TAR-T17349 | Ac4GlcNAlk | TargetMol | |
| 1695666 | TAR-T17347 | Ac4GalNAl | TargetMol | |
| 1695665 | TAR-T17346 | 9-Decyn-1-ol | TargetMol | |
| 1695664 | TAR-T17345 | 7-Octynoic acid | TargetMol | |
| 1695663 | TAR-T17344 | 7-O-(Cbz-N-amido-PEG4)-paclitaxel | TargetMol | |
| 1695662 | TAR-T17343 | 7-O-(Amino-PEG4)-paclitaxel | TargetMol | |
| 1695661 | TAR-T17342 | 6-O-2-Propyn-1-yl-D-galactose | TargetMol | |
| 1695660 | TAR-T17340 | 5-endo-BCN-pentanoic acid | TargetMol | |
| 1695659 | TAR-T17339 | (5,6)TAMRA-PEG3-Azide-PEG3-Desthiobiotin | TargetMol | |
| 1695658 | TAR-T17338 | (4-Oxo-4H-quinazolin-3-yl)-acetic acid | TargetMol | |
| 1695657 | TAR-T17337 | 4-N3Pfp-NHS ester | TargetMol | |
| 1695656 | TAR-T17336 | 4-(N-Boc-amino)-1,6-heptanedioic acid | TargetMol | |
| 1695655 | TAR-T17335 | 4-Methyl-4-(pyridin-2-yldisulfanyl)pentanoic acid | TargetMol | |
| 1695654 | TAR-T17334 | 4-Methyl-4-(methyldisulfanyl)pentanoic acid | TargetMol | |
| 1695653 | TAR-T17333 | 4-(6-Methyl-1,2,4,5-tetrazin-3-yl)phenol | TargetMol | |
| 1695652 | TAR-T17332 | 3,4-Dibromo-Mal-PEG8-acid | TargetMol | |
| 1695651 | TAR-T17331 | (2-pyridyldithio)-PEG4 acid | TargetMol | |
| 1695650 | TAR-T17329 | 2-Bromo-2,2-dimethyl-acetamido-PEG3-acid | TargetMol | |
| 1695649 | TAR-T17328 | 2-((Azido-PEG8-carbamoyl)methoxy)acetic acid | TargetMol | |
| 1695648 | TAR-T17327 | 2-(Azido-PEG3-amido)-1,3-bis(NHS ester) | TargetMol | |
| 1695647 | TAR-T17322 | 1-(Isopropylthio)-2,3,4,6-tetra-o-Ac-beta-D-glucosylpyranose | TargetMol | |
| 1695646 | TAR-T17320 | 1,3-bis(carboxyethoxy)-2,2-bis(carboxyethoxy)propane | TargetMol | |
| 1695645 | TAR-T17318 | 1,1,1-Trifluoroethyl-PEG4-propargyl | TargetMol | |
| 1695644 | TAR-T17317 | 1,1,1-Trifluoroethyl-PEG2-propargyl | TargetMol | |
| 1695643 | TAR-T17316 | α-Lipoic acid-NHS | TargetMol | |
| 1695642 | TAR-T1729 | 3',4',5',5,7-Pentamethoxyflavanone | TargetMol | |
| 1695641 | TAR-T17242 | VU0453379 | TargetMol | |
| 1695640 | TAR-T17233 | Vipivotide tetraxetan Linker | TargetMol | |
| 1695639 | TAR-T17230 | VH032-PEG3-acetylene | TargetMol | |
| 1695636 | TAR-T17168 | Trityl-PEG8-azide | TargetMol | |
| 1695635 | TAR-T17167 | Trityl-PEG10-azide | TargetMol | |
| 1695634 | TAR-T17165 | Tris[[2-(tert-butoxycarbonyl)ethoxy]methyl]methylamine | TargetMol | |
| 1695633 | TAR-T17161 | Tri(t-butoxycarbonylethoxymethyl) ethanol | TargetMol | |
| 1695632 | TAR-T17160 | Tri(Amino-PEG5-amide)-amine | TargetMol | |
| 1695631 | TAR-T17154 | Tr-PEG8-OH | TargetMol | |
| 1695630 | TAR-T17153 | Tr-PEG6-OH | TargetMol | |
| 1695629 | TAR-T17152 | Tr-PEG5-OH | TargetMol | |
| 1695628 | TAR-T17151 | Tr-PEG4-OH | TargetMol | |
| 1695627 | TAR-T17150 | Tr-PEG3-OH | TargetMol | |
| 1695626 | TAR-T17149 | Tr-PEG2-OH | TargetMol | |
| 1695625 | TAR-T17141 | Tos-PEG9 | TargetMol | |
| 1695624 | TAR-T17140 | Tos-PEG9-Boc | TargetMol | |
| 1695623 | TAR-T17139 | Tos-PEG7-OH | TargetMol | |
| 1695622 | TAR-T17138 | Tos-PEG6-OH | TargetMol | |
| 1695621 | TAR-T17137 | Tos-PEG6-CH2-Boc | TargetMol | |
| 1695620 | TAR-T17136 | Tos-PEG6-C2-Boc | TargetMol | |
| 1695619 | TAR-T17135 | Tos-PEG5-CH2COOtBu | TargetMol | |
| 1695618 | TAR-T17134 | Tos-PEG5-C2-Boc | TargetMol | |
| 1695617 | TAR-T17133 | Tos-PEG4-t-butyl ester | TargetMol | |
| 1695616 | TAR-T17132 | Tos-PEG4-CH2COOH | TargetMol | |
| 1695615 | TAR-T17131 | Tos-PEG4-CH2-Boc | TargetMol | |
| 1695614 | TAR-T17130 | Tos-PEG5-Boc | TargetMol | |
| 1695613 | TAR-T17129 | Tos-PEG3 | TargetMol | |
| 1695612 | TAR-T17128 | Tos-PEG3-CH2COOH | TargetMol | |
| 1695611 | TAR-T17127 | Tos-PEG3-C2-methyl ester | TargetMol | |
| 1695610 | TAR-T17126 | Tos-PEG4-acid | TargetMol | |
| 1695609 | TAR-T17125 | Tos-PEG2-O-Propargyl | TargetMol | |
| 1695608 | TAR-T17124 | Tos-PEG2-CH2COOH | TargetMol | |
| 1695607 | TAR-T17123 | Tos-PEG2-CH2-Boc | TargetMol | |
| 1695606 | TAR-T17122 | Tos-PEG2-C2-Boc | TargetMol | |
| 1695605 | TAR-T17121 | Tos-PEG1-CH2-Boc | TargetMol | |
| 1695604 | TAR-T17120 | Tos-PEG2-Boc | TargetMol | |
| 1695603 | TAR-T17119 | Tos-aminoxy-Boc-PEG4-Tos | TargetMol | |
| 1695601 | TAR-T17089 | THP-SS-PEG1-Tos | TargetMol | |
| 1695600 | TAR-T17088 | THP-SS-PEG1-Boc | TargetMol | |
| 1695599 | TAR-T17087 | THP-SS-alcohol | TargetMol | |
| 1695598 | TAR-T17086 | THP-PEG8-Tos | TargetMol | |
| 1695597 | TAR-T17085 | THP-PEG8-OH | TargetMol | |
| 1695596 | TAR-T17084 | THP-PEG6-OH | TargetMol | |
| 1695595 | TAR-T17083 | THP-PEG5-OH | TargetMol | |
| 1695594 | TAR-T17082 | THP-PEG4-OH | TargetMol | |
| 1695593 | TAR-T17081 | THP-PEG3-OH | TargetMol | |
| 1695592 | TAR-T17080 | Thiol-PEG8-acid | TargetMol | |
| 1695591 | TAR-T17079 | Thiol-PEG6-alcohol | TargetMol | |
| 1695590 | TAR-T17078 | Thiol-PEG4-Boc | TargetMol | |
| 1695589 | TAR-T17077 | Thiol-PEG4-acid | TargetMol | |
| 1695588 | TAR-T17076 | Thiol-PEG3-phosphonic acid | TargetMol | |
| 1695587 | TAR-T17075 | Thiol-PEG3-Boc | TargetMol | |
| 1695586 | TAR-T17074 | Thiol-PEG3-acid | TargetMol | |
| 1695585 | TAR-T1707 | EA25 | TargetMol | |
| 1695584 | TAR-T17063 | Tetrazine-Ph-PEG5-NHS ester | TargetMol | |
| 1695583 | TAR-T17062 | Tetrazine-Ph-NHS ester | TargetMol | |
| 1695582 | TAR-T17061 | Tetrazine-Ph-acid | TargetMol | |
| 1695580 | TAR-T17058 | Tetrahydropyranyldiethyleneglycol | TargetMol | |
| 1695579 | TAR-T17055 | Tetraethylene glycol monotosylate | TargetMol | |
| 1695578 | TAR-T17054 | Tetraethylene glycol monomethyl ether | TargetMol | |
| 1695577 | TAR-T17053 | Tetraethyl octane-1,8-diylbis(phosphonate) | TargetMol | |
| 1695576 | TAR-T17052 | Tetraethyl heptane-1,7-diylbis(phosphonate) | TargetMol | |
| 1695575 | TAR-T17051 | Tetraethyl decane-1,10-diylbis(phosphonate) | TargetMol | |
| 1695574 | TAR-T17050 | Tetraethyl butane-?1,?4-?diylbis(phosphoramid?ate) | TargetMol | |
| 1695573 | TAR-T17049 | Tetraethyl butane-1,4-diylbis(phosphonate) | TargetMol | |
| 1695572 | TAR-T17046 | Tetra(cyanoethoxymethyl) methane | TargetMol | |
| 1695571 | TAR-T17016 | TCO-PEG4-biotin | TargetMol | |
| 1695570 | TAR-T17015L | (S)-TCO-PEG4-acid | TargetMol | |
| 1695569 | TAR-T17015 | TCO-PEG4-acid | TargetMol | |
| 1695568 | TAR-T17013 | TCO-C3-PEG3-C3-amine | TargetMol | |
| 1695567 | TAR-T17012 | TCO-amine | TargetMol | |
| 1695566 | TAR-T17003 | TBDMS-PEG4-OH | TargetMol | |
| 1695565 | TAR-T16997 | Tasidotin hydrochloride | TargetMol | |
| 1695564 | TAR-T16984 | TAMRA-PEG4-Alkyne | TargetMol | |
| 1695563 | TAR-T16983 | TAMRA-PEG4-acid | TargetMol | |
| 1695562 | TAR-T16982 | TAMRA-PEG3-Azide | TargetMol | |
