Inhibitors and Activators
Showing 1000 of 56287 products meeting your criteria.
| ID | Code | Name | Supplier | |
|---|---|---|---|---|
| 1693720 | TAR-T62376 | GNE-9278 | TargetMol | |
| 1693719 | TAR-T62363 | Salazopyridazine | TargetMol | |
| 1693718 | TAR-T62335 | MDH1-IN-2 | TargetMol | |
| 1693717 | TAR-T62334 | VII-31 | TargetMol | |
| 1693716 | TAR-T62328 | Cabotegravir sodium | TargetMol | |
| 1693715 | TAR-T62294 | SRI-37330 hydrochloride | TargetMol | |
| 1693714 | TAR-T62290 | SKLB-197 | TargetMol | |
| 1693713 | TAR-T62279 | (±)-U-50488 hydrate hydrochloride | TargetMol | |
| 1693711 | TAR-T62225 | Topoisomerase I inhibitor 8 | TargetMol | |
| 1693710 | TAR-T62200 | Bunamidine hydrochloride | TargetMol | |
| 1693709 | TAR-T62174 | Protein deglycase DJ-1 against-1 | TargetMol | |
| 1693708 | TAR-T62173 | GPR41 agonist-1 | TargetMol | |
| 1693707 | TAR-T62170 | H1PVAT | TargetMol | |
| 1693706 | TAR-T62162 | ALPK1-IN-2 | TargetMol | |
| 1693705 | TAR-T62126 | (Rac)-NMDAR antagonist 1 | TargetMol | |
| 1693704 | TAR-T62123 | FNDR-20123 | TargetMol | |
| 1693703 | TAR-T62056 | (E/Z)-Zotiraciclib hydrochloride | TargetMol | |
| 1693702 | TAR-T62051 | (R)-(+)-Dimethindene maleate | TargetMol | |
| 1693701 | TAR-T62039 | L-365260 hemihydrate | TargetMol | |
| 1693700 | TAR-T62022 | SKI-I | TargetMol | |
| 1693699 | TAR-T62014 | (R,R)-BAY-Y 3118 | TargetMol | |
| 1693698 | TAR-T61987 | PHA 568487 | TargetMol | |
| 1693697 | TAR-T61947 | SIRT5 inhibitor 3 | TargetMol | |
| 1693696 | TAR-T61946 | IMP2-IN-1 | TargetMol | |
| 1693695 | TAR-T61943 | VEGFR-2-IN-5 hydrochloride | TargetMol | |
| 1693694 | TAR-T61933 | MK-0159 | TargetMol | |
| 1693693 | TAR-T61889 | Benoxathian hydrochloride | TargetMol | |
| 1693692 | TAR-T61882 | AT791 | TargetMol | |
| 1693691 | TAR-T61871 | DC-LC3in-D5 | TargetMol | |
| 1693690 | TAR-T61859 | MK-28 | TargetMol | |
| 1693689 | TAR-T61820 | Ar-V7-IN-1 | TargetMol | |
| 1693688 | TAR-T61819 | Claficapavir | TargetMol | |
| 1693687 | TAR-T61805 | 2-Methylthio-AMP | TargetMol | |
| 1693686 | TAR-T61802 | AK-778-XXMU | TargetMol | |
| 1693685 | TAR-T61776 | TEAD-IN-2 | TargetMol | |
| 1693684 | TAR-T61742 | CDK8-IN-11 | TargetMol | |
| 1693683 | TAR-T61736 | CB1/2 agonist 3 | TargetMol | |
| 1693682 | TAR-T61721 | RAGE 229 | TargetMol | |
| 1693681 | TAR-T61702 | SRI-37240 | TargetMol | |
| 1693680 | TAR-T61701 | SHP2-IN-9 | TargetMol | |
| 1693679 | TAR-T61695 | GLUT4-IN-2 | TargetMol | |
| 1693678 | TAR-T61684 | S 17092 | TargetMol | |
| 1693677 | TAR-T61677 | piCRAC-1 | TargetMol | |
| 1693676 | TAR-T61654 | PI3Kα-IN-9 | TargetMol | |
| 1693675 | TAR-T61649 | ATP synthase inhibitor 2 | TargetMol | |
| 1693674 | TAR-T61647 | TrxR-IN-5 | TargetMol | |
| 1693673 | TAR-T61642 | CCW16 | TargetMol | |
| 1693672 | TAR-T61627 | iMDK quarterhydrate | TargetMol | |
| 1693671 | TAR-T61617 | Hcyb1 | TargetMol | |
| 1693670 | TAR-T61588 | AGN 192870 | TargetMol | |
| 1693669 | TAR-T61580 | Autophagy inducer 3 | TargetMol | |
| 1693668 | TAR-T61574 | PD-L1-IN-1 | TargetMol | |
| 1693667 | TAR-T61556 | GRK6-IN-2 | TargetMol | |
| 1693666 | TAR-T61529 | Pirmenol hydrochloride | TargetMol | |
| 1693665 | TAR-T61506 | NBI-31772 hydrate | TargetMol | |
| 1693664 | TAR-T61485 | S07-2010 | TargetMol | |
| 1693663 | TAR-T61483 | GLP-1R modulator C5 | TargetMol | |
| 1693662 | TAR-T61468 | Golotimod hydrochloride | TargetMol | |
| 1693661 | TAR-T61454 | α-NETA | TargetMol | |
| 1693660 | TAR-T6143L | PI-103 Hydrochloride | TargetMol | |
| 1693659 | TAR-T61434 | Mirogabalin besylate | TargetMol | |
| 1693658 | TAR-T61428 | 4-PQBH | TargetMol | |
| 1693657 | TAR-T61389 | TGFβ1-IN-1 | TargetMol | |
| 1693656 | TAR-T61376 | Opipramol | TargetMol | |
| 1693655 | TAR-T61372 | (S)-Baxdrostat | TargetMol | |
| 1693654 | TAR-T61362 | CDK5-IN-3 | TargetMol | |
| 1693653 | TAR-T61357 | EP3 antagonist 3 | TargetMol | |
| 1693652 | TAR-T61348 | Bradanicline | TargetMol | |
| 1693651 | TAR-T61336 | Numidargistat dihydrochloride | TargetMol | |
| 1693650 | TAR-T61334 | DMA-135 hydrochloride | TargetMol | |
| 1693649 | TAR-T61333 | PDE11-IN-1 | TargetMol | |
| 1693648 | TAR-T61306 | SRI-41315 | TargetMol | |
| 1693647 | TAR-T61281 | (Rac)-PF-06256142 | TargetMol | |
| 1693646 | TAR-T61270 | MDH1-IN-1 | TargetMol | |
| 1693645 | TAR-T61265 | Exo2 | TargetMol | |
| 1693644 | TAR-T61255 | SDH-IN-1 | TargetMol | |
| 1693643 | TAR-T61244 | AhR agonist 2 | TargetMol | |
| 1693642 | TAR-T61241 | Bliretrigine | TargetMol | |
| 1693641 | TAR-T61183 | MRGPRX4 modulator-2 | TargetMol | |
| 1693640 | TAR-T61181 | Pentagamavunon-1 | TargetMol | |
| 1693639 | TAR-T61179 | EMI48 | TargetMol | |
| 1693637 | TAR-T61146 | PIPES disodium | TargetMol | |
| 1693636 | TAR-T61132 | NLRP3-IN-11 | TargetMol | |
| 1693635 | TAR-T61120 | Carbonic anhydrase inhibitor 2 | TargetMol | |
| 1693634 | TAR-T61063 | SEN177 | TargetMol | |
| 1693633 | TAR-T61057 | dCeMM4 | TargetMol | |
| 1693632 | TAR-T61055 | GPR40 agonist 6 | TargetMol | |
| 1693631 | TAR-T61048 | Puliginurad | TargetMol | |
| 1693630 | TAR-T61043 | STING agonist-7 | TargetMol | |
| 1693629 | TAR-T61042 | TBT1 | TargetMol | |
| 1693628 | TAR-T61029 | TP0427736 hydrochloride | TargetMol | |
| 1693627 | TAR-T61026 | CaV1.3 antagonist-1 | TargetMol | |
| 1693626 | TAR-T60964 | Tasipimidine sulfate | TargetMol | |
| 1693625 | TAR-T60953 | BSc5367 | TargetMol | |
| 1693624 | TAR-T60950 | Pirepemat fumarate | TargetMol | |
| 1693623 | TAR-T60944 | (±)-Levomepromazine | TargetMol | |
| 1693622 | TAR-T60929 | Brassinazole | TargetMol | |
| 1693621 | TAR-T60926 | FSG67 | TargetMol | |
| 1693620 | TAR-T60877 | Mtb ATP synthase-IN-1 | TargetMol | |
| 1693619 | TAR-T60872 | Adenosine receptor antagonist 3 | TargetMol | |
| 1693618 | TAR-T60868 | NF-κB-IN-4 | TargetMol | |
| 1693617 | TAR-T60857 | MKK7-COV-9 | TargetMol | |
| 1693616 | TAR-T60845 | MMP2-IN-1 | TargetMol | |
| 1693615 | TAR-T60835 | SKF83959 | TargetMol | |
| 1693614 | TAR-T60834 | Phentolamine hydrochloride | TargetMol | |
| 1693613 | TAR-T60799 | Peldesine dihydrochloride | TargetMol | |
| 1693612 | TAR-T60798 | SK1- I hydrochloride | TargetMol | |
| 1693611 | TAR-T60796 | Cholesterol 24-hydroxylase-IN-1 | TargetMol | |
| 1693609 | TAR-T60785 | SARS-CoV-2-IN-6 | TargetMol | |
| 1693608 | TAR-T60777 | EM127 | TargetMol | |
| 1693607 | TAR-T60770 | PqsR/LasR-IN-3 | TargetMol | |
| 1693606 | TAR-T60762 | PCAF-IN-1 | TargetMol | |
| 1693605 | TAR-T60759 | DS20362725 | TargetMol | |
| 1693604 | TAR-T60742 | HIV-1 integrase inhibitor 8 | TargetMol | |
| 1693603 | TAR-T60718 | 3-IN-PP1 | TargetMol | |
| 1693602 | TAR-T60713 | TK-129 | TargetMol | |
| 1693601 | TAR-T60698 | Roxyl-9 | TargetMol | |
| 1693600 | TAR-T60696 | CXCR2 antagonist 8 | TargetMol | |
| 1693599 | TAR-T60684 | FBA-IN-1 | TargetMol | |
| 1693598 | TAR-T60680 | Tegaserod | TargetMol | |
| 1693597 | TAR-T60674 | DK1 | TargetMol | |
| 1693596 | TAR-T60668 | MAT2A inhibitor 3 | TargetMol | |
| 1693595 | TAR-T60667 | NAT | TargetMol | |
| 1693594 | TAR-T60662 | MS117 | TargetMol | |
| 1693593 | TAR-T60654 | KDM4C-IN-1 | TargetMol | |
| 1693592 | TAR-T60652 | NHE3-IN-2 | TargetMol | |
| 1693591 | TAR-T60649 | AV-153 free base | TargetMol | |
| 1693590 | TAR-T60636 | Pitolisant | TargetMol | |
| 1693589 | TAR-T60616 | MPT0G211 | TargetMol | |
| 1693588 | TAR-T60613 | Mab Aspartate Decarboxylase-IN-1 | TargetMol | |
| 1693587 | TAR-T60608 | FPFT-2216 | TargetMol | |
| 1693585 | TAR-T60604 | XST-14 | TargetMol | |
| 1693584 | TAR-T60603 | BRD9500 | TargetMol | |
| 1693583 | TAR-T60593 | KDM4-IN-3 | TargetMol | |
| 1693582 | TAR-T60571 | O-GlcNAcase-IN-1 | TargetMol | |
| 1693581 | TAR-T60550 | ALDH1A3-IN-1 | TargetMol | |
| 1693580 | TAR-T60547 | PF-06761281 | TargetMol | |
| 1693579 | TAR-T60539 | KG-548 | TargetMol | |
| 1693578 | TAR-T60537 | ARUK3001185 | TargetMol | |
| 1693577 | TAR-T60516 | BPTF-IN-BZ1 | TargetMol | |
| 1693576 | TAR-T60515 | CaMKIIα-IN-1 | TargetMol | |
| 1693575 | TAR-T60508 | (S)-Venlafaxine | TargetMol | |
| 1693574 | TAR-T60507 | Utreloxastat | TargetMol | |
| 1693573 | TAR-T60503 | MFI8 | TargetMol | |
| 1693572 | TAR-T60483 | Fasedienol | TargetMol | |
| 1693571 | TAR-T60478 | BTX161 | TargetMol | |
| 1693570 | TAR-T60475 | RRD-251 | TargetMol | |
| 1693569 | TAR-T60455 | Antibacterial agent 65 | TargetMol | |
| 1693568 | TAR-T60452 | PCAF-IN-2 | TargetMol | |
| 1693567 | TAR-T60447 | α-Amylase-IN-3 | TargetMol | |
| 1693566 | TAR-T60441 | DK3 | TargetMol | |
| 1693565 | TAR-T60435 | Propacetamol | TargetMol | |
| 1693564 | TAR-T60429 | SY-LB-57 | TargetMol | |
| 1693563 | TAR-T60413 | HIF-IN-1 | TargetMol | |
| 1693562 | TAR-T60411 | Primaquine | TargetMol | |
| 1693561 | TAR-T60407 | L-Buthionine-(S,R)-sulfoximine hydrochloride | TargetMol | |
| 1693560 | TAR-T60406 | DL-Buthionine-(S,R)-sulfoximine hydrochloride | TargetMol | |
| 1693559 | TAR-T60398 | Dimethyl-bisphenol A | TargetMol | |
| 1693558 | TAR-T60395 | Nrf2-ARE/hMAO-B/QR2 modulator 1 | TargetMol | |
| 1693557 | TAR-T60388 | MIF098 | TargetMol | |
| 1693556 | TAR-T60384 | VU0420373 | TargetMol | |
| 1693555 | TAR-T60376 | COQ7-IN-2 | TargetMol | |
| 1693554 | TAR-T60372 | ALDH3A1-IN-1 | TargetMol | |
| 1693553 | TAR-T60367 | TG003 | TargetMol | |
| 1693552 | TAR-T60365 | SY-LB-35 | TargetMol | |
| 1693551 | TAR-T60352 | ML089 | TargetMol | |
| 1693550 | TAR-T60343 | Tipiracil | TargetMol | |
| 1693549 | TAR-T60339 | PKN1/2-IN-1 | TargetMol | |
| 1693548 | TAR-T60333 | Cyclopentenyl uracil | TargetMol | |
| 1693547 | TAR-T60326 | CAPSO | TargetMol | |
| 1693546 | TAR-T60323 | Mopivabil | TargetMol | |
| 1693545 | TAR-T60318 | IDO1/TDO-IN-4 | TargetMol | |
| 1693544 | TAR-T60288 | 3?-Deoxyuridine | TargetMol | |
| 1693543 | TAR-T60284 | 4-(Phenyldiazenyl)benzoic acid | TargetMol | |
| 1693542 | TAR-T60274 | TG-2-IN-1 | TargetMol | |
| 1693541 | TAR-T60273 | Mirin | TargetMol | |
| 1693540 | TAR-T60270 | (R)-Preclamol | TargetMol | |
| 1693539 | TAR-T60268 | Benzylthiouracil | TargetMol | |
| 1693538 | TAR-T60266 | (Rac)-Indoximod | TargetMol | |
| 1693537 | TAR-T60265 | NV-5138 hydrochloride | TargetMol | |
| 1693535 | TAR-T60242 | (RS)-AMPA monohydrate | TargetMol | |
| 1693534 | TAR-T60238 | Acloproxalap | TargetMol | |
| 1693532 | TAR-T5700 | PDD00017273 | TargetMol | |
| 1693531 | TAR-T5501 | Clopidogrel thiolactone | TargetMol | |
| 1693530 | TAR-T5499 | gardiquimod TFA salt | TargetMol | |
| 1693529 | TAR-T5339 | YZ129 | TargetMol | |
| 1693527 | TAR-T5033L | Olprinone Hydrochloride | TargetMol | |
| 1693526 | TAR-T4557 | Amylmetacresol | TargetMol | |
| 1693525 | TAR-T4246L | Varenicline | TargetMol | |
| 1693524 | TAR-T41331 | Cyprodinil | TargetMol | |
| 1693523 | TAR-T41322 | Dimethomorph | TargetMol | |
| 1693522 | TAR-T41260 | SC144 hydrochloride | TargetMol | |
| 1693520 | TAR-T41249 | Tenofovir alafenamide fumarate | TargetMol | |
| 1693518 | TAR-T41236 | Z-FY-CHO | TargetMol | |
| 1693517 | TAR-T39377 | Thalidomide-PEG2-NH2 | TargetMol | |
| 1693516 | TAR-T38746 | Fmoc-D-Val-Cit-PAB | TargetMol | |
| 1693515 | TAR-T36503 | Sodium Hydrogen Sulfide (hydrate) | TargetMol | |
| 1693514 | TAR-T35372 | Zinc acetate | TargetMol | |
| 1693512 | TAR-T28775 | Sibrafiban | TargetMol | |
| 1693510 | TAR-T22238 | Alvimopan dihydrate (LY246736 dihydrate) | TargetMol | |
| 1693509 | TAR-T22233 | Aliskiren | TargetMol | |
| 1693508 | TAR-T22104 | ML-291 | TargetMol | |
| 1693507 | TAR-T22002 | (±)-U-50488 hydrochloride | TargetMol | |
| 1693506 | TAR-T21950 | K 00546 | TargetMol | |
| 1693505 | TAR-T21911 | Rilmenidine (hemifumarate) | TargetMol | |
| 1693504 | TAR-T21842 | 2-fluoro Palmitic Acid | TargetMol | |
| 1693503 | TAR-T21836 | Zileuton sodium | TargetMol | |
| 1693502 | TAR-T21750 | A 784168 | TargetMol | |
| 1693500 | TAR-T21705 | 8-CPT-Cyclic AMP (sodium salt) | TargetMol | |
| 1693499 | TAR-T21650 | IWP-3 | TargetMol | |
| 1693498 | TAR-T21637 | SB-505124 hydrochloride | TargetMol | |
| 1693497 | TAR-T21633 | N-3-oxo-dodecanoyl-L-Homoserine lactone | TargetMol | |
| 1693496 | TAR-T21586 | Methsuximide | TargetMol | |
| 1693495 | TAR-T21558 | MK-3207 | TargetMol | |
| 1693494 | TAR-T21547 | PAF (C16) | TargetMol | |
| 1693493 | TAR-T21501 | 5,15-DPP | TargetMol | |
| 1693489 | TAR-T19338 | Gelucire 44/14 | TargetMol | |
| 1693486 | TAR-T15203 | EGNHS | TargetMol | |
| 1693485 | TAR-T14597 | Biotin-PEG4-acid | TargetMol | |
| 1693484 | TAR-T14527 | Benfluralin | TargetMol | |
| 1693483 | TAR-T14250 | Amino-PEG8-amine | TargetMol | |
| 1693481 | TAR-T127402 | Coenzyme Q0 | TargetMol | |
| 1693480 | TAR-T1272L | Cytarabine hydrochloride | TargetMol | |
| 1693479 | TAR-T1271 | Pronetalol | TargetMol | |
| 1693478 | TAR-T12569 | PSB-12379 | TargetMol | |
| 1693477 | TAR-T12440 | PGAM1-IN-2 | TargetMol | |
| 1693476 | TAR-T12439 | PGAM1-IN-1 | TargetMol | |
| 1693475 | TAR-T12175 | Naquotinib mesylate | TargetMol | |
| 1693474 | TAR-T11095 | DREADD agonist 21 dihydrochloride | TargetMol | |
| 1693473 | TAR-T10560 | P2X3 antagonist 34 | TargetMol | |
| 1693472 | TAR-T10476 | BAY-899 | TargetMol | |
| 1693471 | TAR-T0817 | 4-Aminopyridine | TargetMol | |
| 1693470 | TAR-T0711L | Niclosamide olamine | TargetMol | |
| 1693469 | TAR-T0459L | Sulindac sulfide | TargetMol | |
| 1693468 | TAR-T0105 | Carbachol | TargetMol | |
| 1693467 | TAR-Fr12799 | Compound Fr12799 | TargetMol | |
| 1693464 | TAR-T9730 | AGI-41998 | TargetMol | |
| 1693463 | TAR-T9686 | YH-53 | TargetMol | |
| 1693462 | TAR-T9671 | X77 | TargetMol | |
| 1693461 | TAR-T9669 | EST73502 hydrochloride | TargetMol | |
| 1693460 | TAR-T9665 | Esuberaprost Sodium | TargetMol | |
| 1693459 | TAR-T9661 | MB710 | TargetMol | |
| 1693458 | TAR-T9634 | Bomedemstat | TargetMol | |
| 1693457 | TAR-T9574 | PF-07304814 | TargetMol | |
| 1693456 | TAR-T9529 | TAK-020 | TargetMol | |
| 1693455 | TAR-T9424 | Temgicoluril | TargetMol | |
| 1693454 | TAR-T9175 | Casein Kinase inhibitor A51 | TargetMol | |
| 1693453 | TAR-T9134 | UNC5293 | TargetMol | |
| 1693452 | TAR-T8817 | TIE-2/VEGFR-2 kinase-IN-1 | TargetMol | |
| 1693450 | TAR-T8400 | Pamidronic acid | TargetMol | |
| 1693448 | TAR-T77684 | 4-(2-Aminoethyl)amino-7-chloroquinoline | TargetMol | |
| 1693447 | TAR-T77581 | KM02894 | TargetMol | |
| 1693444 | TAR-T7401 | (S)-3-AMino-2-Methylpropanoic acid-HCl | TargetMol | |
| 1693442 | TAR-T67773 | 6,7-Dihydro-2-(2,4,6-trimethylphenyl)-5H-pyrrolo[2,1-c]-1,2,4-triazolium Perchlorate | TargetMol | |
| 1693440 | TAR-T64789 | ((3S,5R)-5-((1H-1,2,4-Triazol-1-yl)methyl)-5-(2,4-difluorophenyl)tetrahydrofuran-3-yl)methyl 4-methylbenzenesulfonate | TargetMol | |
| 1693439 | TAR-T64352 | Tiliquinol | TargetMol | |
| 1693437 | TAR-T64322 | 4-(9H-fluoren-9-ylmethoxycarbonylamino)-piperidine-1,4-dicarboxylic acid mono-tert-butyl ester | TargetMol | |
| 1693435 | TAR-T64232 | Agatolimod | TargetMol | |
| 1693434 | TAR-T64167 | BI-853520 | TargetMol | |
| 1693433 | TAR-T64165 | Gln-AMS TFA | TargetMol | |
| 1693432 | TAR-T64157 | OXi8007 | TargetMol | |
| 1693431 | TAR-T64119 | SSTR5 antagonist 2 hydrochloride | TargetMol | |
| 1693430 | TAR-T64101 | FTI-2153 TFA | TargetMol | |
| 1693429 | TAR-T64092 | (+)-JNJ-A07 | TargetMol | |
| 1693428 | TAR-T64091 | (-)-JNJ-A07 | TargetMol | |
| 1693427 | TAR-T64087 | GZD856 formic | TargetMol | |
| 1693426 | TAR-T64078 | MRS2179 tetrasodium hydrate | TargetMol | |
| 1693425 | TAR-T64068 | KIF18A-IN-3 | TargetMol | |
| 1693424 | TAR-T64016 | WS-898 | TargetMol | |
| 1693423 | TAR-T64010 | ABN401 | TargetMol | |
| 1693422 | TAR-T63935 | Bomedemstat hydrochloride | TargetMol | |
| 1693421 | TAR-T63899 | RECQL5-IN-1 | TargetMol | |
| 1693420 | TAR-T63887 | SOS1-IN-14 | TargetMol | |
| 1693419 | TAR-T63859 | DNMT3A-IN-1 | TargetMol | |
| 1693418 | TAR-T63831 | SID 26681509 quarterhydrate | TargetMol | |
| 1693417 | TAR-T63773 | Aurora kinase inhibitor-8 | TargetMol | |
| 1693416 | TAR-T63771 | CC-99282 | TargetMol | |
| 1693415 | TAR-T63729 | GPX4-IN-3 | TargetMol | |
| 1693414 | TAR-T63726 | AM-5308 | TargetMol | |
| 1693413 | TAR-T63717 | CAM833 | TargetMol | |
| 1693412 | TAR-T63686 | FHT-1204 | TargetMol | |
| 1693411 | TAR-T63651 | IDO1/2-IN-1 hydrochloride | TargetMol | |
| 1693410 | TAR-T63573 | WF-47-JS03 | TargetMol | |
| 1693409 | TAR-T63569 | HSD-016 | TargetMol | |
| 1693408 | TAR-T63550 | (1S,3R,5R)-PIM447 dihydrochloride | TargetMol | |
| 1693407 | TAR-T63544 | RIPK3-IN-1 | TargetMol | |
| 1693406 | TAR-T63512 | LpxC-IN-10 | TargetMol | |
| 1693405 | TAR-T63503 | CCT369260 | TargetMol | |
| 1693404 | TAR-T63497 | PI3Kδ/γ-IN-1 | TargetMol | |
| 1693403 | TAR-T63466 | Envonalkib | TargetMol | |
| 1693402 | TAR-T63423 | AFM-30a hydrochloride | TargetMol | |
| 1693401 | TAR-T63421 | GSK2647544 | TargetMol | |
| 1693400 | TAR-T63412 | DB772 hydrate | TargetMol | |
| 1693399 | TAR-T63411 | CCG258747 | TargetMol | |
| 1693398 | TAR-T63405 | NAZ2329 | TargetMol | |
| 1693397 | TAR-T63390 | (S,S)-TAPI-1 | TargetMol | |
| 1693396 | TAR-T63385 | SARS-CoV-2 3CLpro-IN-2 | TargetMol | |
| 1693395 | TAR-T63289 | (1R)-Tenofovir amibufenamide | TargetMol | |
| 1693394 | TAR-T63287 | HPK1-IN-3 | TargetMol | |
| 1693393 | TAR-T63244 | MG-2119 | TargetMol | |
| 1693392 | TAR-T63204 | BAY-888 | TargetMol | |
| 1693391 | TAR-T63199 | Dalpiciclib hydrochloride | TargetMol | |
| 1693390 | TAR-T63141 | ASP-4058 hydrochloride | TargetMol | |
| 1693389 | TAR-T63095 | GNE 220 hydrochloride | TargetMol | |
| 1693388 | TAR-T63088 | NOD2 antagonist 1 | TargetMol | |
| 1693387 | TAR-T63082 | IDO1-IN-19 | TargetMol | |
| 1693386 | TAR-T63060 | AAA-10 | TargetMol | |
| 1693385 | TAR-T63040 | GNF2133 hydrochloride | TargetMol | |
| 1693384 | TAR-T63024 | (Rac)-CFT7455 | TargetMol | |
| 1693383 | TAR-T63019 | GKA50 quarterhydrate | TargetMol | |
| 1693382 | TAR-T63013 | Ruboxistaurin | TargetMol | |
| 1693381 | TAR-T63008 | PERK-IN-5 | TargetMol | |
| 1693380 | TAR-T62996 | 10-Formyl-5,8-dideazafolic acid | TargetMol | |
| 1693379 | TAR-T62974 | Pactimibe sulfate | TargetMol | |
| 1693378 | TAR-T62919 | CDK9-IN-13 | TargetMol | |
| 1693377 | TAR-T62907 | TAS-117 hydrochloride | TargetMol | |
| 1693376 | TAR-T62900 | PDE10-IN-5 | TargetMol | |
| 1693375 | TAR-T62898 | Glucosylceramide synthase-IN-1 | TargetMol | |
| 1693374 | TAR-T62882 | Ezurpimtrostat hydrochloride | TargetMol | |
| 1693373 | TAR-T62870 | FABPs ligand 6 | TargetMol | |
| 1693372 | TAR-T62853 | UNC9994 hydrochloride | TargetMol | |
| 1693371 | TAR-T62847 | AMXI-5001 | TargetMol | |
| 1693370 | TAR-T62844 | GGTI-2154 hydrochloride | TargetMol | |
| 1693369 | TAR-T62798 | GDC-1971 | TargetMol | |
| 1693368 | TAR-T62795 | BAY 2476568 | TargetMol | |
| 1693367 | TAR-T62731 | ZK824190 hydrochloride | TargetMol | |