| 1695561 | TAR-T16981 | TAMRA-Azide-PEG-biotin | TargetMol | |
| 1695560 | TAR-T16972 | TA 0910 acid-type | TargetMol | |
| 1695559 | TAR-T16971 | t-Boc-Aminooxy-PEG7-methane | TargetMol | |
| 1695558 | TAR-T16970 | t-Boc-aminooxy-PEG6-propargyl | TargetMol | |
| 1695557 | TAR-T16969 | t-Boc-Aminooxy-PEG3-alcohol | TargetMol | |
| 1695556 | TAR-T16968 | t-Boc-Aminooxy-PEG2-azide | TargetMol | |
| 1695555 | TAR-T16959 | Sulfo-NHS-Acetate | TargetMol | |
| 1695554 | TAR-T16958 | Sulfo DBCO-PEG4-Maleimide | TargetMol | |
| 1695553 | TAR-T16957 | Sulfo DBCO-PEG4-amine | TargetMol | |
| 1695552 | TAR-T16956 | Sulfo DBCO-amine | TargetMol | |
| 1695551 | TAR-T16955 | Sulfiram | TargetMol | |
| 1695550 | TAR-T16918 | SPDP-PEG6-NHS ester | TargetMol | |
| 1695549 | TAR-T16917 | SPDP-PEG4-NHS ester | TargetMol | |
| 1695548 | TAR-T16916 | SPDP-PEG4-acid | TargetMol | |
| 1695547 | TAR-T16915 | SPDP-C6-NHS ester | TargetMol | |
| 1695546 | TAR-T16905 | SNIPER(BRD)-1 | TargetMol | |
| 1695545 | TAR-T16903 | SMPH Crosslinker | TargetMol | |
| 1695544 | TAR-T16895 | SL910102 | TargetMol | |
| 1695543 | TAR-T16880 | SIA Crosslinker | TargetMol | |
| 1695542 | TAR-T16828 | S-Acetyl-PEG8-OH | TargetMol | |
| 1695541 | TAR-T16827 | S-acetyl-PEG6-Tos | TargetMol | |
| 1695540 | TAR-T16826 | S-acetyl-PEG6-Boc | TargetMol | |
| 1695539 | TAR-T16825 | S-acetyl-PEG4-propargyl | TargetMol | |
| 1695538 | TAR-T16824 | S-acetyl-PEG4-Boc | TargetMol | |
| 1695537 | TAR-T16823 | S-acetyl-PEG4-alcohol | TargetMol | |
| 1695536 | TAR-T16822 | S-Acetyl-PEG3-C2-acid | TargetMol | |
| 1695535 | TAR-T16821 | S-acetyl-PEG3-Boc | TargetMol | |
| 1695534 | TAR-T16820 | S-Acetyl-PEG3-azide | TargetMol | |
| 1695533 | TAR-T16819 | S-acetyl-PEG3-alcohol | TargetMol | |
| 1695532 | TAR-T16782 | Rolofylline | TargetMol | |
| 1695531 | TAR-T16693 | Pyrene-PEG5-alcohol | TargetMol | |
| 1695530 | TAR-T16692 | Pyrene-amido-PEG4-CH2CH2COOH | TargetMol | |
| 1695529 | TAR-T16691 | Pyrene-amido-PEG4-azide | TargetMol | |
| 1695528 | TAR-T16667 | PROTAC Sirt2 Degrader-1 | TargetMol | |
| 1695527 | TAR-T16666 | NH2-PEG3-C1-Boc | TargetMol | |
| 1695526 | TAR-T16665 | Triethylene glycol | TargetMol | |
| 1695525 | TAR-T16664 | N3-PEG4-C2-NH2 | TargetMol | |
| 1695524 | TAR-T16663 | Bis-NH2-PEG2 | TargetMol | |
| 1695523 | TAR-T16662 | Tetraethylene glycol | TargetMol | |
| 1695522 | TAR-T16661 | NH2-PEG5-C2-NH-Boc | TargetMol | |
| 1695521 | TAR-T16660 | N3-PEG3-CH2COOH | TargetMol | |
| 1695520 | TAR-T16659 | Boc-NH-PEG2-C2-NH2 | TargetMol | |
| 1695519 | TAR-T16658 | Boc-NH-PEG4 | TargetMol | |
| 1695518 | TAR-T16657 | Boc-NH-PEG2 | TargetMol | |
| 1695517 | TAR-T16656 | Propynol Ethoxylate | TargetMol | |
| 1695516 | TAR-T16655 | Propargyl-PEG9-OH | TargetMol | |
| 1695515 | TAR-T16654 | Propargyl-PEG9-bromide | TargetMol | |
| 1695514 | TAR-T16653 | Propargyl-PEG9-amine | TargetMol | |
| 1695513 | TAR-T16652 | Propargyl-PEG8-OH | TargetMol | |
| 1695512 | TAR-T16651 | Propargyl-PEG8-NH2 | TargetMol | |
| 1695511 | TAR-T16650 | Propargyl-PEG8-bromide | TargetMol | |
| 1695510 | TAR-T16649 | Propargyl-PEG8-Boc | TargetMol | |
| 1695509 | TAR-T16648 | Propargyl-PEG8-acid | TargetMol | |
| 1695508 | TAR-T16647 | Propargyl-PEG8-NHS ester | TargetMol | |
| 1695507 | TAR-T16646 | Propargyl-PEG7-Boc | TargetMol | |
| 1695506 | TAR-T16645 | Propargyl-PEG7-alcohol | TargetMol | |
| 1695505 | TAR-T16644 | Propargyl-PEG7-acid | TargetMol | |
| 1695504 | TAR-T16643 | Propargyl-PEG6-NH2 | TargetMol | |
| 1695503 | TAR-T16642 | Propargyl-PEG7-NHS ester | TargetMol | |
| 1695502 | TAR-T16641 | Propargyl-PEG6-Boc | TargetMol | |
| 1695501 | TAR-T16640 | Propargyl-PEG6-alcohol | TargetMol | |
| 1695500 | TAR-T16639 | Propargyl-PEG6-acid | TargetMol | |
| 1695499 | TAR-T16638 | Propargyl-PEG5-OH | TargetMol | |
| 1695498 | TAR-T16637 | Propargyl-PEG6-NHS ester | TargetMol | |
| 1695497 | TAR-T16636 | Propargyl-PEG5-amine | TargetMol | |
| 1695496 | TAR-T16635 | Propargyl-PEG4-Tos | TargetMol | |
| 1695495 | TAR-T16634 | Propargyl-PEG4-thiol | TargetMol | |
| 1695494 | TAR-T16633 | Propargyl-PEG4-tetra-Ac-beta-D-glucose | TargetMol | |
| 1695493 | TAR-T16632 | Propargyl-PEG4-tetra-Ac-beta-D-galactose | TargetMol | |
| 1695492 | TAR-T16631 | Propargyl-PEG4-sulfonic acid | TargetMol | |
| 1695491 | TAR-T16630 | Propargyl-PEG4-O-C1-NHS ester | TargetMol | |
| 1695490 | TAR-T16629 | Propargyl-PEG4-O-C1-Boc | TargetMol | |
| 1695489 | TAR-T16628 | Propargyl-PEG4-NHS ester | TargetMol | |
| 1695488 | TAR-T16627 | Propargyl-PEG4-methylamine | TargetMol | |
| 1695487 | TAR-T16626 | Propargyl-PEG3-methane | TargetMol | |
| 1695486 | TAR-T16625 | Propargyl-PEG4-CH2COOH | TargetMol | |
| 1695485 | TAR-T16624 | Propargyl-PEG4-CH2CH2-Boc | TargetMol | |
| 1695484 | TAR-T16623 | Propargyl-PEG4-CH2-methyl ester | TargetMol | |
| 1695483 | TAR-T16622 | Propargyl-PEG4-CH2-acid | TargetMol | |
| 1695482 | TAR-T16621 | Propargyl-PEG5-NHS ester | TargetMol | |
| 1695481 | TAR-T16620 | Propargyl-PEG5-acid | TargetMol | |
| 1695480 | TAR-T16619 | Propargyl-PEG4-Br | TargetMol | |
| 1695479 | TAR-T16618 | Propargyl-PEG4-Boc | TargetMol | |
| 1695478 | TAR-T16617 | Propargyl-PEG4-beta-D-glucose | TargetMol | |
| 1695477 | TAR-T16616 | Propargyl-PEG4-amine | TargetMol | |
| 1695476 | TAR-T16615 | Propargyl-PEG4-alcohol | TargetMol | |
| 1695475 | TAR-T16614 | Propargyl-PEG4-acid | TargetMol | |
| 1695474 | TAR-T16613 | Propargyl-PEG4-5-nitrophenyl carbonate | TargetMol | |
| 1695473 | TAR-T16612 | Propargyl-PEG3-phosphonic acid | TargetMol | |
| 1695472 | TAR-T16611 | Propargyl-PEG3-phosphonic acid diethyl ester | TargetMol | |
| 1695471 | TAR-T16610 | Propargyl-PEG3-OCH2-Boc | TargetMol | |
| 1695470 | TAR-T16609 | Propargyl-PEG3-CH2COOH | TargetMol | |
| 1695469 | TAR-T16608 | Propargyl-PEG3-bromide | TargetMol | |
| 1695468 | TAR-T16607 | Propargyl-PEG3-Boc | TargetMol | |
| 1695467 | TAR-T16606 | Propargyl-PEG3-alcohol | TargetMol | |
| 1695466 | TAR-T16604 | Propargyl-PEG2-Tos | TargetMol | |
| 1695465 | TAR-T16603 | Propargyl-PEG2-OH | TargetMol | |
| 1695464 | TAR-T16602 | Propargyl-PEG2-NHBoc | TargetMol | |
| 1695463 | TAR-T16601 | Propargyl-PEG2-N-bis(PEG2) | TargetMol | |
| 1695462 | TAR-T16600 | Propargyl-PEG2-Ms | TargetMol | |
| 1695461 | TAR-T16599 | Propargyl-PEG3-NHS ester | TargetMol | |
| 1695460 | TAR-T16598 | Propargyl-PEG2-amine | TargetMol | |
| 1695459 | TAR-T16597 | Propargyl-PEG2-acid | TargetMol | |
| 1695458 | TAR-T16596 | Propargyl-PEG12-OH | TargetMol | |
| 1695457 | TAR-T16595 | Propargyl-PEG10-Boc | TargetMol | |