| 1693366 | TAR-T62684 | ATM Inhibitor-5 | TargetMol | |
| 1693365 | TAR-T62677 | Ganaplacide hydrochloride | TargetMol | |
| 1693364 | TAR-T62664 | Glucosylceramide synthase-IN-2 | TargetMol | |
| 1693363 | TAR-T62641 | EP2 receptor antagonist-1 | TargetMol | |
| 1693362 | TAR-T62608 | Sovesudil hydrochloride | TargetMol | |
| 1693361 | TAR-T62568 | IXA6 | TargetMol | |
| 1693360 | TAR-T62460 | INCB38579 | TargetMol | |
| 1693359 | TAR-T62453 | Orexin receptor antagonist 3 | TargetMol | |
| 1693358 | TAR-T62436 | KY-02327 acetate | TargetMol | |
| 1693357 | TAR-T62340 | NBD-14189 | TargetMol | |
| 1693356 | TAR-T62325 | CXCR7 antagonist-1 hydrochloride | TargetMol | |
| 1693355 | TAR-T62312 | Panamesine | TargetMol | |
| 1693353 | TAR-T62282 | ADAMTS-5-IN-3 | TargetMol | |
| 1693352 | TAR-T62261 | GPR84 antagonist 1 | TargetMol | |
| 1693351 | TAR-T62220 | DGAT1-IN-3 | TargetMol | |
| 1693350 | TAR-T62184 | NRX-2663 | TargetMol | |
| 1693349 | TAR-T62108 | ErSO-DFP | TargetMol | |
| 1693348 | TAR-T62080 | GSK3494245 | TargetMol | |
| 1693347 | TAR-T62074 | MYF-03-176 | TargetMol | |
| 1693346 | TAR-T62045 | ST-193 hydrochloride | TargetMol | |
| 1693345 | TAR-T62036 | Sovesudil | TargetMol | |
| 1693344 | TAR-T62011 | LDN-209929 dihydrochloride | TargetMol | |
| 1693343 | TAR-T61985 | EHT 5372 | TargetMol | |
| 1693342 | TAR-T61964 | RXFP3/4 agonist 2 | TargetMol | |
| 1693341 | TAR-T61941 | BMT-090605 hydrochloride | TargetMol | |
| 1693340 | TAR-T61930 | Yhhu-3792 | TargetMol | |
| 1693339 | TAR-T61878 | N-Demethyl MK-6884 | TargetMol | |
| 1693338 | TAR-T61786 | Selnoflast | TargetMol | |
| 1693337 | TAR-T61754 | TMX-4116 | TargetMol | |
| 1693336 | TAR-T61725 | VU0463271 quarterhydrate | TargetMol | |
| 1693335 | TAR-T61708 | AZD 2066 hydrate | TargetMol | |
| 1693334 | TAR-T61681 | CD38 inhibitor 2 | TargetMol | |
| 1693333 | TAR-T61663 | SBI-581 | TargetMol | |
| 1693332 | TAR-T61659 | CC214-2 | TargetMol | |
| 1693331 | TAR-T61590 | DS96432529 | TargetMol | |
| 1693330 | TAR-T61578 | BRD3731 | TargetMol | |
| 1693329 | TAR-T61539 | AXKO-0046 | TargetMol | |
| 1693328 | TAR-T61521 | NJH-2-030 | TargetMol | |
| 1693327 | TAR-T61495 | Medroxalol | TargetMol | |
| 1693326 | TAR-T61386 | CXCR2 antagonist 2 | TargetMol | |
| 1693325 | TAR-T61232 | (Rac)-Upacicalcet | TargetMol | |
| 1693324 | TAR-T61215 | Alinidine hydrobromide | TargetMol | |
| 1693323 | TAR-T61168 | CAY10590 | TargetMol | |
| 1693322 | TAR-T61086 | HN37 | TargetMol | |
| 1693321 | TAR-T61024 | PK9327 | TargetMol | |
| 1693320 | TAR-T60976 | Bezuclastinib | TargetMol | |
| 1693319 | TAR-T60969 | Myt1-IN-1 | TargetMol | |
| 1693318 | TAR-T60894 | TLR7/8 agonist 4 | TargetMol | |
| 1693317 | TAR-T60887 | (Rac)-RP-6306 | TargetMol | |
| 1693316 | TAR-T60884 | NSC 107512 | TargetMol | |
| 1693315 | TAR-T60860 | Cinnamyl-3,4-dihydroxy-α-cyanocinnamate | TargetMol | |
| 1693313 | TAR-T60852 | Anticancer agent 46 | TargetMol | |
| 1693312 | TAR-T60839 | SLMP53-1 | TargetMol | |
| 1693311 | TAR-T60782 | THK-5470 | TargetMol | |
| 1693310 | TAR-T60740 | TMX-4113 | TargetMol | |
| 1693309 | TAR-T60701 | Fludarabine-Cl | TargetMol | |
| 1693308 | TAR-T60695 | DPQ | TargetMol | |
| 1693307 | TAR-T60629 | PF-06649298 | TargetMol | |
| 1693306 | TAR-T60625 | Tigulixostat | TargetMol | |
| 1693305 | TAR-T60554 | Schnurri-3 inhibitor-1 | TargetMol | |
| 1693304 | TAR-T60548 | Guanoxabenz hydrochloride | TargetMol | |
| 1693303 | TAR-T60428 | Cibenzoline | TargetMol | |
| 1693302 | TAR-T60338 | Antibacterial agent 117 | TargetMol | |
| 1693301 | TAR-T60319 | AZ8838 | TargetMol | |
| 1693300 | TAR-T4233L | Cysteinylglycine acetate | TargetMol | |
| 1693299 | TAR-T41299 | L-Methionine-DL-sulfoximine | TargetMol | |
| 1693298 | TAR-T41281 | N-Methylprotoporphyrin IX | TargetMol | |
| 1693297 | TAR-T41246 | Thromboxane B2 | TargetMol | |
| 1693296 | TAR-T41237 | W146 TFA | TargetMol | |
| 1693295 | TAR-T39953 | Pomalidomide-amino-PEG3-NH2 hydrochloride | TargetMol | |
| 1693294 | TAR-T39866 | Pomalidomide-amino-PEG4-NH2 | TargetMol | |
| 1693293 | TAR-T39806 | Pomalidomide 4'-PEG3-azide | TargetMol | |
| 1693292 | TAR-T39735 | (S,R,S)-AHPC-PEG1-NH2 | TargetMol | |
| 1693291 | TAR-T39427 | Thalidomide-O-amido-PEG-C2-NH2 | TargetMol | |
| 1693290 | TAR-T39379 | Thalidomide-PEG3-NH2 | TargetMol | |
| 1693289 | TAR-T38926 | Azido-PEG7-CH2COOH | TargetMol | |
| 1693288 | TAR-T37575 | GLcNAc1-b-PNP | TargetMol | |
| 1693287 | TAR-T35346 | Tiamulin fumarate | TargetMol | |
| 1693286 | TAR-T3521 | Compound E | TargetMol | |
| 1693285 | TAR-T30543 | BMS-911172 | TargetMol | |
| 1693284 | TAR-T28536 | RI(dl)-2 TFA | TargetMol | |
| 1693283 | TAR-T2408 | Ostarine | TargetMol | |
| 1693282 | TAR-T22197 | CFM 1571 hydrochloride | TargetMol | |
| 1693281 | TAR-T22196 | CD 2314 | TargetMol | |
| 1693280 | TAR-T22146 | S-1 Methanandamide | TargetMol | |
| 1693279 | TAR-T22087 | HLI 373 | TargetMol | |
| 1693278 | TAR-T21949 | Calpain Inhibitor XII | TargetMol | |
| 1693277 | TAR-T21752 | AL 8810 | TargetMol | |
| 1693276 | TAR-T21697 | Sp-Cyclic AMPS (sodium salt) | TargetMol | |
| 1693275 | TAR-T21684 | Bufuralol (hydrochloride) | TargetMol | |
| 1693274 | TAR-T21509 | CA 074 | TargetMol | |
| 1693273 | TAR-T20938 | o,p'-DDT | TargetMol | |
| 1693272 | TAR-T14594 | Biotin-PEG3-NHS ester | TargetMol | |
| 1693270 | TAR-T13765 | MAK683-CH2CH2COOH | TargetMol | |
| 1693269 | TAR-T12888 | MGV354 | TargetMol | |
| 1693268 | TAR-T12342 | P053 | TargetMol | |
| 1693267 | TAR-T12271 | NV03 | TargetMol | |
| 1693266 | TAR-T11674 | IRAK4-IN-6 | TargetMol | |
| 1693265 | TAR-T0745 | Disodium monofluorophosphate | TargetMol | |
| 1693203 | TAR-T9819 | Bunazosin | TargetMol | |
| 1693202 | TAR-T9654 | JNJ-54717793 | TargetMol | |
| 1693201 | TAR-T9423 | Alkyne tyramide | TargetMol | |
| 1693200 | TAR-T9126 | PIP-199 | TargetMol | |
| 1693199 | TAR-T77675 | TNKS-2-IN-1 | TargetMol | |
| 1693198 | TAR-T77674 | 3-Cyano-7-hydroxycoumarin | TargetMol | |
| 1693197 | TAR-T77657 | MSNBA | TargetMol | |
| 1693196 | TAR-T77643 | 2-(Chloromethyl)Imidazo[1,2-A]Pyridine | TargetMol | |
| 1693195 | TAR-T74140 | β-D-Glucan | TargetMol | |
| 1693194 | TAR-T73585 | PU.1-IN-1 | TargetMol | |
| 1693193 | TAR-T73191 | LONP1-IN-2 | TargetMol | |
| 1693192 | TAR-T72077 | Imidacloprid-urea | TargetMol | |
| 1693191 | TAR-T7071 | Oxyphenisatine | TargetMol | |
| 1693190 | TAR-T64851 | Phenprobamate | TargetMol | |
| 1693189 | TAR-T64332 | Glimepiride sulfonamide | TargetMol | |
| 1693188 | TAR-T64318 | Capecitabine-2',3'-cyclic Carbonate | TargetMol | |
| 1693187 | TAR-T64280 | ODN 2216 | TargetMol | |
| 1693186 | TAR-T64278 | ODN 2088 | TargetMol | |
| 1693185 | TAR-T64277 | ODN 1585 | TargetMol | |
| 1693184 | TAR-T64264 | ISIS 104838 | TargetMol | |
| 1693183 | TAR-T64236 | AS 1411 | TargetMol | |
| 1693182 | TAR-T64217 | SM-433 hydrochloride | TargetMol | |
| 1693181 | TAR-T64186 | CARM1-IN-1 hydrochloride | TargetMol | |
| 1693180 | TAR-T64120 | SETDB1-TTD-IN-1 TFA | TargetMol | |
| 1693179 | TAR-T64104 | JAK2/FLT3-IN-1 TFA | TargetMol | |
| 1693178 | TAR-T64046 | BMS-820132 | TargetMol | |
| 1693177 | TAR-T64042 | BTK inhibitor 18 | TargetMol | |
| 1693176 | TAR-T64001 | MAP855 | TargetMol | |
| 1693175 | TAR-T63969 | SM-433 | TargetMol | |
| 1693174 | TAR-T63956 | OP-5244 sodium | TargetMol | |
| 1693173 | TAR-T63930 | DI-1859 | TargetMol | |
| 1693172 | TAR-T63892 | RAD51-IN-5 | TargetMol | |
| 1693171 | TAR-T63751 | GB1211 | TargetMol | |
| 1693170 | TAR-T63645 | ONO-9780307 | TargetMol | |
| 1693169 | TAR-T63601 | PAD2-IN-1 hydrochloride | TargetMol | |
| 1693168 | TAR-T63527 | RIDR-PI-103 | TargetMol | |
| 1693167 | TAR-T63403 | WT IDH1 Inhibitor 2 | TargetMol | |
| 1693166 | TAR-T63402 | (S,R)-WT IDH1 Inhibitor 2 | TargetMol | |
| 1693165 | TAR-T63240 | Lometrexol disodium | TargetMol | |
| 1693164 | TAR-T63089 | (R)-IL-17 modulator 4 | TargetMol | |
| 1693163 | TAR-T63074 | Ivaltinostat formic | TargetMol | |
| 1693162 | TAR-T63045 | (1S,3R)-GNE-502 | TargetMol | |
| 1693161 | TAR-T62879 | OncoFAP | TargetMol | |
| 1693160 | TAR-T62860 | YM-341619 | TargetMol | |
| 1693159 | TAR-T62721 | CPI-1612 | TargetMol | |
| 1693158 | TAR-T62695 | GFB-12811 | TargetMol | |
| 1693157 | TAR-T62694 | (S)-GFB-12811 | TargetMol | |
| 1693156 | TAR-T62687 | Drp1-IN-1 | TargetMol | |
| 1693155 | TAR-T62611 | Adenosine receptor antagonist 2 | TargetMol | |
| 1693154 | TAR-T62587 | TLR7 agonist 4 | TargetMol | |
| 1693153 | TAR-T62511 | AZ3391 | TargetMol | |
| 1693152 | TAR-T62299 | NBD-14270 | TargetMol | |
| 1693151 | TAR-T62053 | Lorpucitinib | TargetMol | |
| 1693150 | TAR-T62049 | CTX-712 | TargetMol | |
| 1693149 | TAR-T61903 | (R)-ONO-2952 | TargetMol | |
| 1693148 | TAR-T61770 | (R)-Irsenontrine | TargetMol | |
| 1693147 | TAR-T61599 | XT2 | TargetMol | |
| 1693146 | TAR-T61527 | GSK2646264 | TargetMol | |
| 1693145 | TAR-T61475 | Ropivacaine mesylate | TargetMol | |
| 1693144 | TAR-T61213 | PF-03654764 | TargetMol | |
| 1693143 | TAR-T6116L | Bleomycin hydrochloride | TargetMol | |
| 1693141 | TAR-T60886 | (R)-RP-6306 | TargetMol | |
| 1693140 | TAR-T60853 | (Z)-Lanoconazole | TargetMol | |
| 1693139 | TAR-T60401 | Tezacitabine | TargetMol | |
| 1693138 | TAR-T60257 | SIRT-IN-3 | TargetMol | |
| 1693137 | TAR-T60235 | (Rac)-Lanicemine | TargetMol | |
| 1693136 | TAR-T4667 | EOS-62062 | TargetMol | |
| 1693135 | TAR-T4413 | Poseltinib | TargetMol | |
| 1693134 | TAR-T41297 | Lometrexol hydrate | TargetMol | |
| 1693133 | TAR-T41240 | Verrucarin A | TargetMol | |
| 1693132 | TAR-T39297 | Bis-sulfone-PEG4-DBCO | TargetMol | |
| 1693131 | TAR-T3086 | Mesoridazine Besylate | TargetMol | |
| 1693128 | TAR-T2712 | Nifekalant hydrochloride | TargetMol | |
| 1693127 | TAR-T22239 | AMI-1, free acid | TargetMol | |
| 1693126 | TAR-T22232 | Alfuzosin | TargetMol | |
| 1693125 | TAR-T21492 | Medetomidine | TargetMol | |
| 1693124 | TAR-T19961 | Trixylyl phosphate | TargetMol | |
| 1693123 | TAR-T1649L | Tenofovir hydrate | TargetMol | |
| 1693121 | TAR-T15839 | m-PEG12-amine | TargetMol | |
| 1693120 | TAR-T15035 | Cystamine | TargetMol | |
| 1693119 | TAR-T14363 | AZ-23 | TargetMol | |
| 1693117 | TAR-T13215 | N-(3-Chloro-4-morpholinophenyl)-N'-hydroxyformimidamide | TargetMol | |
| 1693116 | TAR-T13038 | Sultamicillin | TargetMol | |
| 1693114 | TAR-T11768 | KRAS G12C inhibitor 14 | TargetMol | |
| 1693113 | TAR-T10469 | BAY-298 | TargetMol | |
| 1693112 | TAR-TX0001 | BMS-337197 | TargetMol | |
| 1693111 | TAR-TNU1676 | 5-(2-Hydroxyethyl)cytidine | TargetMol | |
| 1693110 | TAR-TNU1675 | 5?-Homouridine | TargetMol | |
| 1693109 | TAR-TNU1674 | 5?-Homoadenosine | TargetMol | |
| 1693108 | TAR-TNU1673 | 9-(2,3-Di-O-acetyl-6-O-benzoyl-5-deoxy-D-ribo-exofuranoyl)-6-chloropurine | TargetMol | |
| 1693107 | TAR-TNU1672 | 5'-homocytidine | TargetMol | |
| 1693106 | TAR-TNU1671 | 1,2,3-Tri-O-acetyl-6-O-benzoyl-5-deoxy-D-ribo-hexofruanose | TargetMol | |
| 1693105 | TAR-TNU1670 | 3?-Azido-3?-deoxyinosine | TargetMol | |
| 1693104 | TAR-TNU1669 | N1-Methyl pseudouridine 5'-mono phosphate triethyl ammonium salt | TargetMol | |
| 1693103 | TAR-TNU1668 | N-Fmoc-aminohexyl P-methyl phosphonamidite | TargetMol | |
| 1693102 | TAR-TNU1667 | 3,5-O-[1,1,3,3-tetrakis(1-methylethyl)-1,3-disiloxanediyl] cytidine | TargetMol | |
| 1693101 | TAR-TNU1666 | N4-Benzoyl-5?-O-(4,4?-dimethoxytrityl)-3?-deoxy-3?-fluoro-beta-D-xylofuranosyl cytidine-2?-CED-phosphoramidite | TargetMol | |
| 1693100 | TAR-TNU1665 | 6-S-(2-Cyanoethyl)-2?-deoxy-5?-O-DMTr--6-thioguanosine 3?-CED phosphoramidite | TargetMol | |
| 1693099 | TAR-TNU1664 | 2?-O-Phthalimidopropyl uridine | TargetMol | |
| 1693098 | TAR-TNU1663 | N4-Benzoyl-5?-O-DMTr-2?-O-(N3-trifluoroacetyl) aminopropyl cytidine 3?-CED phosphoramidite | TargetMol | |
| 1693097 | TAR-TNU1662 | N4-Benzoyl-5?-O-DMTr-2?-O-(N3-trifluoroacetyl) aminopropyl cytidine | TargetMol | |
| 1693096 | TAR-TNU1661 | 5?-O-DMTr-3?-O-phthalimidopropyl cytidine | TargetMol | |
| 1693095 | TAR-TNU1660 | 2?-O-Phthalimidopropyl cytidine | TargetMol | |
| 1693094 | TAR-TNU1659 | N4-Benzoyl-N-DMTr- morpholino-5-methylcytosine-5?-O-phosphoramidite | TargetMol | |
| 1693093 | TAR-TNU1658 | N4-Benzoyl-7?-OH-N-DMTr morpholino 5-methyl cytosine | TargetMol | |
| 1693092 | TAR-TNU1657 | N2-iBu-5?-O-DMTr-2?-O-hexadecanyl guanosine 3?-CED phosphoramidite | TargetMol | |
| 1693091 | TAR-TNU1656 | N2-iBu-5?-O-DMTr-2?-O-hexadecanyl guanosine | TargetMol | |
| 1693090 | TAR-TNU1655 | 2?-O-Hexadecanyl guanosine | TargetMol | |
| 1693089 | TAR-TNU1654 | 3?-O-Hexadecanyl-2-aminoadenosine | TargetMol | |
| 1693088 | TAR-TNU1653 | 2?-O-Hexadecanyl-2-aminoadenosine | TargetMol | |
| 1693087 | TAR-TNU1652 | N6-Bz-5?-O-DMTr-2?-O-hexadecanyl adenosine 3?-CED phosphoramidite | TargetMol | |
| 1693086 | TAR-TNU1651 | N6-Bz-5?-O-DMTr-2?-O-hexadecanyl adenosine | TargetMol | |
| 1693085 | TAR-TNU1650 | 3?-O-Hexadecanyl adenosine | TargetMol | |
| 1693084 | TAR-TNU1649 | 2?-O-Hexadecanyl adenosine | TargetMol | |
| 1693083 | TAR-TNU1648 | 1-alpha-D-(3-Meth oxynaphthalen-2-yl)-2?-deoxy riboside; (1S)-1,4-Anhy dro-2-deoxy-1-C-(3-methoxy)-naphthalenyl)-D-erythro-pentitol | TargetMol | |
| 1693082 | TAR-TNU1647 | Adenosine 5?-monophosphate triethylammonium salt | TargetMol | |
| 1693081 | TAR-TNU1646 | DMTr-TNA-G(O6-CONPh2)(N2Ac)-amidite; 2-Acetylamino-1-{2?-O-[(2-Cyan oethoxy)(diisopropylamino)phosphino]-3?-O-[(4,4?-dimethoxytri phenyl)methyl]-a-L-threofuranosyl}-6-(N,N-diphenylcarbamoyloxy)-9H-purine | TargetMol | |
| 1693080 | TAR-TNU1645 | 2-Acetylamino-1-{3?-O-[(4,4?-dimethoxy triphenyl)methyl]-a-L-threo furanosyl}-6-(N,N-diphenylcarbamoyloxy)-9H-purine | TargetMol | |
| 1693079 | TAR-TNU1644 | N2,N2-Dimethylamino-6-deamino adenosine | TargetMol | |
| 1693078 | TAR-TNU1643 | Alpha-5-Methyluridine | TargetMol | |
| 1693077 | TAR-TNU1642 | 1,4-Anhydro-2-deoxy-3,5-bis-O-(t-butyl diphenylsilyl-D-erythro-pent-1-enitol | TargetMol | |
| 1693076 | TAR-TNU1641 | 1-b-D-(3-Methoxy naphthalen-2-yl)-2?-deoxyriboside; 1,4-Anhydro-2-deoxy-1-C-(3-methoxy)-naphthalenyl)-D-erythro-pentitol | TargetMol | |
| 1693075 | TAR-TNU1640 | 3?-O-Methyl inosine | TargetMol | |
| 1693074 | TAR-TNU1639 | alpha-Guanosine | TargetMol | |
| 1693073 | TAR-TNU1638 | Alpha-inosine | TargetMol | |
| 1693072 | TAR-TNU1637 | alpha-Adenosine | TargetMol | |
| 1693071 | TAR-TNU1636 | alpha-Cytidine, ara-C impurity 30 | TargetMol | |
| 1693070 | TAR-TNU1635 | alpha-Uridine | TargetMol | |
| 1693069 | TAR-TNU1634 | 3?-O-Acetyl-2?-deoxyuridine | TargetMol | |
| 1693068 | TAR-TNU1633 | DMTr-TNA-A(Bz)-amidite; 1-{2?-O-[(2-Cyanoethoxy)(diisopropyl amino)phosphino]-3?-O-[(4,4?-dimethoxytriphenyl)methyl]-a-L-threofuranosyl}-N6-benzoyladenine | TargetMol | |
| 1693067 | TAR-TNU1632 | DMTr-TNA-C(Bz)-amidite; 1-{2?-O-[(2-Cyanoethoxy)(diisopropyl amino)phosphino]-3?-O-[(4,4?-dimethoxytriphenyl)methyl]-a-L-threofuranosyl}-N4-benzoylcytosine | TargetMol | |
| 1693066 | TAR-TNU1631 | N6-Methyladenosine 5?-monophos phate triethylammonium salt (neutral 4229-50-9) | TargetMol | |
| 1693065 | TAR-TNU1630 | 2?-O-Methyl-N6-methyladenosine 5?-monophosphate triethylammonium salt (60091-05-6 neutral molecule) | TargetMol | |
| 1693064 | TAR-TNU1629 | 1-[3?-O-[(4,4?-dimethoxytriphenyl)methyl]-a-L-threofuranosyl]-N6-benzoyladenine | TargetMol | |
| 1693063 | TAR-TNU1628 | 1-[3?-O-[(4,4?-dimethoxytriphenyl)methyl]-a-L-threofuranosyl]-N4-benzoylcytosine | TargetMol | |
| 1693062 | TAR-TNU1627 | 1-(3?-O-[4,4?-dimethoxytrityl]-alpha-L-threofuranosyl)uridine | TargetMol | |
| 1693061 | TAR-TNU1626 | 1,2-Di-O-acetyl-3,5-di-O-benzyl-D-xylofuranose | TargetMol | |
| 1693060 | TAR-TNU1625 | Arabino inosine, 9-(β-D-Arabinofuranosyl)hypoxanthine | TargetMol | |
| 1693059 | TAR-TNU1624 | Beta-D-homoDNA-C(Bz)-phosphorami dite; N4-Benzoyl-1-[6-O-DMTr-2,3-dideoxy-4-(O-CED-phosphoramitidyl)-beta-D-erythro-hexopyranosyl)cytosine | TargetMol | |
| 1693058 | TAR-TNU1623 | N4-Benzoyl-1-(6-O-DMTr-2,3-dideoxy-beta-D-erythro-hexopyranosyl)cytosine | TargetMol | |
| 1693057 | TAR-TNU1622 | 1-(2,3-Dideoxy-2,3-didehydro-a-D-erythro-hexo pyranosyl) cytosine | TargetMol | |
| 1693056 | TAR-TNU1621 | 2?-Deoxy-2?-(N-trifluoroacetyl)amino-5?-O-DMTr-uridine 3?-CED phosphoramidite | TargetMol | |
| 1693055 | TAR-TNU1620 | 5?-O-DMTr-2?-OMe-5MeU-P-methyl phosphonamidite; 5?-O-DMTr-2?-O-methyl-5-methyluridine-3?-O-(P-methyl-N,N-diisopropylamino) phosphonamidite | TargetMol | |
| 1693054 | TAR-TNU1619 | 5?-O-DMTr-2?-O-methyl-5-methyluridine 3?-CED phosphoramidite | TargetMol | |
| 1693053 | TAR-TNU1618 | 5?-O-(4,4?-Dimethoxytrityl)-2?-O-methyl-N6-methyladenosine ? 3?-CED phosphoramidite | TargetMol | |
| 1693052 | TAR-TNU1617 | 2?-Deoxy-5?-O-(4,4?-dimethoxytrityl)-2?-fluoro ? inosine 3?-CED phosphoramidite | TargetMol | |
| 1693051 | TAR-TNU1616 | 9-(2,5-Di-O-benzoyl-2-C-beta-ethynyl-beta-D-ribofuranosyl)-6-chloropurine | TargetMol | |
| 1693050 | TAR-TNU1615 | 3?-O-Acetyl-N2-iso-Butyroyl-2?-deoxy-guanosine | TargetMol | |
| 1693049 | TAR-TNU1614 | 2?-Deoxy-N4-ethyl-5-methylcytidine | TargetMol | |
| 1693048 | TAR-TNU1613 | N4-Ethyl-2?-deoxycytidine | TargetMol | |
| 1693047 | TAR-TNU1612 | 8-Aza-alpha-D-2?-deoxyguanosine | TargetMol | |
| 1693046 | TAR-TNU1611 | 8-Aza-2?-deoxyguanosine | TargetMol | |
| 1693045 | TAR-TNU1610 | 5?-O-DMTr-2?-O-MOE ? inosine 3?-P-methyl phosphonamidite | TargetMol | |
| 1693044 | TAR-TNU1609 | 6-Mthoxy-9-beta-D-(2-O-methyl-ribofuranosyl)purine | TargetMol | |
| 1693043 | TAR-TNU1608 | 1-{2?-O-[(2-Cyanoethoxy)(diisopropyl ? amino)phosphino]-3?-O-[(4,4?-dimethoxytriphenyl)methyl]-?-L-threofuranosyl} ? uracil | TargetMol | |
| 1693042 | TAR-TNU1607 | 1-{2?-O-[(2-Cyanoethoxy)(diisopropyl ? amino)phosphino]-3?-O-[(4,4?-dimethoxytriphenyl)methyl]-?-L-threofuranosyl} ? thymine | TargetMol | |
| 1693041 | TAR-TNU1606 | 3?-O-DMTr-thymidine ? 5?-CE phosphoramidite | TargetMol | |
| 1693040 | TAR-TNU1605 | N4-Bz-3?-O-DMTr-2?-deoxycytidine ? 5?-O-CE-phosphoramidite | TargetMol | |
| 1693039 | TAR-TNU1604 | 2?-O-(2-Cyanoethoxy) ? (diisopropylamino)phosphino-3?-O-(4,4?-dimethoxy triphenyl)methyl-N2-isobutyryl-(R)-9-(2,3-dihydroxypropyl)-guanine | TargetMol | |
| 1693038 | TAR-TNU1603 | N4-Benzoyl-3'-O-(4,4?-dimethoxy ? trityl)-2'-O-(2-methoxyethyl)-5-methylcytidine-5?-CED phosphoramidite | TargetMol | |
| 1693037 | TAR-TNU1602 | N4-Benzoyl-3'-O-(4,4?-dimethoxytrityl)-2'-O-(2-methoxyethyl)-5-methylcytidine | TargetMol | |
| 1693036 | TAR-TNU1601 | 7-Methoxy-2,2,4-trimethyl-1,2,3,4-tetrahydroquinoline | TargetMol | |
| 1693035 | TAR-TNU1600 | N-DMTr-N2-isobutyryl-morpholino-G-5?-O-phosphoramidite | TargetMol | |
| 1693034 | TAR-TNU1599 | N-DMTr-N6-benzoyl-morpholino-A-5?-O-phosphoramidite | TargetMol | |