| 1695456 | TAR-T16594 | Propargyl-PEG10-amine | TargetMol | |
| 1695455 | TAR-T16593 | Propargyl-PEG10-acid | TargetMol | |
| 1695454 | TAR-T16592 | Propargyl-PEG1-SS-PEG1-propargyl | TargetMol | |
| 1695453 | TAR-T16591 | Propargyl-PEG1-SS-PEG1-PFP ester | TargetMol | |
| 1695452 | TAR-T16590 | Propargyl-PEG1-SS-PEG1-C2-Boc | TargetMol | |
| 1695451 | TAR-T16589 | Propargyl-PEG1-SS-PEG1-acid | TargetMol | |
| 1695450 | TAR-T16588 | Propargyl-PEG1-SS-alcohol | TargetMol | |
| 1695449 | TAR-T16587 | Propargyl-PEG1-NHS ester | TargetMol | |
| 1695448 | TAR-T16586 | Propargyl-PEG1-NH2 | TargetMol | |
| 1695447 | TAR-T16585 | Propargyl-PEG1-Boc | TargetMol | |
| 1695446 | TAR-T16584 | Propargyl-PEG1-acrylate | TargetMol | |
| 1695445 | TAR-T16583 | Propargyl-PEG1-acid | TargetMol | |
| 1695443 | TAR-T16568 | PR-924 | TargetMol | |
| 1695442 | TAR-T16553 | Pneumadin, rat | TargetMol | |
| 1695441 | TAR-T16520 | Ph-Bis(C1-N-(C2-NH-Boc)2) | TargetMol | |
| 1695440 | TAR-T16468 | Pentaethylene glycol | TargetMol | |
| 1695439 | TAR-T16467 | Pentaethylene glycol monomethyl ether | TargetMol | |
| 1695438 | TAR-T16463 | PEG8-Tos | TargetMol | |
| 1695437 | TAR-T16462 | PEG5-Tos | TargetMol | |
| 1695436 | TAR-T16461 | PEG5-bis-(Ethyl phosphonate) | TargetMol | |
| 1695435 | TAR-T16460 | PEG4-sulfonic acid | TargetMol | |
| 1695434 | TAR-T16459 | PEG4-Ms | TargetMol | |
| 1695433 | TAR-T16458 | PEG4-bis(phosphonic acid diethyl ester) | TargetMol | |
| 1695432 | TAR-T16457 | PEG3-methylamine | TargetMol | |
| 1695431 | TAR-T16456 | PEG3-bis(phosphonic acid) | TargetMol | |
| 1695430 | TAR-T16455 | PEG3-bis(phosphonic acid diethyl ester) | TargetMol | |
| 1695429 | TAR-T16454 | PEG3-bis-(ethyl phosphonate) | TargetMol | |
| 1695428 | TAR-T16453 | PEG2-bis(phosphonic acid diethyl ester) | TargetMol | |
| 1695427 | TAR-T16452 | PEG12-Tos | TargetMol | |
| 1695426 | TAR-T16450 | PDK1-IN-RS2 | TargetMol | |
| 1695425 | TAR-T16438 | PC Biotin-PEG3-azide | TargetMol | |
| 1695424 | TAR-T16400 | OPSS-PEG8-COOH | TargetMol | |
| 1695422 | TAR-T16375 | Octaethylene glycol | TargetMol | |
| 1695421 | TAR-T16374 | Octaethylene glycol monomethyl ether | TargetMol | |
| 1695420 | TAR-T16337 | Nonaethylene glycol | TargetMol | |
| 1695419 | TAR-T16336 | Nonaethylene glycol monomethyl ether | TargetMol | |
| 1695418 | TAR-T16320 | NHS-PEG4-(m-PEG4)3-ester | TargetMol | |
| 1695417 | TAR-T16319 | NH2-PEG9-acid | TargetMol | |
| 1695416 | TAR-T16318 | NH2-PEG8-OH | TargetMol | |
| 1695415 | TAR-T16317 | NH2-PEG7 | TargetMol | |
| 1695414 | TAR-T16316 | NH2-PEG6-CH2CH2COOH | TargetMol | |
| 1695413 | TAR-T16314 | NH2-PEG5-OH | TargetMol | |
| 1695412 | TAR-T16313 | NH2-PEG4-CH2CH2COOH | TargetMol | |
| 1695411 | TAR-T16312 | NH2-PEG3 | TargetMol | |
| 1695410 | TAR-T16311 | NH2-PEG2-C2-Boc | TargetMol | |
| 1695409 | TAR-T16310 | NH2-PEG1-CH2CH2-Boc | TargetMol | |
| 1695408 | TAR-T16309 | NH-bis-PEG5 | TargetMol | |
| 1695407 | TAR-T16308 | NH-bis-PEG4 | TargetMol | |
| 1695406 | TAR-T16307 | NH-bis(PEG4-C2-NH-Boc) | TargetMol | |
| 1695405 | TAR-T16306 | NH-bis(PEG4-Boc) | TargetMol | |
| 1695404 | TAR-T16305 | NH-bis-PEG3 | TargetMol | |
| 1695403 | TAR-T16304 | NH-bis(PEG3-C2-NH-Boc) | TargetMol | |
| 1695402 | TAR-T16303 | NH-bis(PEG3-Boc) | TargetMol | |
| 1695401 | TAR-T16301 | NH-bis-PEG2 | TargetMol | |
| 1695400 | TAR-T16300 | NH-bis(PEG2-propargyl) | TargetMol | |
| 1695399 | TAR-T16299 | NH-bis(PEG2-C2-Boc) | TargetMol | |
| 1695398 | TAR-T16298 | NH-bis(m-PEG8) | TargetMol | |
| 1695397 | TAR-T16297 | NH-bis(m-PEG4) | TargetMol | |
| 1695396 | TAR-T16296 | NH-bis(C2-PEG2-NH-Boc) | TargetMol | |
| 1695395 | TAR-T16295 | NH-bis(C2-PEG1-azide) | TargetMol | |
| 1695394 | TAR-T16283 | Neocarzinostatin | TargetMol | |
| 1695393 | TAR-T16262 | N33-TEG-COOH | TargetMol | |
| 1695392 | TAR-T16261 | N3-PEG8-CH2COOH | TargetMol | |
| 1695391 | TAR-T16260 | N3-PEG4-C2-Pfp ester | TargetMol | |
| 1695390 | TAR-T16259 | N3-PEG4-C2-NHS ester | TargetMol | |
| 1695389 | TAR-T16258 | N3-PEG3-CH2CH2COOH | TargetMol | |
| 1695388 | TAR-T16257 | N3-PEG3-CH2CH2-Boc | TargetMol | |
| 1695387 | TAR-T16256 | N3-PEG3-C2-PFP ester | TargetMol | |
| 1695386 | TAR-T16255 | N3-PEG3-C2-NHS ester | TargetMol | |
| 1695385 | TAR-T16254 | N3-PEG2-C2-PFP ester | TargetMol | |
| 1695384 | TAR-T16253 | N3-PEG2-C2-NHS ester | TargetMol | |
| 1695383 | TAR-T16252 | N-(t-Boc-Aminooxy-PEG2)-N-bis(PEG3-propargyl) | TargetMol | |
| 1695382 | TAR-T16250 | N-Succinimidyl 3-(Bromoacetamido)propionate | TargetMol | |
| 1695381 | TAR-T16249 | N-(Propargyl-PEG4)-N-bis(PEG4-acid) | TargetMol | |
| 1695380 | TAR-T16248 | N-(Propargyl-PEG4-carbonyl)-N-bis(PEG1-methyl ester) | TargetMol | |
| 1695379 | TAR-T16247 | N-(Propargyl-PEG4)-biocytin | TargetMol | |
| 1695378 | TAR-T16246 | N-(Propargyl-PEG2)-N-Boc-PEG3-t-butyl ester | TargetMol | |
| 1695377 | TAR-T16245 | N-(PEG3-acid)-N-bis(PEG3-amine) | TargetMol | |
| 1695376 | TAR-T16244 | N-(PEG2-C2-acid)-N-bis(PEG2-propargyl) | TargetMol | |
| 1695375 | TAR-T16243 | N-(PEG2-Boc)-N-bis(PEG2-propargyl) | TargetMol | |
| 1695374 | TAR-T16242 | N-(PEG1-OH)-N-Boc-PEG2-propargyl | TargetMol | |
| 1695373 | TAR-T16241 | N-(NHS-PEG3)-N-bis(PEG3-azide) | TargetMol | |
| 1695372 | TAR-T16238 | N-Methyl-N-(t-Boc)-PEG4-acid | TargetMol | |
| 1695371 | TAR-T16237 | N-Me-N-bis-PEG4 | TargetMol | |
| 1695370 | TAR-T16236 | N-Me-N-bis(PEG2-propargyl) | TargetMol | |
| 1695369 | TAR-T16235 | N-(Mal-PEG6)-N-bis(PEG3-amine) | TargetMol | |
| 1695368 | TAR-T16234 | N-Mal-N-bis(PEG4-NHS ester) | TargetMol | |
| 1695367 | TAR-T16233 | N-Mal-N-bis(PEG4-NH-Boc) | TargetMol | |
| 1695366 | TAR-T16232 | N-Mal-N-bis(PEG4-amine) | TargetMol | |
| 1695365 | TAR-T16231 | N-Mal-N-bis(PEG2-NHS ester) | TargetMol | |
| 1695364 | TAR-T16230 | N-Mal-N-bis(PEG2-NH-Boc) | TargetMol | |
| 1695363 | TAR-T16229 | N-Mal-N-bis(PEG2-C2-Boc) | TargetMol | |
| 1695362 | TAR-T16228 | N-Mal-N-bis(PEG2-amine) | TargetMol | |
| 1695361 | TAR-T16227 | N-Mal-N-bis(PEG2-acid) | TargetMol | |
| 1695360 | TAR-T16224 | N-(Hydroxy-PEG3)-N-bis(PEG4-Boc) | TargetMol | |
| 1695359 | TAR-T16222 | N-Bromoacetyl-β-alanine | TargetMol | |
| 1695358 | TAR-T16221 | N-Boc-serinol | TargetMol | |
| 1695357 | TAR-T16220 | N-Boc-PEG7-alcohol | TargetMol | |
| 1695356 | TAR-T16219 | N-Boc-PEG6-alcohol | TargetMol | |
| 1695355 | TAR-T16217 | N-Boc-PEG5-alcohol | TargetMol | |
| 1695354 | TAR-T16216 | N-(Boc-PEG4)-NH-PEG4-NH-Boc | TargetMol | |
| 1695353 | TAR-T16215 | N-Boc-PEG4-bromide | TargetMol | |