| 1693033 | TAR-TNU1598 | N-DMTr-N4-benzoyl-morpholino-cytosine-5?-O-phosphoramidite | TargetMol | |
| 1693032 | TAR-TNU1597 | N-DMTr-morpholino-T-5?-O-phosphoramidite | TargetMol | |
| 1693031 | TAR-TNU1596 | N-DMTr-morpholino-U-5?-O-phosphoramidite | TargetMol | |
| 1693030 | TAR-TNU1595 | 2-Amino-6-chloro-9-(3?-O-methyl-beta-D-ribofuranosyl)-9H-purine | TargetMol | |
| 1693029 | TAR-TNU1594 | 2-Amino-6-chloro-9-(2-O-acetyl-5-O-benzoyl-3-O-methyl-β-D-ribofuranosyl)-9H-purine | TargetMol | |
| 1693028 | TAR-TNU1593 | 5-Aza-3?-beta-methylcytidine | TargetMol | |
| 1693027 | TAR-TNU1592 | 5-Aza-3?-deoxycytidine | TargetMol | |
| 1693026 | TAR-TNU1591 | 5-Aza-9-(b-D-xylofuranosyl) cytosine; 5-Aza-xylo-cytidine | TargetMol | |
| 1693025 | TAR-TNU1590 | 5-Aza-2?,3?,5?-tri-O-benzoylcytidine; azacytidine impuirty 29 ??????39 | TargetMol | |
| 1693024 | TAR-TNU1589 | N2-Isobutyryl-7?-OH-N-DMTr-morpholino ? guanine | TargetMol | |
| 1693023 | TAR-TNU1588 | N6-Benzoyl-7?-OH-N-DMTr morpholino adenine | TargetMol | |
| 1693022 | TAR-TNU1587 | N4-Benzoyl-7?-OH-N-DMTr morpholino cytosine | TargetMol | |
| 1693021 | TAR-TNU1586 | 7?-OH-N-DMTr morpholino uracil | TargetMol | |
| 1693020 | TAR-TNU1585 | 7?-OH-N-DMTr morpholino-5-methyluracil | TargetMol | |
| 1693019 | TAR-TNU1584 | 8-Chloro-2?-deoxy-2?-fluoroadenosine | TargetMol | |
| 1693018 | TAR-TNU1583 | 2-Chloro-N6,N6-dimethyl-2?-deoxyadenosine | TargetMol | |
| 1693017 | TAR-TNU1582 | 2-Chloro-N6-methyl-2?-deoxyadenosine | TargetMol | |
| 1693016 | TAR-TNU1581 | 2-Chloro-6-methoxy ? purine-9-beta-D-(2?-deoxy)riboside | TargetMol | |
| 1693015 | TAR-TNU1580 | 2-Chloro-2?-deoxy ? inosine | TargetMol | |
| 1693014 | TAR-TNU1579 | 5-O-t-Butyldiphenyl ? silyl-2,3-O-isopropylidene-D-ribono-1,4-lactone | TargetMol | |
| 1693013 | TAR-TNU1578 | 3?-O-(4-Methoxybenzyl)-2?-O,4?-C-methylene uridine | TargetMol | |
| 1693012 | TAR-TNU1577 | 5?-O-Benzoyl-2?-O,4?-C-methyleneuridine | TargetMol | |
| 1693011 | TAR-TNU1576 | 2?,3?-Bis-O-(t-butyldimethylsilyl)-N1-methylpseudouridine | TargetMol | |
| 1693010 | TAR-TNU1575 | 1,4-Anhydro-2,3-O-isopropylidene-5-O-t-butyldiphenylsilyl-4-thio-D-ribitol | TargetMol | |
| 1693009 | TAR-TNU1574 | DMTr-MOE-Inosine-3-CED-phosphoramidite | TargetMol | |
| 1693008 | TAR-TNU1573 | 5?-O-(4,4?-Dimethoxy ? trityl)-2?-O-(2-methoxyethyl) inosine | TargetMol | |
| 1693007 | TAR-TNU1572 | 2?,3?-Di-O-acetyluridine | TargetMol | |
| 1693006 | TAR-TNU1571 | 3-Carbosypropyl ? 2,3,4,6-tetra-O-acetyl-beta-D glucopyranoside | TargetMol | |
| 1693005 | TAR-TNU1570 | N4-Benzoyl-5?-O-(4,4?-dimethoxy trityl)-2?-O,4?-C-methylene-cytidine 3?-O-[(2-cyanoethyl) ? (N,N-diisopropyl)]-phosphorramidite | TargetMol | |
| 1693004 | TAR-TNU1569 | 3?-Deoxy-5-trifluoromethyluridine | TargetMol | |
| 1693003 | TAR-TNU1568 | 2-Deoxyuridine | TargetMol | |
| 1693002 | TAR-TNU1567 | 2-Thiothymidine | TargetMol | |
| 1693001 | TAR-TNU1566 | DMTr-dH2U-amidite | TargetMol | |
| 1693000 | TAR-TNU1565 | 2-Deoxy-2?-deoxy-5?-(4,4?-dimethoxytrityl)uridine | TargetMol | |
| 1692999 | TAR-TNU1564 | 2-Deoxy-2?-deoxyuridine | TargetMol | |
| 1692998 | TAR-TNU1563 | 2?-Deoxy-2-thiouridine | TargetMol | |
| 1692997 | TAR-TNU1562 | 5?-DMTr-3?dA(Bz)-methyl ? phosphonamidite | TargetMol | |
| 1692996 | TAR-TNU1561 | 5?-O-(4,4-Dimethoxytrityl)-2?-O-methyl ? inosine-3?-CED phosphoramidite | TargetMol | |
| 1692995 | TAR-TNU1560 | 5?-O-(4,4-Dimethoxytrityl)-2?-O-methyl ? inosine | TargetMol | |
| 1692994 | TAR-TNU1559 | 3?-O-Acetylthymidine | TargetMol | |
| 1692993 | TAR-TNU1558 | 2?-Deoxy-2?-fluoro-ara-uridine | TargetMol | |
| 1692992 | TAR-TNU1557 | 2?-Deoxy-2?-fluoro-N1-methyluridine | TargetMol | |
| 1692991 | TAR-TNU1556 | N1-Methyl ara-uridine | TargetMol | |
| 1692990 | TAR-TNU1555 | 3?-Deoxy-N6-ethyladenosine | TargetMol | |
| 1692989 | TAR-TNU1554 | 3?-Deoxy-N1-Methyl ? inosine | TargetMol | |
| 1692988 | TAR-TNU1553 | 3?-Deoxy-3?-fluoro-N1-methyluridine | TargetMol | |
| 1692987 | TAR-TNU1552 | N3,5-Dimethyl-2?-O-(2-methoxyethyl) ? uridine | TargetMol | |
| 1692986 | TAR-TNU1551 | (R)-GNA-A(Bz) ? phosphoramidite | TargetMol | |
| 1692985 | TAR-TNU1550 | (R)-DMT-glycidol-A(Bz) | TargetMol | |
| 1692984 | TAR-TNU1549 | (R)-GNA-T ? phosphoramidite | TargetMol | |
| 1692983 | TAR-TNU1548 | (R)-DMT-glycidol-thymine | TargetMol | |
| 1692982 | TAR-TNU1547 | (R)-GNA-U phosphoramidite | TargetMol | |
| 1692981 | TAR-TNU1546 | (S)-GNA-A(Bz)-phosphoramidite | TargetMol | |
| 1692980 | TAR-TNU1545 | (S)-DMT-glycidol-A(Bz) | TargetMol | |
| 1692979 | TAR-TNU1544 | (S)-GNA-U-phosphoramidite | TargetMol | |
| 1692978 | TAR-TNU1543 | (S)-DMT-glycidol-uracil | TargetMol | |
| 1692977 | TAR-TNU1542 | 2?,3?-Isopropylidene-5-hydroxyuridine | TargetMol | |
| 1692976 | TAR-TNU1541 | 2?-Deoxy-2?-fluoro-N6-methyladensoine | TargetMol | |
| 1692975 | TAR-TNU1540 | 2?-Deoxy-2?-fluoroinosine | TargetMol | |
| 1692974 | TAR-TNU1539 | 2-Amino-2?-deoxy-N6-ethyl-adenosine | TargetMol | |
| 1692973 | TAR-TNU1538 | 2-Amino-2?-deoxy-N6,N6-dimethyl-2?-adenosine | TargetMol | |
| 1692972 | TAR-TNU1537 | O6-Methyldeoxy ? guanosine | TargetMol | |
| 1692971 | TAR-TNU1536 | 5?-O-DMTr-N6-ethyl-2?-deoxyadenosine 3?-CED phosphoramidite | TargetMol | |
| 1692970 | TAR-TNU1535 | 5?-O-DMTr-N6-ethyl-2?-deoxyadenosine | TargetMol | |
| 1692969 | TAR-TNU1534 | N6-Ethyl-2?-deoxyadenosine | TargetMol | |
| 1692968 | TAR-TNU1533 | Rev ? 2?-O-MOE-A(Bz)-5?-amidite | TargetMol | |
| 1692967 | TAR-TNU1532 | N6-Benzoyl-3?-O-(4,4?-dimethoxytrityl)-2?-O- ? (2-methoxyethyl)adenosine | TargetMol | |
| 1692966 | TAR-TNU1531 | Rev 2?-O-MOE-C(Bz)-5?-amidite; N4-Benzoyl-3'-O-(4,4?-dimethoxy trityl)-2'-O-(2-methoxyethyl)cytidine-5?-CED phosphoramidite | TargetMol | |
| 1692965 | TAR-TNU1530 | Rev 2?-O-MOE-G(iBu)-5?-amidite | TargetMol | |
| 1692964 | TAR-TNU1529 | 3?-O-(4,4-Dimethoxytrityl)-N2-isobutyryl-2?-O- ? (2-methoxyethyl) guanosine | TargetMol | |
| 1692963 | TAR-TNU1528 | MOE-5MeU-5?-amidite | TargetMol | |
| 1692962 | TAR-TNU1527 | 3'-O-(4,4?-Dimethoxytrityl)-2'-O-(2-methoxyethyl)-5-methyluridine | TargetMol | |
| 1692961 | TAR-TNU1526 | N2-iso-Butyryl-8-azaguanosine | TargetMol | |
| 1692960 | TAR-TNU1525 | 2-(p-Cyano ? phenylmethylidene hydrazino) adenosine | TargetMol | |
| 1692959 | TAR-TNU1524 | 2-(3-Methyl-n-butylidenehydrazino) adenosine | TargetMol | |
| 1692958 | TAR-TNU1523 | 8-Methyl-2?-deoxyguanosine | TargetMol | |
| 1692957 | TAR-TNU1522 | 8-Methylguanosine | TargetMol | |
| 1692956 | TAR-TNU1521 | 8-Methyl-2?-deoxyadenosine | TargetMol | |
| 1692955 | TAR-TNU1520 | 5?-O-DMTr-5-MedC(Ac)-methyl ? phosphonamidite | TargetMol | |
| 1692954 | TAR-TNU1519 | N4-Acetyl-5?-O-(4,4?-dimethoxytrityl)-5-methyl-2?-deoxy ? cytidine | TargetMol | |
| 1692953 | TAR-TNU1518 | 5?-O-Triphenylmethyl-2?-deoxyuridine | TargetMol | |
| 1692952 | TAR-TNU1517 | 5?-O-DMTr-dU-methyl ? phosphonamidite | TargetMol | |
| 1692951 | TAR-TNU1516 | 2-Amino-2?,3?-bis-O-(2-methoxyethyl) ? adenosine | TargetMol | |
| 1692950 | TAR-TNU1515 | O-2,3?-Anhydro-5-methylcytidine ? hydrochloride | TargetMol | |
| 1692949 | TAR-TNU1514 | 5?-O-DMTr-3?-deoxyuridine ? 2?-CED phosphoramidite | TargetMol | |
| 1692948 | TAR-TNU1513 | 5?-O-DMTr-3?-deoxyuridine | TargetMol | |
| 1692947 | TAR-TNU1512 | 2?-Deoxy-2?-fluoro-3?,5?-bis-O-TBDMS-uridine | TargetMol | |
| 1692946 | TAR-TNU1511 | N2-iBu-2?,3?-bis-O-TBDMS ? guanosine | TargetMol | |
| 1692945 | TAR-TNU1510 | 5?-O-TBDPS-5-methyl-2,2?-anhydrouridine | TargetMol | |
| 1692944 | TAR-TNU1509 | 5?-O-TBDPS-2,2?-anhydrouridine | TargetMol | |
| 1692943 | TAR-TNU1508 | DMTr-FNA-C(Bz)phosphoramidite | TargetMol | |
| 1692942 | TAR-TNU1506 | 1-[[2-Hydroxy-1-(hydroxy ? methyl)ethoxy]methyl]cytosine | TargetMol | |
| 1692941 | TAR-TNU1505 | 2?-O-Acetyl-N4-benzoyl-5?-O-(4,4?-dimethoxytrityl) ? arabinocytidine 3?-O-phosphoramidite | TargetMol | |
| 1692940 | TAR-TNU1504 | N4-Benzo yl-5?-O-(4,4?-dimethoxytrityl)-aracytidine | TargetMol | |
| 1692939 | TAR-TNU1503 | 2?-Deoxy-2?-fluoroarabino-O6-methyl ? inosine | TargetMol | |
| 1692938 | TAR-TNU1502 | 2?-Deoxy-2?-fluoroarabino ? inosine | TargetMol | |
| 1692937 | TAR-TNU1501 | 4-Deoxy-3?-deoxy-3?-fluoro uridine | TargetMol | |
| 1692936 | TAR-TNU1500 | 2?-beta-C-Ethynyl-5-methyluridine | TargetMol | |
| 1692935 | TAR-TNU1499 | 3?-Deoxy-O6-methyl inosine | TargetMol | |
| 1692934 | TAR-TNU1498 | 3?-Deoxy inosine | TargetMol | |
| 1692933 | TAR-TNU1497 | 3?-Deoxy-5-methycytidine | TargetMol | |
| 1692932 | TAR-TNU1496 | 3?-beta-C-Ethynyl-5-deoxyuridine | TargetMol | |
| 1692931 | TAR-TNU1495 | 3?-beta-C-Ethynyl-5-methoxyuridine | TargetMol | |
| 1692930 | TAR-TNU1494 | 3?-beta-C-Ethynyl-5-fluorouridine | TargetMol | |
| 1692929 | TAR-TNU1493 | 3?-beta-C-Methyl-N6-(p-methoxybenzyl)adenosine | TargetMol | |
| 1692928 | TAR-TNU1492 | 3?-beta-C-Methyl-3-deazauridine | TargetMol | |
| 1692927 | TAR-TNU1491 | 3?-beta-C-Methyl-5-methoxyuridine | TargetMol | |
| 1692926 | TAR-TNU1490 | 3?-beta-C-Methyl-5-trifluoromethyluridine | TargetMol | |
| 1692925 | TAR-TNU1489 | 5-Fluoro-3?-beta-C-methyluridine | TargetMol | |
| 1692924 | TAR-TNU1488 | 3?-Deoxy-3?-fluoro-xylo-N6-(p-methoxybenzyl)adenosine | TargetMol | |
| 1692923 | TAR-TNU1487 | 3?-Deoxy-3?-fluoro-xylo-5-trifluoromethyluridine | TargetMol | |
| 1692922 | TAR-TNU1486 | 3?-Deoxy-3?-fluoro-xylo-5-methoxyuridine | TargetMol | |
| 1692921 | TAR-TNU1485 | 1-(b-D-Xylofuranosyl)-N6-(p-methoxybenzyl) ? adenine | TargetMol | |
| 1692920 | TAR-TNU1484 | 3-Deaza-xylouridine | TargetMol | |
| 1692919 | TAR-TNU1483 | 1-(b-D-Xylofuranosyl)-5-trifluoromethyluracil | TargetMol | |
| 1692918 | TAR-TNU1482 | 1-(b-D-Xylofuranosyl)-5-methoxyuracil | TargetMol | |
| 1692917 | TAR-TNU1481 | 1-(b-D-Xylofuranosyl)-5-fluorouracil | TargetMol | |
| 1692916 | TAR-TNU1480 | 5?-O-DMTr-2?,2?-difluoro-dC(Bz)-methyl ? phosphonamidite | TargetMol | |
| 1692915 | TAR-TNU1479 | (2?,3?,5?-Tri-O-acetyl)uridine ? 5-carboxylic acid | TargetMol | |
| 1692914 | TAR-TNU1478 | 5-Carboxy-3,4-dihydro-2,4-dioxo-1(2H)-pyrimidine ? acetic acid | TargetMol | |
| 1692913 | TAR-TNU1477 | 5-Carboxy-3,4-dihydro-2,4-dioxo-1(2H)-pyrimidine ? acetic acid benzyl ester | TargetMol | |
| 1692912 | TAR-TNU1476 | NULL | TargetMol | |
| 1692911 | TAR-TNU1475 | 5?-O-DMTr-2?-FU-methyl ? phosphonamidite | TargetMol | |
| 1692910 | TAR-TNU1474 | (1,2-Dihydro-2-oxo-1,8-naphthyridin-3-yl)acetic ? acid | TargetMol | |
| 1692909 | TAR-TNU1473 | (1,2-Dihydro-2-oxo-1,8-naphthyridin-3-yl)acetic ? acid ethyl ester | TargetMol | |
| 1692908 | TAR-TNU1471 | N-Trityl-N2-isobutyryl-morpholino-G-5?-O-phosphoramidite | TargetMol | |
| 1692907 | TAR-TNU1470 | N-Trityl-N6-benzoyl-morpholino-A-5?-O-phosphoramidite | TargetMol | |
| 1692906 | TAR-TNU1469 | N-Trityl-N4-benzoyl-morpholino-C-5?-O-phosphoramidite | TargetMol | |
| 1692905 | TAR-TNU1468 | N-Trityl-morpholino-T-5?-O-phosphoramidite | TargetMol | |
| 1692904 | TAR-TNU1467 | N-Trityl-morpholino-U-5?-O-phosphoramidite | TargetMol | |
| 1692903 | TAR-TNU1466 | 5?-DMTr-dA(Bz)-Methyl ? phosphonamidite | TargetMol | |
| 1692902 | TAR-TNU1465 | 5?-DMTr-dC ? (Ac)-methylphosphonamidite | TargetMol | |
| 1692901 | TAR-TNU1464 | N4-Acetyl-5?-O-(4,4?-dimethoxytrityl)-2?-deoxycytidine | TargetMol | |
| 1692900 | TAR-TNU1463 | N4-Acetyl-2?-deoxycytidine | TargetMol | |
| 1692899 | TAR-TNU1462 | 5?-DMTr-T-Methyl ? phosphonamidite | TargetMol | |
| 1692898 | TAR-TNU1461 | N4-Benzoyl-7?-OH-N-trityl morpholino 5-methyl cytosine | TargetMol | |
| 1692897 | TAR-TNU1460 | Tr-morpholino-U; ? 7?-OH-N-trityl morpholino uracil | TargetMol | |
| 1692896 | TAR-TNU1459 | 5?-DMTr-dG(iBu) ? -Methyl phosphonamidite | TargetMol | |
| 1692895 | TAR-TNU1458 | 1-O-(4,4'-Dimethoxytrityl)-3-O-succinyl-l,3-propanediol | TargetMol | |
| 1692894 | TAR-TNU1457 | N1-Carboxymethyl-6-[2-(N,N?-bis-Cbz-guanidino) ? ethoxy]-phenoxazine | TargetMol | |
| 1692893 | TAR-TNU1456 | N1-(tert-Butoxycarbonylmethyl)-6-[2-(N-Cbz-amino)ethoxy)]-phenoxazine | TargetMol | |
| 1692892 | TAR-TNU1455 | N,N?-bis-Cbz-N??-(2-hydroxyethyl)-guanidine | TargetMol | |
| 1692891 | TAR-TNU1454 | 2-Amino-1,3-benzenediol; ? 2-Aminoresorcinol | TargetMol | |
| 1692890 | TAR-TNU1453 | 5-Bromo-N1-t-butoxycarbonylmethyl-uracil | TargetMol | |
| 1692889 | TAR-TNU1451 | 6-Deoxo-8-oxo-3?-deoxy-guanosine | TargetMol | |
| 1692888 | TAR-TNU1450 | N2-iso-Butyroyl-7?-O-(4,4?-dimethoxytrityloxy)morpholinoguanine | TargetMol | |
| 1692887 | TAR-TNU1449 | N6-Benzoyl-7?-O-(4,4?-dimethoxytrityloxy)morpholino adenine | TargetMol | |
| 1692886 | TAR-TNU1448 | novelN4-Benzoyl-7?-O-(4,4?-dimethoxytrityl oxy)morpholinocytosine | TargetMol | |
| 1692885 | TAR-TNU1447 | 7?-O-(4,4?-Dimethoxytrityloxy) ? morpholino thymine | TargetMol | |
| 1692884 | TAR-TNU1446 | 7?-O-(4,4?-Dimethoxytrityloxy)morpholino ? uracil | TargetMol | |
| 1692883 | TAR-TNU1445 | 5?-(4,4?-Dimethoxytrityl)-5-methyluridine | TargetMol | |
| 1692882 | TAR-TNU1444 | (2R-cis)-5-[Tetrahydro-5-(hydroxymethyl)-4-oxo-2-furanyl]-2,4(1H,3H)-pyrimidinedione | TargetMol | |
| 1692881 | TAR-TNU1443 | 1,4-Anhydro-2-de oxy-3-O-(t-butyldiphenylsilyl-D-erythro-pent-1-enitol | TargetMol | |
| 1692880 | TAR-TNU1442 | 2?-Deoxy-2?-fluoro-4?-thio-a-D-arabinouridine | TargetMol | |
| 1692879 | TAR-TNU1441 | 2?-Deoxy-2?-fluoro-5-methyl-4?-thio-a-D-arabinouridine | TargetMol | |
| 1692878 | TAR-TNU1440 | (S)-GNA-G(iBu) phosphoramidite | TargetMol | |
| 1692877 | TAR-TNU1439 | (S)-9-[3-(4,4?-Dime ? thoxytrityloxy)-2-hydroxypropyl]-N2-isobutyrylguanine | TargetMol | |
| 1692876 | TAR-TNU1438 | N2-Isobutyryl-(S)-9-(2,3-dihydroxypropyl)-guanine | TargetMol | |
| 1692875 | TAR-TNU1437 | (S)-9-(2,3-Dihydroxypropyl)-guanine | TargetMol | |
| 1692874 | TAR-TNU1436 | (S)-9-(2,3-Dihydroxypropyl)-2-amino-6-chloropurine | TargetMol | |
| 1692873 | TAR-TNU1435 | (R)-GNA-C(Bz)-phosphoramidite | TargetMol | |
| 1692872 | TAR-TNU1434 | (R)-DMT-glycidol-C(Bz) | TargetMol | |
| 1692871 | TAR-TNU1433 | (S)-GNA-C(Bz)-phosphoramidite | TargetMol | |
| 1692870 | TAR-TNU1432 | (S)-DMT-glycidol-C(Bz) | TargetMol | |
| 1692869 | TAR-TNU1430 | (S)-DMT-glycidol-T | TargetMol | |
| 1692868 | TAR-TNU1429 | 2R-[(4,4?-Dimethoxy trityloxy)methyl]oxirane | TargetMol | |
| 1692867 | TAR-TNU1428 | 2S-[(4,4?-Dimethoxy trityloxy)methyl]oxirane | TargetMol | |
| 1692866 | TAR-TNU1427 | 6-Amino-9-[2-deoxy-β-D-ribofuranosyl]-9H-purine | TargetMol | |
| 1692865 | TAR-TNU1426 | 6-Chloro-9-[3,5-di-O-(p-toluoyl)-2-deoxy-β-D- ribofuranosyl]-9H-purine | TargetMol | |
| 1692864 | TAR-TNU1425 | 2?-Bromo-2?-deoxy-5-fluorouridine | TargetMol | |
| 1692863 | TAR-TNU1424 | 3?-Deoxy-5?-O-(4,4?-dimethoxytrityl)-3?-fluorouridine-2?-CED-phosphoramidite | TargetMol | |
| 1692862 | TAR-TNU1423 | 3?-Deoxy-5?-O-(4,4?-dimethoxytrityl)-3?-fluorouridine | TargetMol | |
| 1692861 | TAR-TNU1422 | N2-iso-Butyroyl-5?-O-(4,4?-dimethoxytrityl)-2?-deoxy- fluoro-2?-arabinoguanosine-3?-CED-phosphoramidite | TargetMol | |
| 1692860 | TAR-TNU1421 | N2-iso-Butyroyl-2?-fluoro-2?-deoxyarabinoguanosine | TargetMol | |
| 1692859 | TAR-TNU1420 | 5?-O-(4,4?-Dimethoxytrityl)-2?-deoxy-2?-fluoro-5-methyl-b-D-arabinouridine-3?-CED-phosphoramidite | TargetMol | |
| 1692858 | TAR-TNU1419 | 5?-O-(4,4?-Dimethoxytrityl)-2?-deoxy-2?-fluoro-5-methyl-b-D-arabinouridine | TargetMol | |
| 1692857 | TAR-TNU1418 | 2?-dG ? (iBu)-2?-phosphoramidite | TargetMol | |
| 1692856 | TAR-TNU1417 | 3?-dC(Bz)-2?-phosphoramidite | TargetMol | |
| 1692855 | TAR-TNU1416 | N4-Benzoyl-5?-O-(4,4-dimethoxytrityl)-3?-deoxycytidine | TargetMol | |
| 1692854 | TAR-TNU1415 | N4-Benzoyl-3?-deoxycytidine | TargetMol | |
| 1692853 | TAR-TNU1414 | 5-Me-3?-dU-2?-phosphoramidite | TargetMol | |
| 1692852 | TAR-TNU1413 | 5?-O-(4,4-Dimethoxytrityl)-3?-deoxy-5-methyluridine | TargetMol | |
| 1692851 | TAR-TNU1412 | 2?-Chloro-N6-benzyl adenosine | TargetMol | |
| 1692850 | TAR-TNU1411 | 2,6-Bis(4-morpholinyl)-9-b-D-ribofuranosyl-9H-purine | TargetMol | |
| 1692849 | TAR-TNU1410 | 2?,3?,5?-Tri-O-benzoyl-4-thiouridine | TargetMol | |
| 1692848 | TAR-TNU1409 | 5-Aminomethyl-2?,3?-di-O-isopropylidene 2-thiouridine | TargetMol | |
| 1692847 | TAR-TNU1408 | 2?,3?,5?-Tri-O-acetyl-6-S-methyl-6-thio-guanosine | TargetMol | |
| 1692846 | TAR-TNU1407 | 3?-N-Acetyl-3?-amino-3?-deoxy-2?,5?-di-O-acetyluridine | TargetMol | |
| 1692845 | TAR-TNU1406 | 5?-Deoxy-5?-furfurylamino ? thymidine | TargetMol | |
| 1692844 | TAR-TNU1405 | 5?-Deoxy-5?-(4-morpholinyl)thymidine | TargetMol | |
| 1692843 | TAR-TNU1404 | 5?-Deoxy-5?-N-(2-chloroethyl)aminothymidine | TargetMol | |
| 1692842 | TAR-TNU1403 | 5?-Deoxy-5?-N,N-diethylaminothymidine | TargetMol | |
| 1692841 | TAR-TNU1402 | 5?-Deoxy-5?-N,N-dimethylaminothymidine | TargetMol | |
| 1692840 | TAR-TNU1401 | 5?-Deoxy-5?-N-methylaminothymidine | TargetMol | |
| 1692839 | TAR-TNU1400 | 2?,3?,5?-Tri-O-acetyl-5,N3-dimethyl uridine | TargetMol | |
| 1692838 | TAR-TNU1399 | 3?,5?-Di-O-acetyl-2?-deoxy-5,N3-dimethyl uridine | TargetMol | |
| 1692837 | TAR-TNU1398 | 3?,5?-Di-O-acetyl-2?-deoxy-N3-methyl uridine | TargetMol | |
| 1692836 | TAR-TNU1397 | 2?,3?,5?-Tri-O-acetyl-N3-methyluridine | TargetMol | |
| 1692835 | TAR-TNU1396 | 3?,5?-di-O-benzoyl thymidine | TargetMol | |
| 1692834 | TAR-TNU1395 | 3?,5?-di-O-acetylthymidine | TargetMol | |
| 1692833 | TAR-TNU1394 | 2?-O-Acetyl-5?-O-benzoyl-3?-O-(2-methoxyethyl)uridine | TargetMol | |
| 1692832 | TAR-TNU1393 | 3?-O-Methyl-5-methyluridine | TargetMol | |
| 1692831 | TAR-TNU1392 | 2?-O-Acetyl-5?-O-benzoyl-3?-O-methyl-5-methyluridine | TargetMol | |
| 1692830 | TAR-TNU1391 | 3?-O-MOE-G(iBu)-2?-phosphoramidite | TargetMol | |
| 1692829 | TAR-TNU1390 | N2-iso-Butyroyl-5?-O-(4,4?-dimethoxytrityl)-3?-O-(methoxyethyl)guanosine | TargetMol | |
| 1692828 | TAR-TNU1389 | N2-iso-Butyroyl-3?-O-(methoxyethyl)guanosine | TargetMol | |
| 1692827 | TAR-TNU1388 | 3?-O-MOE-5Me-C(Bz)-2?-phosphoramidite | TargetMol | |
| 1692826 | TAR-TNU1387 | 3?-O-MOE-5MeU-2?-phosphoramidite | TargetMol | |
| 1692825 | TAR-TNU1386 | 3?-O-MOE-U-2?-phosphoramidite | TargetMol | |
| 1692824 | TAR-TNU1385 | 5?-O-(4,4?-Dimethoxytrityl)-3?-O-(2-methoxyethyl) uridine | TargetMol | |
| 1692823 | TAR-TNU1384 | 3?-O-Me-G(iBu)-2?-phosphoramidite | TargetMol | |
| 1692822 | TAR-TNU1383 | N2-iso-Butyroyl-5?-O-(4,4?-dimethoxytrityl)-3?-O-Methyl ? guanosine | TargetMol | |
| 1692821 | TAR-TNU1382 | N2-iso-Butyroyl-3?-O-methylguanosine | TargetMol | |
| 1692820 | TAR-TNU1381 | 3?-O-Me-C(Bz)-2?-phosphoramidite | TargetMol | |
| 1692819 | TAR-TNU1380 | N4-Benzoyl-3?-O-methylcytidine | TargetMol | |
| 1692818 | TAR-TNU1379 | 3?-O-Me-U-2?-phosphoramidite | TargetMol | |
| 1692817 | TAR-TNU1378 | 5?-O-(4,4?-Dimethoxytrityl)-3?-O-methyluridine | TargetMol | |