| 1695352 | TAR-T16214 | N-(Boc-PEG3)-N-bis(PEG3-azide) | TargetMol | |
| 1695351 | TAR-T16213 | N-(Boc-PEG3)-N-bis(PEG2-alcohol) | TargetMol | |
| 1695350 | TAR-T16212 | N-Boc-PEG3-bromide | TargetMol | |
| 1695349 | TAR-T16211 | N-Boc-PEG2-bromide | TargetMol | |
| 1695348 | TAR-T16210 | N-(Boc-PEG1)-N-bis(PEG2-propargyl) | TargetMol | |
| 1695347 | TAR-T16209 | N-Boc-N-bis-PEG5 | TargetMol | |
| 1695346 | TAR-T16208 | N-Boc-N-bis(PEG4-OH) | TargetMol | |
| 1695345 | TAR-T16207 | N-Boc-N-bis(PEG4-azide) | TargetMol | |
| 1695344 | TAR-T16206 | N-Boc-N-bis(PEG3-azide) | TargetMol | |
| 1695343 | TAR-T16205 | N-Boc-N-bis(PEG2-propargyl) | TargetMol | |
| 1695342 | TAR-T16204 | N-Boc-N-bis(PEG2-OH) | TargetMol | |
| 1695341 | TAR-T16203 | N-Boc-N-bis(C2-PEG1-azide) | TargetMol | |
| 1695340 | TAR-T16202 | N-Boc-diethanolamine | TargetMol | |
| 1695339 | TAR-T16201 | N-(Biotin)-N-bis(PEG1-alcohol) | TargetMol | |
| 1695338 | TAR-T16200 | N-Benzyl-N-bis-PEG4 | TargetMol | |
| 1695337 | TAR-T16199 | N-Benzyl-N-bis-PEG2 | TargetMol | |
| 1695336 | TAR-T16198 | N-(Azido-PEG4)-N-Boc-PEG4-NHS ester | TargetMol | |
| 1695335 | TAR-T16197 | N-(Azido-PEG4)-N-Boc-PEG4-Boc | TargetMol | |
| 1695334 | TAR-T16196 | N-(Azido-PEG4)-N-bis(PEG4-t-butyl ester) | TargetMol | |
| 1695333 | TAR-T16195 | N-(Azido-PEG4)-N-bis(PEG4-acid) | TargetMol | |
| 1695332 | TAR-T16194 | N-(Azido-PEG4)-biocytin | TargetMol | |
| 1695331 | TAR-T16193 | N-(Azido-PEG3)-NH-PEG3-acid | TargetMol | |
| 1695330 | TAR-T16192 | N-(Azido-PEG3)-N-(PEG2-amine)-PEG3-acid | TargetMol | |
| 1695329 | TAR-T16191 | N-(Azido-PEG3)-N-Fluorescein-PEG3-acid | TargetMol | |
| 1695328 | TAR-T16190 | N-(Azido-PEG3)-N-Boc-PEG4-Boc | TargetMol | |
| 1695327 | TAR-T16189 | N-(Azido-PEG3)-N-Boc-PEG4-acid | TargetMol | |
| 1695326 | TAR-T16188 | N-(Azido-PEG3)-N-Boc-PEG3-acid | TargetMol | |
| 1695325 | TAR-T16187 | N-(Azido-PEG3)-N-bis(PEG4-acid) | TargetMol | |
| 1695324 | TAR-T16186 | N-(Azido-PEG3)-N-bis(PEG3-acid) | TargetMol | |
| 1695323 | TAR-T16185 | N-(Azido-PEG3)-N-bis(PEG1-t-butyl ester) | TargetMol | |
| 1695322 | TAR-T16184 | N-(Azido-PEG3)-N-Biotin-PEG4-methyl ester | TargetMol | |
| 1695321 | TAR-T16183 | N-(Azido-PEG2)-N-Fluorescein-PEG3-acid | TargetMol | |
| 1695320 | TAR-T16182 | N-(Azido-PEG2)-N-Boc-PEG4-NHS ester | TargetMol | |
| 1695319 | TAR-T16181 | N-(Azido-PEG2)-N-Boc-PEG4-Boc | TargetMol | |
| 1695318 | TAR-T16180 | N-(Azido-PEG2)-N-Boc-PEG4-acid | TargetMol | |
| 1695317 | TAR-T16179 | N-(Azido-PEG2)-N-Boc-PEG3-NHS ester | TargetMol | |
| 1695316 | TAR-T16178 | N-(Azido-PEG2)-N-Boc-PEG3-Boc | TargetMol | |
| 1695315 | TAR-T16177 | N-(Azido-PEG2)-N-Boc-PEG3-acid | TargetMol | |
| 1695314 | TAR-T16176 | N-(Azido-PEG2)-N-bis(PEG4-Boc) | TargetMol | |
| 1695313 | TAR-T16175 | N-(Aminooxy-PEG3)-N-bis(PEG4-Boc) | TargetMol | |
| 1695312 | TAR-T16174 | N-(Aminooxy-PEG2)-N-bis(PEG3-propargyl) | TargetMol | |
| 1695311 | TAR-T16173 | N-(Amino-PEG5)-N-bis(PEG4-acid) | TargetMol | |
| 1695310 | TAR-T16172 | N-(Amino-PEG4)-N-bis(PEG4-Boc) | TargetMol | |
| 1695309 | TAR-T16171 | N-(Amino-PEG3)-N-bis(PEG3-Boc) | TargetMol | |
| 1695308 | TAR-T16170 | N-(Amino-PEG3)-N-bis(PEG3-acid) | TargetMol | |
| 1695307 | TAR-T16168 | N-(acid-PEG3)-N-bis(PEG3-azide) | TargetMol | |
| 1695306 | TAR-T16167 | N-(4-Carboxycyclohexylmethyl)maleimide | TargetMol | |
| 1695305 | TAR-T16151 | Ms-PEG7-Ms | TargetMol | |
| 1695304 | TAR-T16150 | Ms-PEG5-t-butyl ester | TargetMol | |
| 1695303 | TAR-T16149 | Ms-PEG4-Ms | TargetMol | |
| 1695302 | TAR-T16148 | Ms-PEG2-Ms | TargetMol | |
| 1695301 | TAR-T16147 | Ms-PEG2-C2-Boc | TargetMol | |
| 1695300 | TAR-T16146 | Ms-PEG12-m | TargetMol | |
| 1695299 | TAR-T16065 | Methyltetrazine-propylamine | TargetMol | |
| 1695298 | TAR-T16064 | Methyltetrazine-Ph-PEG4-azide | TargetMol | |
| 1695297 | TAR-T16063 | Methyltetrazine-Ph-NHS ester | TargetMol | |
| 1695296 | TAR-T16062 | Methyltetrazine-PEG8-NHS ester | TargetMol | |
| 1695295 | TAR-T16061 | Methyltetrazine-PEG8-acid | TargetMol | |
| 1695294 | TAR-T16060 | Methyltetrazine-PEG5-NHS ester | TargetMol | |
| 1695293 | TAR-T16059 | Methyltetrazine-PEG5-alkyne | TargetMol | |
| 1695292 | TAR-T16058 | Methyltetrazine-PEG4-maleimide | TargetMol | |
| 1695291 | TAR-T16057 | Methyltetrazine-PEG4-amine | TargetMol | |
| 1695290 | TAR-T16056 | Methyltetrazine-DBCO | TargetMol | |
| 1695289 | TAR-T16055 | Methyltetrazine-acid | TargetMol | |
| 1695288 | TAR-T16054 | Methylamino-PEG5-azide | TargetMol | |
| 1695287 | TAR-T16053 | Methylamino-PEG4-Boc | TargetMol | |
| 1695286 | TAR-T16052 | Methylamino-PEG4-acid | TargetMol | |
| 1695285 | TAR-T16051 | Methylamino-PEG3-azide | TargetMol | |
| 1695284 | TAR-T16050 | Methylamino-PEG2-Boc | TargetMol | |
| 1695283 | TAR-T16049 | Methylamino-PEG2-acid | TargetMol | |
| 1695282 | TAR-T16048 | Methylamino-PEG1-Boc | TargetMol | |
| 1695281 | TAR-T16047 | Methylamino-PEG1-acid | TargetMol | |
| 1695280 | TAR-T16046 | Methyl propionate-PEG12 | TargetMol | |
| 1695279 | TAR-T16032L | (Z)-MDL 105519 | TargetMol | |
| 1695278 | TAR-T16025 | SGD-1910 | TargetMol | |
| 1695277 | TAR-T16024 | MC-GGFG-DX8951 | TargetMol | |
| 1695276 | TAR-T16008 | Maleimido-tri(ethylene glycol)-propionic acid | TargetMol | |
| 1695275 | TAR-T16006 | Mal-Sulfo-DBCO | TargetMol | |
| 1695274 | TAR-T16005 | Mal-PEG8-NHS ester | TargetMol | |
| 1695273 | TAR-T16004 | Mal-PEG8-Boc | TargetMol | |
| 1695272 | TAR-T16003 | Mal-PEG8-acid | TargetMol | |
| 1695271 | TAR-T16002 | Mal-PEG6-PFP ester | TargetMol | |
| 1695270 | TAR-T16001 | Mal-PEG6-NHS ester | TargetMol | |
| 1695269 | TAR-T16000 | Mal-PEG6-Boc | TargetMol | |
| 1695268 | TAR-T15999 | Mal-PEG6-acid | TargetMol | |
| 1695267 | TAR-T15998 | Mal-PEG5-PFP ester | TargetMol | |
| 1695266 | TAR-T15997 | Mal-PEG5-NHS ester | TargetMol | |
| 1695265 | TAR-T15996 | Mal-PEG5-acid | TargetMol | |
| 1695264 | TAR-T15995 | Mal-PEG4-Val-Cit-PAB-PNP | TargetMol | |
| 1695263 | TAR-T15994 | Mal-PEG4-Val-Cit-PAB-OH | TargetMol | |
| 1695262 | TAR-T15993 | Mal-PEG4-PFP ester | TargetMol | |
| 1695261 | TAR-T15992 | Mal-PEG4-OH | TargetMol | |
| 1695260 | TAR-T15991 | Mal-?PEG4-?NHS ester | TargetMol | |
| 1695259 | TAR-T15990 | Mal-PEG4-Boc | TargetMol | |
| 1695258 | TAR-T15989 | Mal-PEG4-acid | TargetMol | |
| 1695257 | TAR-T15988 | Mal-PEG3-PFP ester | TargetMol | |
| 1695256 | TAR-T15987 | Mal-PEG3-NHS ester | TargetMol | |
| 1695255 | TAR-T15986 | Mal-PEG3-Boc | TargetMol | |
| 1695254 | TAR-T15985 | Mal-PEG3-alcohol | TargetMol | |