| 1692816 | TAR-TNU1377 | 3?-F-3?-dG(iBu)-2?-phosphoramidite | TargetMol | |
| 1692815 | TAR-TNU1376 | N2-iso-Butyroyl-5?-O-(4,4?-dimethoxytrityl)-3?-deoxy-3?- fluoroguanosine | TargetMol | |
| 1692814 | TAR-TNU1375 | N2-iso-Butyroyl-3?-deoxy-3?-fluoro ? guanosine | TargetMol | |
| 1692813 | TAR-TNU1374 | 5-Azidomethyl-2?-beta-methyl-2?,3?,5?-tri-O-benzoyluridine | TargetMol | |
| 1692812 | TAR-TNU1373 | 5-Azidomethyl-2?,3?,5?-tri-O-benzoyl uridine | TargetMol | |
| 1692811 | TAR-TNU1372 | 2?-Deoxy-N6-(3-methoxybenzyl)adenosine | TargetMol | |
| 1692810 | TAR-TNU1371 | 2?-Deoxy-N6-(4-methoxybenzyl)adenosine | TargetMol | |
| 1692809 | TAR-TNU1370 | 2?-Deoxy-N6-cyclopentyladenosine | TargetMol | |
| 1692808 | TAR-TNU1369 | 2?-Deoxy-N6,N6-dimethyladenosine | TargetMol | |
| 1692807 | TAR-TNU1368 | 2-Amino-8-hydroxypurine-9-beta-D-(2?,5?-di-O-acetyl-3?-deoxy)riboside | TargetMol | |
| 1692806 | TAR-TNU1367 | 3?-Deoxy-2?,5?-di-O-acetyl-8-hydroxyguanosine | TargetMol | |
| 1692805 | TAR-TNU1366 | 4-Deoxy-xylo-uridine | TargetMol | |
| 1692804 | TAR-TNU1365 | 2?-Deoxy-5?-O-(4,4?-dimethoxytrityl)-5-methylcytidine | TargetMol | |
| 1692803 | TAR-TNU1364 | 2-Amino-3?,5?-di-O-acetyl-N6,N6-dimethyl-2?-O-methyl adenosine | TargetMol | |
| 1692802 | TAR-TNU1363 | 3-Deoxy-3-fluoro-1,2,5-tri-O-acetyl-D-xylofuranose | TargetMol | |
| 1692801 | TAR-TNU1362 | N4-Benzoyl-5?-O-(4,4?-dimethoxytrityl)-3?-O-(2- methoxyethyl)-5-methylcytidine | TargetMol | |
| 1692800 | TAR-TNU1361 | N4-Benzoyl-3?-O-(2-methoxyethyl)-5-methylcytidine | TargetMol | |
| 1692799 | TAR-TNU1360 | 3?-O-(2-Methoxyethyl)-5-methyluridine | TargetMol | |
| 1692798 | TAR-TNU1359 | 1?,2?-Di-O-acetayl-3?,5?-di-O-benzoyl-3?-beta-C-ethynyl-D-ribofuranose | TargetMol | |
| 1692797 | TAR-TNU1358 | N1-Methyl-2?-deoxyinosine | TargetMol | |
| 1692796 | TAR-TNU1357 | 1?,2?,3?,5?-Tetra-O-benzoyl-2?-beta-C-ethynyl-D- ribofuranose | TargetMol | |
| 1692795 | TAR-TNU1356 | 2?-Deoxy-N2-cyclopentyl guanosine | TargetMol | |
| 1692794 | TAR-TNU1355 | 2?-Deoxy-N2,N2-diethyl ? guanosine | TargetMol | |
| 1692793 | TAR-TNU1354 | 2?-Deoxy-N2-isopropyl guanosine | TargetMol | |
| 1692792 | TAR-TNU1353 | 2-Amino-7-propargyl-7,8-dihydro-8-oxo-9-(beta-D-2,5-di-O-acetyl-3-deoxy-3-fluoro-ribofuranosyl)purine | TargetMol | |
| 1692791 | TAR-TNU1352 | 2?,3?-Di-O-acetyl-8-benzyloxy-3?-deoxy-3?-fluoroguanosine | TargetMol | |
| 1692790 | TAR-TNU1351 | 2-Amino-7-propargyl-7,8-dihydro-8-oxo-9-(beta-D-3-deoxy-ribofuranosyl)purine | TargetMol | |
| 1692789 | TAR-TNU1350 | 2-Amino-7-propargyl-7,8-dihydro-8-oxo-9-(beta-D-2,5-di-O-acetyl-3-deoxy-ribofuranosyl)purine | TargetMol | |
| 1692788 | TAR-TNU1349 | 2?,3?-Di-O-acetyl-8-benzyloxy-3?-deoxy ? guanosine | TargetMol | |
| 1692787 | TAR-TNU1348 | 1-(2?-O-Acetyl-3?,5?-bis-O-benzoyl-b-D-xylofuranosyl)-6-azauracil | TargetMol | |
| 1692786 | TAR-TNU1347 | 4?-alpha-C-Allyl-2?,3?-bis(O-t-butyldimethylsilyl)uridine | TargetMol | |
| 1692785 | TAR-TNU1346 | 4?-alpha-C-Azido-2?,3?-bis(O-t-butyldimethylsilyl)uridine | TargetMol | |
| 1692784 | TAR-TNU1345 | 1-(alpha-L-Threofuranosyl)cytosine | TargetMol | |
| 1692783 | TAR-TNU1344 | 2-Chloro-N6-cyclopentyl 2?-deoxy- ? adenosine | TargetMol | |
| 1692782 | TAR-TNU1343 | Methyl ? 3?-O-benzyl xyloriboside | TargetMol | |
| 1692781 | TAR-TNU1342 | 5?-O-(4,4?-Dimethoxytrityl)-2?-O-(2-methoxyethyl) adenosine | TargetMol | |
| 1692780 | TAR-TNU1341 | N6-Benzoyl-2',3'-isopropylidene adenosine | TargetMol | |
| 1692779 | TAR-TNU1340 | Methyl ? 2-deoxy-3,5-di-O-benzoyl-2-fluoro-4-thio-beta-D-arabinopentofuranoside | TargetMol | |
| 1692778 | TAR-TNU1339 | Methyl 2-deoxy-3,5-di-O-benzoyl-2-fluoro-4-thio-D-arabinopentofuranoside | TargetMol | |
| 1692777 | TAR-TNU1338 | 3-Deoxy-3-fluoro-1,2:5,6-di-O-isopropylidene-a-D-gluco-pentofuranose | TargetMol | |
| 1692776 | TAR-TNU1337 | 1-(3?-O-[4,4?-Dimethoxytrityl]-alpha-L-threofuranosyl)-thymine | TargetMol | |
| 1692775 | TAR-TNU1336 | 1-(alpha-L-Threofuranosyl)thymine | TargetMol | |
| 1692774 | TAR-TNU1335 | 3?-O-(2-Methoxyethyl)uridine | TargetMol | |
| 1692773 | TAR-TNU1334 | N-[4-Isopropyl ? oxyphenyl]-N?-furfurylthiourea | TargetMol | |
| 1692772 | TAR-TNU1333 | 7,8-Dihydro-8-oxo-7-propargyl-3?-deoxy guanosine | TargetMol | |
| 1692771 | TAR-TNU1332 | 2-Amino-7-propargyl-7,8-dihydro-8-oxo-9-(beta-D-xylofuranosyl)purine | TargetMol | |
| 1692770 | TAR-TNU1331 | 2-Amino -7-propargyl-7,8-dihydro-8-oxo-9-(beta-D-2,3,5-tri-O-actyl-xylofuranosyl)purine | TargetMol | |
| 1692769 | TAR-TNU1330 | 2-(N,N-Dimethylaminomethylene ) amino-7-cyclopropylmethyl-7,9-dihydro-1H-purine-6,8-dione | TargetMol | |
| 1692768 | TAR-TNU1329 | N-[4-Isopropyloxyphe ? nyl]-N?-(1H-pyrrol-2-yl)methyl)thiourea | TargetMol | |
| 1692767 | TAR-TNU1328 | N2-Phenylacetyl-7?-OH-N-trityl-morpholino guanine | TargetMol | |
| 1692766 | TAR-TNU1327 | 7?-t-Butyldimethylsilyloxy-N-trityl-morpholino ? guanine | TargetMol | |
| 1692765 | TAR-TNU1326 | N-Trityl-morpholino ? guanine | TargetMol | |
| 1692764 | TAR-TNU1325 | 1-O-Acetyl-2-O-benzoyl-3-O-tert-butyldiphenylsilyl-L-threofuranose | TargetMol | |
| 1692763 | TAR-TNU1324 | 4?-Methylthymidine | TargetMol | |
| 1692762 | TAR-TNU1323 | 3?,5?-Bis(O-t-butyldimethylsilyl)-4?-C-hydroxymethyl thymidine | TargetMol | |
| 1692761 | TAR-TNU1322 | 3?-O-t-Bulyldimethylsilyl-4?-C-hydroxymethylthymidine | TargetMol | |
| 1692760 | TAR-TNU1321 | 5?-O-(4,4?-Dimethoxytrityl)-2?-deoxy-3-formylindole-ribofuranosyl-3?-[(2-cyano ? ethyl)-(N,N-diisopropyl)]-phosphoramidite | TargetMol | |
| 1692759 | TAR-TNU1320 | 5?-O-(4,4?-Dimethoxytrityl)-3-formylindole-2?-deoxyriboside | TargetMol | |
| 1692758 | TAR-TNU1319 | 3-Formylindole-2?-deoxyriboside | TargetMol | |
| 1692757 | TAR-TNU1318 | 1-(b-D-2-Deoxyribofuranosyl)-5-nitroindole | TargetMol | |
| 1692756 | TAR-TNU1317 | 1,2-Di-O-acetyl-5-O-benzoyl-3-O-(2-methoxyethyl)-D-ribofuranose | TargetMol | |
| 1692755 | TAR-TNU1316 | 1,2-Di-O-isopropylidene-3-O-(2-methoxyethyl)-alpha-D- ribofuranose | TargetMol | |
| 1692754 | TAR-TNU1315 | 2?-Deoxy-5-methoxyuridine | TargetMol | |
| 1692753 | TAR-TNU1314 | DMTr-LNA-G(iBu)-3?-CED-phosphoramidite | TargetMol | |
| 1692752 | TAR-TNU1313 | 1,2-Di-O-acetyl-5-O-benzoyl-3-O-(4-methoxybenzyl)-D-ribofuranose | TargetMol | |
| 1692751 | TAR-TNU1312 | 1,2-Di-O-isopropylidene-3-O-(4-methoxybenzyl)-a-D- ribofuranose | TargetMol | |
| 1692750 | TAR-TNU1310 | Compound 2389988-36-5 | TargetMol | |
| 1692749 | TAR-TNU1309 | 7-(Buten-2-yl)-7,8-dihydro-8-oxo-9-(beta-D-xylofuranosyl)guanine | TargetMol | |
| 1692748 | TAR-TNU1308 | Confident | TargetMol | |
| 1692747 | TAR-TNU1307 | 2-amino-9-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-(2,2,2-trifluoroethyl)-6,7,8,9-tetrahydro-1H-purine-6,8-dione | TargetMol | |
| 1692746 | TAR-TNU1306 | [(2R,3S,4R,5R)-3,4-diacetyloxy-5-[2-amino-7-(cyclopropylmethyl)-8-oxopurin-9-yl]oxolan-2-yl]methyl acetate | TargetMol | |
| 1692745 | TAR-TNU1305 | 2?-Fluoro-2-thio-2?-dU-3?-phosphoramidite | TargetMol | |
| 1692744 | TAR-TNU1304 | 2?-O-Me-2-thio-U-3?-phos phoramidite | TargetMol | |
| 1692743 | TAR-TNU1303 | 5?-O-(4,4?-Dimethoxytrityl)-2?-O-methyl-2-thiouridine | TargetMol | |
| 1692742 | TAR-TNU1302 | 3?-Azido-2?,3?-dideoxy-5-hydroxyuridine | TargetMol | |
| 1692741 | TAR-TNU1301 | 6-Chloro-7-deaza-9-(2?,3?,5?-tri-O-acetyl-b-D-ribofuranosyl)purine | TargetMol | |
| 1692740 | TAR-TNU1300 | 9-(5?-O-Benzoyl-N4-benzoyl-2-deoxy-beta-D-threo-pentofuranosyl)adenine | TargetMol | |
| 1692739 | TAR-TNU1299 | N4-Benzoyl-5?-O-(4,4?-dimethoxytrityl)-2?,2?-difluoro-2?-deoxycytidine ? 3?-O-[(2-cyanoethyl)(N,N-diisopropyl)]phosphoramidite | TargetMol | |
| 1692738 | TAR-TNU1298 | N4-Benzoyl-2?-deoxy-5?-O-(4,4?-dimethoxytrityl)-2?,2?- diflurocytidine | TargetMol | |
| 1692737 | TAR-TNU1297 | N6-Benzoyl-2?-deoxy-2?,2?-diflurocytidine | TargetMol | |
| 1692736 | TAR-TNU1296 | 6-(β-D-5-O-(4,4?-Dimethoxytrityl)-2-deoxyribofuranosyl)-3,4-dihydro-8H-pyrimido[4,5-c][1,2]oxazin-7-one | TargetMol | |
| 1692735 | TAR-TNU1295 | DMTr-LNA-A(Bz)-3-CED-phosphoramidite | TargetMol | |
| 1692734 | TAR-TNU1294 | 2-O-benzoyl-3-O-t-butyldiphenylsilyl-L-threonolactone | TargetMol | |
| 1692733 | TAR-TNU1293 | L-Threonolactone | TargetMol | |
| 1692732 | TAR-TNU1292 | 2,3,5-Tri-O-(p-toluoyl)-1-O-acetyl-4-thio-D-ribofuranose | TargetMol | |
| 1692731 | TAR-TNU1291 | 2-Amino-4-chloro-5-iodo-N2-pivaloyl-7-[2-deoxy-3,5-di-O- (4-methylbenzoyl)-b-D-ribofuanosyl]-7H-pyrrolo[2,3-d]pyrimidine | TargetMol | |
| 1692730 | TAR-TNU1290 | 2-Amino-4-chloro-N2-pivaloyl-7-[2-deoxy-3,5-di-O-(4- methylbenzoyl)-b-D-ribofuanosyl]-7H-pyrrolo[2,3-d]pyrimidine | TargetMol | |
| 1692729 | TAR-TNU1289 | 1-[(5E)-3-O-[(Bis-di-isopropyl ? amino)(2-cyanoethoxy) phosphino]-5,6-dideoxy-6-(diethoxyphosphinyl)-2-O-(2-methoxyethyl)-β-D-ribo-hex-5-enofuranosyl]-5-methyluracil | TargetMol | |
| 1692728 | TAR-TNU1288 | 1-[(5E)-3-O-[(Bis-diisopropyl amino)(2-cyano ethoxy)phosphino]-5,6-dideoxy-6-(diethoxy ? phosphinyl)-2-O-(2-methoxyethyl)-β-D-ribo-hex-5-enofuranosyl]uracil | TargetMol | |
| 1692727 | TAR-TNU1287 | 1-[(5E)-5,6-Dideoxy-6-(diethoxyphosphinyl)-2-O-(2-methoxy ethyl)-β-D-ribo-hex-5-enofuranosyl]-5-methyluracil | TargetMol | |
| 1692726 | TAR-TNU1286 | 1-[6-(Diethoxyphosphinyl)-2-O-(2-methoxyethyl)-β-D-ribo-hexofuranosyl]uracil | TargetMol | |
| 1692725 | TAR-TNU1285 | 1-[(5E)-5,6-Dideoxy-6-(diethoxyphosphinyl)-2-O-(2-methoxyethyl)-β-D-ribo-hex-5-enofuranosyl]uracil | TargetMol | |
| 1692724 | TAR-TNU1284 | 3?-O-(t-Butyldimethylsilyl)-2?-O-(2-methoxyethyl)-5-methyluridine | TargetMol | |
| 1692723 | TAR-TNU1283 | 3?-O-(t-Butyldimethylsilyl)-2?-O-(2-methoxyethyl) uridine | TargetMol | |
| 1692722 | TAR-TNU1282 | N-(4-Isopropyloxy phenyl)-N-(1H-pyrrol-2-ylmethyl)urea; flavoring agent, flavor modifier | TargetMol | |
| 1692721 | TAR-TNU1281 | 6-(β-D-2-Deoxyribofuranosyl)-3,4-dihydro-8H-pyrimido[4,5-c][1,2]oxazin-7-one | TargetMol | |
| 1692720 | TAR-TNU1280 | 5-(2-Hyroxyethyl)-2?-deoxyuridine | TargetMol | |
| 1692719 | TAR-TNU1279 | 5-(2-Hyroxyethyl)-2?,3?-di-O-toluoyl-2?-deoxyuridine | TargetMol | |
| 1692718 | TAR-TNU1278 | 9-(2,3,5-Tri-O-acetyl-beta-D-ribofuranosyl)-2,6-dichloropurine | TargetMol | |
| 1692717 | TAR-TNU1277 | 2?-O,4?-C-Methyleneadenosine 5?-monophosphate ? triethyl ammonium | TargetMol | |
| 1692716 | TAR-TNU1276 | 2?-Deoxy-2?-fluoroguanosine ? 5?-monophosphate triethyl ammonium | TargetMol | |
| 1692715 | TAR-TNU1275 | 2?-O-Methyladenosine ? 5?-monophosphate triethyl ammonium | TargetMol | |
| 1692714 | TAR-TNU1274 | 2?-Deoxy-2?-fluoroadenosine ? 5?-monophosphate triethyl ammonium | TargetMol | |
| 1692713 | TAR-TNU1273 | 4-Chloro-7-(2-beta-C-methyl-3,5-di-O-(p-toluoyl)-beta-D-ribofuranosyl)-7H-pyrrolo[2,3-d]pyrimidine | TargetMol | |
| 1692712 | TAR-TNU1272 | 3,5-Bis-O-(4-methylbenzoyl)-2-C-methyl-D-ribonic acid gama-lactone | TargetMol | |
| 1692711 | TAR-TNU1271 | 2-Methyl-2?-deoxyadenosine | TargetMol | |
| 1692710 | TAR-TNU1270 | N6-Isopentenyl-2?-deoxyadenosine | TargetMol | |
| 1692709 | TAR-TNU1269 | 3?-O-(t-Butyldiphenylsilyl)thymidine | TargetMol | |
| 1692708 | TAR-TNU1268 | Furan-2-carbohydrazide | TargetMol | |
| 1692707 | TAR-TNU1267 | 2?-Deoxy-N1-methylguanosine | TargetMol | |
| 1692706 | TAR-TNU1266 | N4-Benzoyl-5?-O-(4,4?-dimethoxytrityl)-2?-O,4?-C-methylene-5-methylcytidine 3?-O-[(2-cyanoethyl)(N,N-diisopropyl)]-phosphorramidite | TargetMol | |
| 1692705 | TAR-TNU1265 | N4-Banzoyl-5-methyl-2?-O,4?-C-methylenecytidine | TargetMol | |
| 1692704 | TAR-TNU1264 | DMTr-LNA-U-3-CED-phosphoramidite | TargetMol | |
| 1692703 | TAR-TNU1263 | N-1H-imidazo[4,5d ? ]pyridazin-7-yl benzamideN4-Benzoyl-2-aza-3?-deazaadenine | TargetMol | |
| 1692702 | TAR-TNU1262 | 1H-Imidazo[4,5-d]pyridazin-7-amine | TargetMol | |
| 1692701 | TAR-TNU1261 | 3?-O-MOE-A(Bz)-2?-CED-phosphoramidite | TargetMol | |
| 1692700 | TAR-TNU1260 | N6-Benzoyl-5?-O-(4,4?-dimethoxytrityl)-3?-O-(2-methoxyethyl)adenosine | TargetMol | |
| 1692699 | TAR-TNU1259 | 2?-Deoxy-2?-fluorouridine ? 5?-monophosphate triethyl ammonium | TargetMol | |
| 1692698 | TAR-TNU1258 | 2?,3?-Dideoxy ? tubercidin | TargetMol | |
| 1692697 | TAR-TNU1257 | 9-(2-Deoxy-beta-D-threo-pentofuranosyl)adenine | TargetMol | |
| 1692696 | TAR-TNU1256 | 5?-Azido-2?,5?-dideoxyadenosine | TargetMol | |
| 1692695 | TAR-TNU1255 | 5?-Azido-5?-deoxyadenosine | TargetMol | |
| 1692694 | TAR-TNU1254 | 5?-Deoxy-5?-iodoguanosine | TargetMol | |
| 1692693 | TAR-TNU1253 | 5?-Amino-5?-deoxy-2?-O-methyl-5-methyluridine | TargetMol | |
| 1692692 | TAR-TNU1252 | 5?-Amino-2?,5?-dideoxyuridine | TargetMol | |
| 1692691 | TAR-TNU1251 | 5?-Amino-5?-deoxythymidine | TargetMol | |
| 1692690 | TAR-TNU1250 | 5?-Azido-5?-deoxy-2?-O,4?-C-methyleneuridine | TargetMol | |
| 1692689 | TAR-TNU1249 | 5?-O-Benzoyl-3?-O-(4-methoxybenzoyl)-2?-O,4?-C-methyleneuridine | TargetMol | |
| 1692688 | TAR-TNU1248 | 2?,3?-Dideoxy-3?-fluoroadenosine | TargetMol | |
| 1692687 | TAR-TNU1247 | N6-benzoyl-3?-fluoro-2?,3?-dideoxyadenosine | TargetMol | |
| 1692686 | TAR-TNU1246 | 3?-F-3?-dA(Bz)-2?-phosphoramidite | TargetMol | |
| 1692685 | TAR-TNU1245 | N6-Benzoyl-3?-deoxy-5?-O-(4,4?-dimethoxytrityl)-3?-fluoroadenosine | TargetMol | |
| 1692684 | TAR-TNU1244 | N6-Benzoyl-3?-deoxy-3?-fluoroadenosine | TargetMol | |
| 1692683 | TAR-TNU1243 | 5-Amino-2?-deoxyuridine ? hydrochloride | TargetMol | |
| 1692682 | TAR-TNU1242 | 3-Methyl-2-buten-1-amine ? hydrochloride | TargetMol | |
| 1692681 | TAR-TNU1241 | 8-Azido-2?-deoxyadenosine | TargetMol | |
| 1692680 | TAR-TNU1240 | 2?-O-MOE-C(Bz)-3?-phosphoramidite | TargetMol | |
| 1692679 | TAR-TNU1239 | N4-Benzoyl-5?-O-(4,4?-dimethoxytrityl)-2?-O-(2-methoxyethyl)cytidine | TargetMol | |
| 1692678 | TAR-TNU1238 | N4-Benzoyl-2?-O-(2-methoxyethyl)cytidine | TargetMol | |
| 1692677 | TAR-TNU1237 | 5?-O-Benzoyl-2?,3?-di-O-acetyl-4?-C-fluoromethyluridine | TargetMol | |
| 1692676 | TAR-TNU1236 | 3,4-Dihydro-4-[[2-hydroxy-1-(hydroxymethyl)ethoxy] ? methyl]-3-oxo-2-pyrazinecarboxamide | TargetMol | |
| 1692675 | TAR-TNU1235 | N4-Benzoyl-5?-O-(4,4?-dimethoxytrityl)-5-methylcytidine | TargetMol | |
| 1692674 | TAR-TNU1234 | 2?-Deoxy-8-methylamino-adenosine | TargetMol | |
| 1692673 | TAR-TNU1233 | 8-Amino-2?-deoxyadenosine | TargetMol | |
| 1692672 | TAR-TNU1232 | 2?-Deoxy-8-methoxyadenosine | TargetMol | |
| 1692671 | TAR-TNU1231 | 2?-Deoxy-8-methylthio-guanosine | TargetMol | |
| 1692670 | TAR-TNU1230 | 2?-Deoxy-8-methylthio-adenosine | TargetMol | |
| 1692669 | TAR-TNU1229 | 3?-Azido-3?-deoxythymidine ? 5?-triphosphate triethyl ammonium salt | TargetMol | |
| 1692668 | TAR-TNU1228 | 1,2,3,5-Tetra-O-benzoyl-4-alpha-C-vinyl-D-ribofuranose | TargetMol | |
| 1692667 | TAR-TNU1227 | 5?-O-DMTr-N6-Fmoc-dA-phosphoramidite | TargetMol | |
| 1692666 | TAR-TNU1226 | 5?-O-DMTr-N4-Fmoc-5-Me-dC-phosphoramidite | TargetMol | |
| 1692665 | TAR-TNU1225 | 5?-O-(4,4?-Dimethoxytrityl)-2'-deoxy-N4-[(9H-fluoren-9-ylmethoxy) carbonyl]-5-methylcytidine | TargetMol | |
| 1692664 | TAR-TNU1224 | 1,2,3,5-Tetra-O-benzoyl-2-bea-C-methyl-D-ribofuranose | TargetMol | |
| 1692663 | TAR-TNU1223 | 2-b-C-Methyl-D-ribono-1,4-lactone | TargetMol | |
| 1692662 | TAR-TNU1222 | 3?-Azido-N6-benzoyl-3?-deoxyadenosine | TargetMol | |
| 1692661 | TAR-TNU1221 | N2-Isobutyryl-O6-cyanoethyl-7?-OH-N-trityl-morpholino guanine | TargetMol | |
| 1692660 | TAR-TNU1220 | N1-Methyl-2?-deoxyadenosine | TargetMol | |
| 1692659 | TAR-TNU1219 | 5-Amino-2-(2-furanyl)-7H-pyrazolo[4,3-e][1,2,4] ? triazolo[1,5-c] pyrimidine | TargetMol | |
| 1692658 | TAR-TNU1218 | 4-(2-Chloroethyl)benzoic ? acid ethyl ester | TargetMol | |
| 1692657 | TAR-TNU1217 | 2-[4-(2-Chloroethyl)phenoxy]acetic ? acid ethyl ester | TargetMol | |
| 1692656 | TAR-TNU1216 | 4-(2-Chloroethyl)phenol | TargetMol | |
| 1692655 | TAR-TNU1215 | 4-(3-Hydroxypropyl)benzoic acid | TargetMol | |
| 1692654 | TAR-TNU1214 | (3aR,5S,6S,6aR)-6-Benzy ?loxy-5-(benzyloxymethyl)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole | TargetMol | |
| 1692653 | TAR-TNU1213 | (3aR,5R,6S,6aR)-5-[(4R)-2,2-Dimethyl-1,3-dioxolan-4-yl]-5-(hydroxymethyl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]-dioxol-6-ol | TargetMol | |
| 1692652 | TAR-TNU1212 | N3-Cyanoethyl-5?-O-(4,4?-dimethoxytrityl)-2?-O-methyluridine | TargetMol | |
| 1692651 | TAR-TNU1211 | 2-Chloro-9-(beta-D-ribofuranosyl)purine | TargetMol | |
| 1692650 | TAR-TNU1210 | 2-Chloro-9-[(2,3,5-tri-O-acetyl-β-D-ribofuranosyl)]-9H-purine | TargetMol | |
| 1692649 | TAR-TNU1209 | 2?-Deoxy-5,N4,N4-trimethylcytidine | TargetMol | |
| 1692648 | TAR-TNU1208 | 2?-Deoxy-5,N4-dimethylcytidine | TargetMol | |
| 1692647 | TAR-TNU1207 | 5?-Deoxy-N4,N4-dimethyl-5-fluorocytidine | TargetMol | |
| 1692646 | TAR-TNU1206 | 2?-Deoxy-N4,N4-dimethylcytidine | TargetMol | |
| 1692645 | TAR-TNU1205 | 2?-Deoxy-N4-methylcytidine | TargetMol | |
| 1692644 | TAR-TNU1204 | 3?-Azido-2?,3?-dideoxyuridine 5?-phosphate ?diammonium salt | TargetMol | |
| 1692643 | TAR-TNU1203 | 2?-Deoxy-5-Fluorouridine 5?-phosphate triethyl ammonium salt | TargetMol | |
| 1692642 | TAR-TNU1202 | 3?,5?-TIPS-N-PAc-Guanosine | TargetMol | |
| 1692641 | TAR-TNU1201 | N2-Phenoxyacetylguanosine | TargetMol | |
| 1692640 | TAR-TNU1200 | 3?,5?-TIPS-N-Ac-Adenosine | TargetMol | |
| 1692639 | TAR-TNU1199 | 5?-O-(4,4?-Dimethoxytrityl)-2?-beta-C-methyladenosine | TargetMol | |
| 1692638 | TAR-TNU1198 | 3-O-(4-Methoxybenzyl)-4-C-hydroxymethyl-1,2-O-isopropylidine-alpha-D-ribofuranose | TargetMol | |
| 1692637 | TAR-TNU1197 | 5-O-Benzoyl-1,2,3-tri-O-acetyl-4-C-fluoromethyl-D-ribofuranose | TargetMol | |
| 1692636 | TAR-TNU1196 | 5-O-Benzoyl-1,2,3-tri-O-acetyl-4-C-methyl-D-ribofuranose | TargetMol | |
| 1692635 | TAR-TNU1195 | 5-O-Benzoyl-4-C-hydroxymethyl-2,3-O-isopropylidene-1-O-methyl-beta-D-ribofuranose | TargetMol | |
| 1692634 | TAR-TNU1194 | 4-C-Hydroxymethyl-2,3-O-isopropylidene-1-O-methyl-beta-D-ribofuranose | TargetMol | |
| 1692633 | TAR-TNU1193 | 1,2-Di-O-acetyl-3,5-di-O-benzoyl-3-beta-C-methyl-D-ribofuranose | TargetMol | |
| 1692632 | TAR-TNU1192 | N1-Methyl-d3-pseudouridine | TargetMol | |
| 1692631 | TAR-TNU1191 | 2?-Deoxy-N3-methylcytidine | TargetMol | |
| 1692630 | TAR-TNU1190 | N3-Methyl-5-methyluridine | TargetMol | |
| 1692629 | TAR-TNU1189 | N3-Methylthymidine | TargetMol | |
| 1692628 | TAR-TNU1188 | N3-Methyl-2?-deoxyuridine | TargetMol | |
| 1692627 | TAR-TNU1187 | N2-iso-Butyroyl-2?-deoxy-5?-O-(4,4?-dimethoxytrityl)-guanosine-3?-(4-nitrophenoxyl)butanedioate | TargetMol | |
| 1692626 | TAR-TNU1186 | 2?,3?-Bis(O-t-butyldimethylsilyl)-4?,5?-Didehydro-5?-deoxyuridine | TargetMol | |
| 1692625 | TAR-TNU1185 | 5?-Deoxy-5-methyluridine | TargetMol | |
| 1692624 | TAR-TNU1184 | 5?-Deoxyuridine | TargetMol | |
| 1692623 | TAR-TNU1183 | 2?,5?-Dideoxyuridine | TargetMol |