| 1695253 | TAR-T15984 | Mal-PEG2-Val-Cit-amido-PAB-OH | TargetMol | |
| 1695252 | TAR-T15983 | Mal-PEG2-PFP ester | TargetMol | |
| 1695251 | TAR-T15982 | Mal-PEG2-NHS ester | TargetMol | |
| 1695250 | TAR-T15981 | Mal-PEG2-NH2 | TargetMol | |
| 1695249 | TAR-T15980 | Mal-PEG2-NH-Boc | TargetMol | |
| 1695248 | TAR-T15979 | Mal-PEG2-alcohol | TargetMol | |
| 1695247 | TAR-T15978 | Mal-PEG2-acid | TargetMol | |
| 1695246 | TAR-T15977 | Mal-PEG1-PFP ester | TargetMol | |
| 1695245 | TAR-T15975 | Mal-PEG1-bromide | TargetMol | |
| 1695244 | TAR-T15974 | Mal-PEG1-Boc | TargetMol | |
| 1695243 | TAR-T15973 | Mal-PEG1-acid | TargetMol | |
| 1695242 | TAR-T15972 | Mal-NH2 TFA | TargetMol | |
| 1695241 | TAR-T15971 | Mal-NH-ethyl-SS-propionic acid | TargetMol | |
| 1695240 | TAR-T15970 | Mal-NH-Boc | TargetMol | |
| 1695239 | TAR-T15969 | Mal-N-bis(PEG4-C2-acid) | TargetMol | |
| 1695238 | TAR-T15968 | Mal-C6-amine TFA | TargetMol | |
| 1695237 | TAR-T15967 | Mal-C4-NH-Boc | TargetMol | |
| 1695236 | TAR-T15966 | Mal-amido-PEG9-NH-Boc | TargetMol | |
| 1695235 | TAR-T15965 | Mal-amido-PEG9-amine | TargetMol | |
| 1695234 | TAR-T15964 | Mal-amido-PEG9-acid | TargetMol | |
| 1695233 | TAR-T15963 | Mal-amido-PEG8-TFP ester | TargetMol | |
| 1695232 | TAR-T15961 | Mal-amido-PEG8-C2-acid | TargetMol | |
| 1695231 | TAR-T15959 | Mal-amido-PEG6-NHS ester | TargetMol | |
| 1695230 | TAR-T15958 | Mal-amido-PEG6-acid | TargetMol | |
| 1695229 | TAR-T15957 | Mal-amido-PEG4-TFP ester | TargetMol | |
| 1695228 | TAR-T15955 | Mal-Amido-PEG4-Boc | TargetMol | |
| 1695227 | TAR-T15954 | Mal-amido-PEG4-acid | TargetMol | |
| 1695226 | TAR-T15953 | Mal-amido-PEG2-Val-Cit-PAB-PNP | TargetMol | |
| 1695225 | TAR-T15952 | Mal-amido-PEG2-TFP ester | TargetMol | |
| 1695224 | TAR-T15951 | Mal-amido-PEG2-NHS ester | TargetMol | |
| 1695223 | TAR-T15950 | Mal-amido-PEG2-C2-acid | TargetMol | |
| 1695222 | TAR-T15941 | m-PEG9-phosphonic acid | TargetMol | |
| 1695221 | TAR-T15940 | m-PEG9-Amine | TargetMol | |
| 1695220 | TAR-T15939 | m-PEG8-Tos | TargetMol | |
| 1695219 | TAR-T15938 | m-PEG8-thiol | TargetMol | |
| 1695218 | TAR-T15937 | m-PEG8-succinimidyl carbonate | TargetMol | |
| 1695217 | TAR-T15936 | m-PEG8-NHS ester | TargetMol | |
| 1695216 | TAR-T15935 | m-PEG8-Ms | TargetMol | |
| 1695215 | TAR-T15934 | m-PEG8-Mal | TargetMol | |
| 1695214 | TAR-T15933 | m-PEG8-CH2COOH | TargetMol | |
| 1695213 | TAR-T15932 | m-PEG9-NHS ester | TargetMol | |
| 1695212 | TAR-T15931 | m-PEG8-(CH2)12-phosphonic acid ethyl ester | TargetMol | |
| 1695211 | TAR-T15930 | m-PEG8-C10-phosphonic acid | TargetMol | |
| 1695210 | TAR-T15929 | m-PEG8-Br | TargetMol | |
| 1695209 | TAR-T15928 | m-PEG8-azide | TargetMol | |
| 1695208 | TAR-T15927 | m-PEG8-Amine | TargetMol | |
| 1695207 | TAR-T15926 | m-PEG7-Tos | TargetMol | |
| 1695206 | TAR-T15925 | m-PEG7-NHS ester | TargetMol | |
| 1695205 | TAR-T15924 | m-PEG7-Ms | TargetMol | |
| 1695204 | TAR-T15923 | m-PEG7-CH2CH2COOH | TargetMol | |
| 1695203 | TAR-T15922 | m-PEG7-CH2CH2CHO | TargetMol | |
| 1695202 | TAR-T15921 | m-PEG7-azide | TargetMol | |
| 1695201 | TAR-T15920 | m-PEG7-Amine | TargetMol | |
| 1695200 | TAR-T15918 | m-PEG6-Tos | TargetMol | |
| 1695199 | TAR-T15917 | m-PEG6-thiol | TargetMol | |
| 1695198 | TAR-T15916 | m-PEG6-O-CH2COOH | TargetMol | |
| 1695197 | TAR-T15915 | m-PEG6-NHS ester | TargetMol | |
| 1695196 | TAR-T15914 | m-PEG6-CH2CH2COOH | TargetMol | |
| 1695195 | TAR-T15913 | m-PEG6-CH2CH2CHO | TargetMol | |
| 1695194 | TAR-T15912 | m-PEG6-(CH2)6-Phosphonic acid | TargetMol | |
| 1695193 | TAR-T15911 | m-PEG7-CH2-OH | TargetMol | |
| 1695192 | TAR-T15910 | m-PEG6-C6-phosphonic acid ethyl ester | TargetMol | |
| 1695191 | TAR-T15909 | m-PEG6-Br | TargetMol | |
| 1695190 | TAR-T15908 | m-PEG7-Boc | TargetMol | |
| 1695189 | TAR-T15907 | m-PEG6-azide | TargetMol | |
| 1695188 | TAR-T15906 | m-PEG6-amino-Mal | TargetMol | |
| 1695187 | TAR-T15905 | m-PEG6-Amine | TargetMol | |
| 1695186 | TAR-T15904 | m-PEG6-2-methylacrylate | TargetMol | |
| 1695185 | TAR-T15903 | m-PEG5-Tos | TargetMol | |
| 1695184 | TAR-T15902 | m-PEG5-sulfonic acid | TargetMol | |
| 1695183 | TAR-T15901 | m-PEG5-succinimidyl carbonate | TargetMol | |
| 1695182 | TAR-T15900 | m-PEG5-SH | TargetMol | |
| 1695181 | TAR-T15899 | m-PEG5-phosphonic acid | TargetMol | |
| 1695180 | TAR-T15898 | m-PEG5-phosphonic acid ethyl ester | TargetMol | |
| 1695179 | TAR-T15897 | m-PEG5-nitrile | TargetMol | |
| 1695178 | TAR-T15896 | m-PEG5-NHS ester | TargetMol | |
| 1695177 | TAR-T15895 | m-PEG5-NH2 | TargetMol | |
| 1695176 | TAR-T15894 | m-PEG5-Ms | TargetMol | |
| 1695175 | TAR-T15893 | m-PEG5-CH2COOH | TargetMol | |
| 1695174 | TAR-T15892 | m-PEG5-CH2CH2COOH | TargetMol | |
| 1695173 | TAR-T15891 | m-PEG5-Br | TargetMol | |
| 1695172 | TAR-T15890 | m-PEG5-Boc | TargetMol | |
| 1695171 | TAR-T15889 | m-PEG5-azide | TargetMol | |
| 1695170 | TAR-T15888 | m-PEG5-acid | TargetMol | |
| 1695169 | TAR-T15887 | m-PEG5-2-methylacrylate | TargetMol | |
| 1695168 | TAR-T15886 | m-PEG4-Tos | TargetMol | |
| 1695167 | TAR-T15885 | m-PEG4-sulfonic acid | TargetMol | |
| 1695166 | TAR-T15884 | m-PEG4-propargyl | TargetMol | |
| 1695165 | TAR-T15883 | m-PEG4-phosphonic acid ethyl ester | TargetMol | |
| 1695164 | TAR-T15882 | m-PEG4-O-NHS ester | TargetMol | |
| 1695163 | TAR-T15881 | m-PEG4-NHS ester | TargetMol | |
| 1695162 | TAR-T15880 | m-PEG4-Ms | TargetMol | |
| 1695161 | TAR-T15879 | m-PEG4-Hydrazide | TargetMol | |
| 1695160 | TAR-T15878 | m-PEG4-CH2COOH | TargetMol | |
| 1695159 | TAR-T15877 | m-PEG4-CH2-methyl ester | TargetMol | |
| 1695158 | TAR-T15876 | m-PEG4-CH2-aldehyde | TargetMol | |
| 1695157 | TAR-T15875 | m-PEG4-CH2-acid | TargetMol | |
| 1695156 | TAR-T15874 | m-PEG4-(CH2)6-Phosphonic acid | TargetMol | |
| 1695155 | TAR-T15873 | m-PEG4-C6-phosphonic acid ethyl ester | TargetMol | |
| 1695154 | TAR-T15872 | m-PEG4-Br | TargetMol | |
| 1695153 | TAR-T15871 | m-PEG4-Boc | TargetMol | |
| 1695152 | TAR-T15870 | m-PEG4-azide | TargetMol | |
| 1695151 | TAR-T15869 | m-PEG4-amino-Mal | TargetMol | |
| 1695150 | TAR-T15868 | m-PEG4-Amine | TargetMol | |
| 1695149 | TAR-T15867 | m-PEG4-aldehyde | TargetMol | |
| 1695148 | TAR-T15866 | m-PEG3-Tos | TargetMol | |
| 1695147 | TAR-T15865 | m-PEG3-succinimidyl carbonate | TargetMol | |
| 1695146 | TAR-T15864 | m-PEG3-S-Acetyl | TargetMol | |
| 1695145 | TAR-T15863 | m-PEG3-Propanoyl chloride | TargetMol | |
| 1695144 | TAR-T15862 | m-PEG3-aminooxy-Boc | TargetMol | |
| 1695143 | TAR-T15861 | m-PEG3-OMs | TargetMol | |
| 1695142 | TAR-T15860 | m-PEG3-OH | TargetMol | |
| 1695141 | TAR-T15859 | m-PEG3-NHS ester | TargetMol | |
| 1695140 | TAR-T15858 | m-PEG3-CH2COOH | TargetMol | |
| 1695139 | TAR-T15857 | m-PEG3-CH2CH2COOH | TargetMol | |
| 1695138 | TAR-T15856 | m-PEG3-CH2-alcohol | TargetMol | |
| 1695137 | TAR-T15855 | m-PEG4-CH2-alcohol | TargetMol | |
| 1695136 | TAR-T15854 | m-PEG3-Boc | TargetMol | |
| 1695135 | TAR-T15853 | m-PEG3-azide | TargetMol | |
| 1695134 | TAR-T15852 | m-PEG3-Aminooxy | TargetMol | |
| 1695133 | TAR-T15851 | m-PEG3-Amine | TargetMol | |
| 1695132 | TAR-T15850 | m-PEG3-aldehyde | TargetMol | |
| 1695131 | TAR-T15848 | m-PEG2-Tos | TargetMol | |
| 1695130 | TAR-T15847 | m-PEG2-phosphonic acid | TargetMol | |
| 1695129 | TAR-T15846 | m-PEG2-Ms | TargetMol | |
| 1695128 | TAR-T15845 | m-PEG2-CH2CH2COOH | TargetMol | |
| 1695127 | TAR-T15844 | m-PEG2-azide | TargetMol | |
| 1695126 | TAR-T15843 | m-PEG2-Amino | TargetMol | |
| 1695125 | TAR-T15842 | m-PEG2-Amine | TargetMol | |
| 1695124 | TAR-T15841 | m-PEG2-acid | TargetMol | |
| 1695123 | TAR-T15840 | m-PEG2-4-nitrophenyl carbonate | TargetMol | |
| 1695122 | TAR-T15838 | m-PEG11-Amine | TargetMol | |
| 1695121 | TAR-T15837 | m-PEG10-Tos | TargetMol | |
| 1695120 | TAR-T15836 | m-PEG10-azide | TargetMol | |
| 1695119 | TAR-T15835 | m-PEG10-amine | TargetMol | |
| 1695118 | TAR-T15834 | m-PEG10-alcohol | TargetMol | |
| 1695117 | TAR-T15833 | m-PEG1-NHS ester | TargetMol | |
| 1695116 | TAR-T15832 | m-PEG-OH (MW 2000) | TargetMol | |
| 1695114 | TAR-T15765 | Lipoamido-PEG4-azide | TargetMol | |
| 1695113 | TAR-T15764 | Lipoamido-PEG4-acid | TargetMol | |
| 1695112 | TAR-T15763 | Lipoamido-PEG3-OH | TargetMol | |
| 1695111 | TAR-T15762 | Lipoamido-PEG2-OH | TargetMol | |
| 1695110 | TAR-T15761 | Lipoamide-PEG3-Mal | TargetMol | |
| 1695109 | TAR-T15736 | Leriglitazone | TargetMol | |
| 1695108 | TAR-T15724 | LC-PEG8-SPDP | TargetMol | |
| 1695106 | TAR-T15698 | L-Palmitoylcarnitine | TargetMol | |
| 1695105 | TAR-T15694 | L-Homopropargylglycine | TargetMol | |
| 1695104 | TAR-T15693 | L-Azidohomoalanine | TargetMol | |
| 1695103 | TAR-T15680 | L-159282 | TargetMol | |
| 1695102 | TAR-T15620 | JNJ-5207787 | TargetMol | |
| 1695100 | TAR-T15589 | Iodo-PEG4-N3 | TargetMol | |
| 1695099 | TAR-T15585 | IRBP(668-687) (TFA) | TargetMol | |
| 1695098 | TAR-T15540 | Hydroxy-PEG9-Boc | TargetMol | |
| 1695097 | TAR-T15539 | Hydroxy-PEG8-Boc | TargetMol | |
| 1695096 | TAR-T15538 | Hydroxy-PEG6-CH2-Boc | TargetMol | |
| 1695095 | TAR-T15536 | Hydroxy-PEG6-acid | TargetMol | |
| 1695094 | TAR-T15535 | Hydroxy-PEG5-C2-methyl ester | TargetMol | |
| 1695093 | TAR-T15533 | Hydroxy-PEG4-O-Boc | TargetMol | |
| 1695092 | TAR-T15532 | Hydroxy-PEG4-methylamine | TargetMol | |
| 1695091 | TAR-T15531 | Hydroxy-PEG4-CH2COOH | TargetMol | |
| 1695090 | TAR-T15530 | Hydroxy-PEG4-CH2-Boc | TargetMol | |
| 1695089 | TAR-T15528 | Hydroxy-PEG4-acid | TargetMol | |
| 1695088 | TAR-T15527 | Hydroxy-PEG3-SS-PEG3-alcohol | TargetMol | |
| 1695087 | TAR-T15526 | Hydroxy-PEG3-PFP ester | TargetMol | |
| 1695086 | TAR-T15525 | Hydroxy-PEG3-CH2-Boc | TargetMol | |
| 1695085 | TAR-T15524 | Hydroxy-PEG3-(CH2)2-Boc | TargetMol | |
| 1695084 | TAR-T15523 | Hydroxy-PEG3-C2-methyl ester | TargetMol | |
| 1695083 | TAR-T15522 | Hydroxy-PEG3-acrylate | TargetMol | |
| 1695082 | TAR-T15521L | Hydroxy-PEG2-CH2COONa | TargetMol | |
| 1695081 | TAR-T15521 | Hydroxy-PEG2-CH2COOH | TargetMol | |
| 1695080 | TAR-T15520 | Hydroxy-PEG2-CH2-Boc | TargetMol | |
| 1695079 | TAR-T15519 | Hydroxy-PEG2-(CH2)2-Boc | TargetMol | |
| 1695078 | TAR-T15518 | Hydroxy-PEG2-C2-sulfonic acid | TargetMol | |
| 1695077 | TAR-T15517 | Hydroxy-PEG2-C2-PFP ester | TargetMol | |
| 1695076 | TAR-T15516 | Hydroxy-PEG2-C2-methyl ester | TargetMol | |
| 1695075 | TAR-T15515 | Hydroxy-PEG2-acid | TargetMol | |
| 1695074 | TAR-T15514 | Hydroxy-PEG10-Boc | TargetMol | |
| 1695073 | TAR-T15513 | Hydroxy-PEG1-CH2-Boc | TargetMol | |
| 1695072 | TAR-T15512 | Hydroxy-PEG1-(CH2)2-Boc | TargetMol | |
| 1695071 | TAR-T15511 | Hydroxy-PEG1-C2-methyl ester | TargetMol | |
| 1695070 | TAR-T15510 | Hydroxy-PEG1-acid | TargetMol | |
| 1695069 | TAR-T15509 | Hydroxy-Amino-bis(PEG2-propargyl) | TargetMol | |
| 1695068 | TAR-T15508 | Hydroxy-Amino-bis(PEG1-C2-Boc) | TargetMol | |
| 1695067 | TAR-T15504 | HS-PEG6-CH2CH2-Boc | TargetMol | |
| 1695066 | TAR-T15499 | HOOCCH2O-PEG4-CH2COOH | TargetMol | |
| 1695065 | TAR-T15494 | HO-PEG8-CH2CH2COOH | TargetMol | |
| 1695064 | TAR-T15493 | HO-PEG21-OH | TargetMol | |
| 1695063 | TAR-T15492 | HO-PEG20-OH | TargetMol | |
| 1695062 | TAR-T15491 | HO-PEG17-OH | TargetMol | |
| 1695061 | TAR-T15490 | HO-PEG15-OH | TargetMol | |
| 1695060 | TAR-T15489 | HO-PEG14-OH | TargetMol | |
| 1695059 | TAR-T15488 | HO-PEG11-OH | TargetMol | |
| 1695058 | TAR-T15476 | Hexaethylene glycol | TargetMol | |
| 1695057 | TAR-T15475 | Hexaethylene glycol monomethyl ether | TargetMol | |
| 1695056 | TAR-T15473 | Heptaethylene glycol | TargetMol | |
| 1695055 | TAR-T15459 | H2N-PEG2-CH2COOH | TargetMol | |
| 1695054 | TAR-T15415 | GR 159897 | TargetMol | |
| 1695053 | TAR-T15395 | GMBS | TargetMol | |
| 1695052 | TAR-T15392 | Gly-PEG3-amine | TargetMol | |
| 1695051 | TAR-T15347 | FR167344 free base | TargetMol | |
| 1695050 | TAR-T15334 | Fmoc-PEG6-NHS ester | TargetMol | |
| 1695049 | TAR-T15333 | Fmoc-PEG5-NHS ester | TargetMol | |
| 1695048 | TAR-T15332 | Fmoc-PEG4-NHS ester | TargetMol | |
| 1695047 | TAR-T15331 | Fmoc-PEG4-Ala-Ala-Asn-PAB | TargetMol | |
| 1695046 | TAR-T15330 | Fmoc-PEG3-C2-NHS ester | TargetMol | |
| 1695045 | TAR-T15329 | Fmoc-PEG3-Ala-Ala-Asn(Trt)-PAB | TargetMol | |
| 1695044 | TAR-T15328 | Fmoc-PEG2-C2-NHS ester | TargetMol | |
| 1695043 | TAR-T15327 | Fmoc-PEG1-CH2CH2-NHS ester | TargetMol | |
| 1695042 | TAR-T15326 | Fmoc-NMe-PEG4-C2-acid | TargetMol | |
| 1695041 | TAR-T15325 | Fmoc-NH-PEG9-CH2CH2COOH | TargetMol | |
| 1695040 | TAR-T15323 | Fmoc-NH-PEG8-CH2COOH | TargetMol | |
| 1695039 | TAR-T15322 | Fmoc-NH-PEG8-CH2CH2COOH | TargetMol | |
| 1695038 | TAR-T15321 | Fmoc-NH-PEG6-CH2COOH | TargetMol | |
| 1695037 | TAR-T15320 | Fmoc-NH-PEG6-CH2CH2COOH | TargetMol | |
| 1695036 | TAR-T15319 | Fmoc-NH-PEG5-CH2COOH | TargetMol | |
| 1695035 | TAR-T15318 | Fmoc-NH-PEG4-CH2COOH | TargetMol | |
| 1695034 | TAR-T15317 | Fmoc-NH-PEG4-CH2CH2COOH | TargetMol | |
| 1695033 | TAR-T15316 | Fmoc-NH-PEG3-CH2CH2COOH | TargetMol | |
| 1695032 | TAR-T15315 | Fmoc-NH-PEG2-CH2CH2COOH | TargetMol | |
| 1695031 | TAR-T15314 | Fmoc-NH-PEG1-CH2COOH | TargetMol | |
| 1695030 | TAR-T15313 | Fmoc-NH-PEG1-C2-acid | TargetMol | |
| 1695029 | TAR-T15312 | Fmoc-NH-ethyl-SS-propionic NHS ester | TargetMol | |
| 1695028 | TAR-T15311 | Fmoc-NH-ethyl-SS-propionic acid | TargetMol | |
| 1695027 | TAR-T15310 | Fmoc-N-PEG3-CH2-NHS ester | TargetMol | |
| 1695026 | TAR-T15309 | Fmoc-N-methyl-PEG3-CH2CH2COOH | TargetMol | |
| 1695025 | TAR-T15308 | Fmoc-Lys (biotin-PEG4)-OH | TargetMol | |
| 1695024 | TAR-T15307 | Fmoc-aminooxy-PEG4-acid | TargetMol | |
| 1695023 | TAR-T15306 | Fmoc-amino-PEG5-acid | TargetMol | |
| 1695022 | TAR-T15305 | Fmoc-amino-PEG3-CH2COOH | TargetMol | |
| 1695021 | TAR-T15299 | Fluorescein-thiourea-PEG6-acid | TargetMol | |
| 1695020 | TAR-T15298 | Fluorescein-thiourea-PEG4-azide | TargetMol | |
| 1695019 | TAR-T15297 | Fluorescein-thiourea-PEG2-azide | TargetMol | |
| 1695018 | TAR-T15296 | Fluorescein-PEG6-NHS ester | TargetMol | |
| 1695017 | TAR-T15295 | Fluorescein-PEG6-bis-NHS ester | TargetMol | |
| 1695016 | TAR-T15294 | Fluorescein-PEG5-acid | TargetMol | |
| 1695015 | TAR-T15293 | Fluorescein-PEG4-acid | TargetMol | |
| 1695014 | TAR-T15292 | Fluorescein-PEG3-NH-Boc | TargetMol | |
| 1695013 | TAR-T15291 | Fluorescein-PEG3-amine | TargetMol | |
| 1695012 | TAR-T15290 | Fluorescein-DBCO | TargetMol | |
| 1695011 | TAR-T15287 | Flumazenil acid | TargetMol | |
| 1695010 | TAR-T15240 | Tazemetostat trihydrochloride | TargetMol | |
| 1695009 | TAR-T15231 | endo-BCN-PEG8-NHS ester | TargetMol | |
| 1695008 | TAR-T15230 | endo-BCN-PEG8-acid | TargetMol | |
| 1695007 | TAR-T15229 | endo-BCN-PEG4-PFP ester | TargetMol | |
| 1695006 | TAR-T15228 | endo-BCN-PEG4-NHS ester | TargetMol | |
| 1695005 | TAR-T15227 | endo-BCN-PEG4-Boc | TargetMol | |
| 1695004 | TAR-T15226 | endo-BCN-PEG4-acid | TargetMol | |
| 1695003 | TAR-T15225 | endo-BCN-PEG3-NH-Boc | TargetMol | |
| 1695002 | TAR-T15224 | endo-BCN-PEG3-acid | TargetMol | |
| 1695001 | TAR-T15223 | endo-BCN-PEG2-PFP ester | TargetMol | |
| 1695000 | TAR-T15222 | endo-BCN-PEG2-alcohol | TargetMol | |
| 1694999 | TAR-T15221 | endo-BCN-PEG2-acid | TargetMol | |
| 1694998 | TAR-T15208 | Elisartan | TargetMol | |
| 1694997 | TAR-T15190 | (S,R,S)-AHPC-PEG4-NH2 hydrochloride | TargetMol | |
| 1694996 | TAR-T15161 | Doxorubicin-SMCC | TargetMol | |
| 1694994 | TAR-T15156 | Dodecaethylene glycol | TargetMol | |
| 1694993 | TAR-T15154 | DNP-PEG4-NHS ester | TargetMol | |
| 1694992 | TAR-T15153 | DNP-PEG4-alcohol | TargetMol | |
| 1694991 | TAR-T15152 | DNP-PEG4-acid | TargetMol | |
| 1694990 | TAR-T15151 | DNP-PEG3-DNP | TargetMol | |
| 1694989 | TAR-T15150 | DNP-PEG3-azide | TargetMol | |
| 1694988 | TAR-T15149 | DNP-NH-PEG4-C2-Boc | TargetMol | |
| 1694987 | TAR-T15148 | DNP-NH-PEG2-C2-acid | TargetMol | |
| 1694986 | TAR-T15136L | DiZPK Hydrochloride (1337883-32-5 free base) | TargetMol | |
| 1694984 | TAR-T15132L | Dimetacrine tartrate | TargetMol | |
| 1694983 | TAR-T15127 | Difluoro atorvastatin | TargetMol | |
| 1694982 | TAR-T15125 | Diethylene Glycol Monobenzyl Ether | TargetMol | |
| 1694981 | TAR-T15123 | Diethyl 8-bromooctylphosphonate | TargetMol | |
| 1694980 | TAR-T15122 | Diethyl 7-bromoheptylphosphonate | TargetMol | |
| 1694979 | TAR-T15121 | Diethyl 12-bromododecylphosphonate | TargetMol | |
| 1694978 | TAR-T15120 | Diethyl 10-bromodecylphosphonate | TargetMol | |
| 1694977 | TAR-T15119 | Diethoxy-phosphorylethyl-PEG5-ethylphosphonic acid | TargetMol | |
| 1694976 | TAR-T15115 | Diazo Biotin-PEG3-azide | TargetMol | |
| 1694975 | TAR-T15114 | Diazo Biotin-PEG3-alkyne | TargetMol | |
| 1694974 | TAR-T15113 | Diazepinomicin | TargetMol | |
| 1694973 | TAR-T15100 | Desmethyl cariprazine | TargetMol | |
| 1694972 | TAR-T15099 | Desfluoro-atorvastatin | TargetMol | |
| 1694971 | TAR-T15089 | Decaethylene glycol | TargetMol | |
| 1694970 | TAR-T15086 | Dde Biotin-PEG4-Picolyl azide | TargetMol | |
| 1694969 | TAR-T15085 | Dde Biotin-PEG4-DBCO | TargetMol | |
| 1694968 | TAR-T15084 | Dde Biotin-PEG4-azide | TargetMol | |
| 1694967 | TAR-T15083 | Dde Biotin-PEG4-alkyne | TargetMol | |
| 1694966 | TAR-T15078 | DBCO-Sulfo-NHS ester sodium | TargetMol | |
| 1694965 | TAR-T15077 | DBCO-Sulfo-Link-biotin | TargetMol | |
| 1694964 | TAR-T15075 | DBCO-PEG5-NHS ester | TargetMol | |
| 1694962 | TAR-T15072 | DBCO-PEG4-Maleimide | TargetMol | |
| 1694961 | TAR-T15071 | DBCO-PEG4-DBCO | TargetMol | |
| 1694960 | TAR-T15070 | DBCO-PEG4-C2-acid | TargetMol | |
| 1694959 | TAR-T15068 | DBCO-PEG4-amine | TargetMol | |
| 1694958 | TAR-T15066 | DBCO-NHS ester 2 | TargetMol | |
| 1694957 | TAR-T15065 | DBCO-NHCO-PEG5-NHS ester | TargetMol | |
| 1694956 | TAR-T15064 | DBCO-NHCO-PEG4-NHS ester | TargetMol | |
| 1694955 | TAR-T15063 | DBCO-NHCO-PEG4-NH-Boc | TargetMol | |
| 1694954 | TAR-T15062 | DBCO-NHCO-PEG4-amine | TargetMol | |
| 1694953 | TAR-T15061 | DBCO-NHCO-PEG4-acid | TargetMol | |
| 1694952 | TAR-T15060 | DBCO-Maleimide | TargetMol | |
| 1694951 | TAR-T15059 | DBCO-?C6-?acid | TargetMol | |
| 1694950 | TAR-T15057 | DBCO-acid | TargetMol | |
| 1694946 | TAR-T14952 | Chloroacetamido-PEG4-C2-Boc | TargetMol | |
| 1694945 | TAR-T14951 | Chlorhexidine digluconate | TargetMol | |
| 1694944 | TAR-T14945 | CH-0793076 | TargetMol | |
| 1694943 | TAR-T14892 | Cbz-NH-PEG8-C2-acid | TargetMol | |
| 1694942 | TAR-T14891 | Cbz-NH-PEG6-C2-acid | TargetMol | |
| 1694941 | TAR-T14890 | Cbz-NH-PEG5-C2-acid | TargetMol | |
| 1694940 | TAR-T14889 | Cbz-NH-PEG4-C2-acid | TargetMol | |
| 1694939 | TAR-T14888 | Cbz-NH-PEG3-C2-acid | TargetMol | |
| 1694938 | TAR-T14887 | Cbz-NH-PEG2-C2-acid | TargetMol | |
| 1694937 | TAR-T14874 | Carboxyrhodamine 110-PEG4-alkyne | TargetMol | |
| 1694936 | TAR-T14873 | Carboxyrhodamine 110-PEG3-Azide | TargetMol | |
| 1694935 | TAR-T14870 | Carboxy-PEG5-sulfonic acid | TargetMol | |
| 1694934 | TAR-T14869 | Carboxy-PEG4-sulfonic acid | TargetMol | |
| 1694933 | TAR-T14868 | Carboxy-PEG4-phosphonic acid | TargetMol | |
| 1694932 | TAR-T14867 | Carboxy-PEG4-phosphonic acid ethyl ester | TargetMol | |
| 1694931 | TAR-T14866 | Carboxy-PEG2-sulfonic acid | TargetMol | |
| 1694930 | TAR-T14851 | C2-Bis-phosphoramidic acid diethyl ester | TargetMol | |
| 1694929 | TAR-T14850 | C-NH-Boc-C-Bis-(C1-PEG1-PFP) | TargetMol | |
| 1694928 | TAR-T14849 | C-NH-Boc-C-Bis-(C-PEG1-Boc) | TargetMol | |
| 1694927 | TAR-T14838 | Butoxycarbonyl-PEG5-sulfonic acid | TargetMol | |
| 1694926 | TAR-T14837 | Butane-1,4-diyldiphosphonic acid | TargetMol | |
| 1694925 | TAR-T14833 | BS3 Crosslinker | TargetMol | |
| 1694924 | TAR-T14832 | BS2G Crosslinker disodium | TargetMol | |
| 1694923 | TAR-T14828 | Bromoacetamido-PEG8-Boc | TargetMol | |
| 1694922 | TAR-T14827 | Bromoacetamido-PEG8-acid | TargetMol | |
| 1694921 | TAR-T14826 | Bromoacetamido-PEG5-azide | TargetMol | |
| 1694920 | TAR-T14825 | Bromoacetamido-PEG4-NHS ester | TargetMol | |
| 1694919 | TAR-T14824 | Bromoacetamido-PEG4-C2-Boc | TargetMol | |
| 1694918 | TAR-T14823 | Bromoacetamido-PEG4-acid | TargetMol | |
| 1694917 | TAR-T14822 | Bromoacetamido-PEG3-NH-Boc | TargetMol | |
| 1694916 | TAR-T14821 | Bromoacetamido-PEG3-C2-Boc | TargetMol | |
| 1694915 | TAR-T14820 | Bromoacetamido-PEG3-C2-acid | TargetMol | |
| 1694914 | TAR-T14819 | Bromoacetamido-PEG3-azide | TargetMol | |
| 1694913 | TAR-T14818 | Bromoacetamido-PEG2-C2-NHS ester | TargetMol | |
| 1694912 | TAR-T14817 | Bromoacetamido-PEG2-C2-acid | TargetMol | |
| 1694911 | TAR-T14816 | Bromoacetamido-C2-PEG2-NH-Boc | TargetMol | |
| 1694910 | TAR-T14815 | Bromo-PEG8-Boc | TargetMol | |
| 1694909 | TAR-T14814 | Bromo-PEG6-bromide | TargetMol | |
| 1694908 | TAR-T14813 | Bromo-PEG6-Boc | TargetMol | |
| 1694907 | TAR-T14812 | Bromo-PEG6-azide | TargetMol | |
| 1694906 | TAR-T14811 | Bromo-PEG6-alcohol | TargetMol | |
| 1694905 | TAR-T14810 | Bromo-PEG5-phosphonic acid | TargetMol | |
| 1694904 | TAR-T14809 | Bromo-PEG5-phosphonic acid diethyl ester | TargetMol | |
| 1694903 | TAR-T14808 | Bromo-PEG5-C2-acid | TargetMol | |
| 1694902 | TAR-T14807 | Bromo-PEG5-bromide | TargetMol | |
| 1694901 | TAR-T14806 | Bromo-PEG5-Boc | TargetMol | |
| 1694900 | TAR-T14805 | Bromo-PEG5-azide | TargetMol | |
| 1694899 | TAR-T14804 | Bromo-PEG5-alcohol | TargetMol | |
| 1694898 | TAR-T14803 | Bromo-PEG4-bromide | TargetMol | |
| 1694897 | TAR-T14802 | Bromo-PEG4-azide | TargetMol | |
| 1694896 | TAR-T14801 | Bromo-PEG4-acid | TargetMol | |
| 1694895 | TAR-T14800 | Bromo-PEG3-phosphonic acid diethyl ester | TargetMol | |
| 1694894 | TAR-T14799 | Bromo-PEG3-CH2-Boc | TargetMol | |
| 1694893 | TAR-T14798 | Bromo-PEG3-C2-phosphonic acid | TargetMol | |
| 1694892 | TAR-T14796 | Bromo-PEG3-bromide | TargetMol | |
| 1694891 | TAR-T14795 | Bromo-PEG3-azide | TargetMol | |
| 1694890 | TAR-T14794 | Bromo-PEG2-phosphonic acid | TargetMol | |
| 1694889 | TAR-T14793 | Bromo-PEG2-phosphonic acid diethyl ester | TargetMol | |
| 1694888 | TAR-T14791 | Bromo-PEG2-C2-Boc | TargetMol | |
| 1694887 | TAR-T14790 | Bromo-PEG2-C2-azide | TargetMol | |
| 1694886 | TAR-T14789 | Bromo-PEG2-C2-acid | TargetMol | |
| 1694885 | TAR-T14788 | Bromo-PEG2-bromide | TargetMol | |
| 1694884 | TAR-T14787 | Bromo-PEG2-alcohol | TargetMol | |
| 1694883 | TAR-T14786 | Bromo-PEG1-CH2COOH | TargetMol | |
| 1694882 | TAR-T14785 | Bromo-PEG1-CH2-Boc | TargetMol | |
| 1694881 | TAR-T14784 | Bromo-PEG1-C2-Boc | TargetMol | |
| 1694880 | TAR-T14783 | Bromo-PEG1-acid | TargetMol | |
| 1694879 | TAR-T14773 | Br-PEG4-OH | TargetMol | |
| 1694878 | TAR-T14772 | Br-PEG4-CH2-Boc | TargetMol | |
| 1694877 | TAR-T14771 | Br-PEG4-C2-Boc | TargetMol | |
| 1694876 | TAR-T14770 | Br-PEG3-OH | TargetMol | |
| 1694875 | TAR-T14769 | Br-PEG3-CH2COOH | TargetMol | |
| 1694874 | TAR-T14768 | Br-PEG3-C2-Boc | TargetMol | |
| 1694873 | TAR-T14762 | Boc-PEG4-sulfonic acid | TargetMol | |
| 1694872 | TAR-T14761 | Boc-PEG4-phosphonic acid ethyl ester | TargetMol | |
| 1694871 | TAR-T14760 | Boc-PEG2-sulfonic acid | TargetMol | |
| 1694870 | TAR-T14759 | Boc-NH-PEG9-azide | TargetMol | |
| 1694869 | TAR-T14758 | Boc-NH-PEG8-propargyl | TargetMol | |
| 1694868 | TAR-T14757 | Boc-NH-PEG7-propargyl | TargetMol | |
| 1694867 | TAR-T14755 | Boc-NH-PEG7-azide | TargetMol | |
| 1694866 | TAR-T14754 | Boc-NH-PEG7-acid | TargetMol | |
| 1694865 | TAR-T14753 | Boc-NH-PEG6-propargyl | TargetMol | |
| 1694864 | TAR-T14752 | Boc-NH-PEG6-CH2CH2COOH | TargetMol | |
| 1694863 | TAR-T14751 | Boc-NH-PEG6-azide | TargetMol | |
| 1694862 | TAR-T14750 | Boc-NH-PEG6-amine | TargetMol | |
| 1694861 | TAR-T14749 | Boc-NH-PEG5-propargyl | TargetMol | |
| 1694860 | TAR-T14748 | Boc-NH-PEG5-CH2CH2COOH | TargetMol | |
| 1694859 | TAR-T14747 | Boc-NH-PEG5-azide | TargetMol | |
| 1694858 | TAR-T14745 | Boc-NH-PEG4-C3-acid | TargetMol | |
| 1694857 | TAR-T14744 | Boc-NH-PEG4-azide | TargetMol | |
| 1694856 | TAR-T14743 | Boc-NH-PEG3-sulfonic acid | TargetMol | |
| 1694855 | TAR-T14742 | Boc-NH-PEG3-propargyl | TargetMol | |
| 1694854 | TAR-T14740 | Boc-aminooxy-PEG2-propargyl | TargetMol | |
| 1694853 | TAR-T14739 | Boc-NH-PEG2-NH-Boc | TargetMol | |
| 1694852 | TAR-T14738 | Boc-NH-PEG2-CH2COOH | TargetMol | |
| 1694851 | TAR-T14737 | Boc-NH-PEG2-CH2CH2COOH | TargetMol | |
| 1694850 | TAR-T14736 | Boc-NH-PEG2-C2-NHS ester | TargetMol | |
| 1694849 | TAR-T14735 | Boc-NH-PEG1-CH2COOH | TargetMol | |
| 1694848 | TAR-T14734 | Boc-NH-PEG1-CH2CH2COOH | TargetMol | |
| 1694847 | TAR-T14733 | Boc-NH-ethyl-SS-propionic acid | TargetMol | |
| 1694846 | TAR-T14732 | Boc-N-PEG5-C2-NHS ester | TargetMol | |
| 1694845 | TAR-T14731 | Boc-N-PEG1-C2-NHS ester | TargetMol | |
| 1694844 | TAR-T14730 | Boc-N-Amido-PEG4-propargyl | TargetMol | |
| 1694843 | TAR-T14729 | Boc-N-Amido-PEG3-azide | TargetMol | |
| 1694842 | TAR-T14728 | Boc-N-amido-PEG3-acid | TargetMol | |
| 1694841 | TAR-T14727 | Boc-N-Amido-PEG2-C2-azide | TargetMol | |
| 1694840 | TAR-T14726 | Boc-gly-PEG3-endo-BCN | TargetMol | |
| 1694839 | TAR-T14725 | Boc-Gly-amido-C-PEG3-C3-amine | TargetMol | |
| 1694838 | TAR-T14724 | Boc-Cystamine | TargetMol | |
| 1694837 | TAR-T14723 | Boc-Aminoxy-PEG4-OH | TargetMol | |
| 1694836 | TAR-T14722 | Boc-aminooxy-PEG5-propargyl | TargetMol | |
| 1694835 | TAR-T14721 | Boc-Aminooxy-PEG4-Tos | TargetMol | |
| 1694834 | TAR-T14720 | Boc-aminooxy-PEG4-propargyl | TargetMol | |
| 1694833 | TAR-T14719 | Boc-Aminooxy-PEG4-NH2 | TargetMol | |
| 1694832 | TAR-T14718 | Boc-Aminooxy-PEG4-CH2CO2H | TargetMol | |
| 1694831 | TAR-T14717 | Boc-Aminooxy-PEG4-azide | TargetMol | |
| 1694830 | TAR-T14716 | Boc-Aminooxy-PEG3-thiol | TargetMol | |
| 1694829 | TAR-T14715 | Boc-Aminooxy-PEG3-C2-NH2 | TargetMol | |
| 1694828 | TAR-T14714 | Boc-Aminooxy-PEG3-bromide | TargetMol | |
| 1694827 | TAR-T14713 | Boc-Aminooxy-PEG3-azide | TargetMol | |
| 1694826 | TAR-T14712 | Boc-Aminooxy-PEG3-acid | TargetMol | |
| 1694825 | TAR-T14711 | Boc-Aminooxy-PEG2 | TargetMol | |
| 1694824 | TAR-T14710 | Boc-Aminooxy-PEG2-CH2COOH | TargetMol | |
| 1694823 | TAR-T14709 | Boc-Aminooxy-PEG2-C2-amine | TargetMol | |
| 1694822 | TAR-T14708 | Boc-aminooxy-PEG1-propargyl | TargetMol |